diff --git a/manage.py b/manage.py new file mode 100755 index 0000000..36e549c --- /dev/null +++ b/manage.py @@ -0,0 +1,22 @@ +#!/usr/bin/env python +"""Django's command-line utility for administrative tasks.""" +import os +import sys + + +def main(): + """Run administrative tasks.""" + os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'miclave.settings') + try: + from django.core.management import execute_from_command_line + except ImportError as exc: + raise ImportError( + "Couldn't import Django. Are you sure it's installed and " + "available on your PYTHONPATH environment variable? Did you " + "forget to activate a virtual environment?" + ) from exc + execute_from_command_line(sys.argv) + + +if __name__ == '__main__': + main() diff --git a/miclave/__init__.py b/miclave/__init__.py new file mode 100644 index 0000000..e69de29 diff --git a/miclave/asgi.py b/miclave/asgi.py new file mode 100644 index 0000000..2f66ff6 --- /dev/null +++ b/miclave/asgi.py @@ -0,0 +1,16 @@ +""" +ASGI config for miclave project. + +It exposes the ASGI callable as a module-level variable named ``application``. + +For more information on this file, see +https://docs.djangoproject.com/en/5.0/howto/deployment/asgi/ +""" + +import os + +from django.core.asgi import get_asgi_application + +os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'miclave.settings') + +application = get_asgi_application() diff --git a/miclave/settings.py b/miclave/settings.py new file mode 100644 index 0000000..a3b7b35 --- /dev/null +++ b/miclave/settings.py @@ -0,0 +1,131 @@ +""" +Django settings for miclave project. + +Generated by 'django-admin startproject' using Django 5.0.6. + +For more information on this file, see +https://docs.djangoproject.com/en/5.0/topics/settings/ + +For the full list of settings and their values, see +https://docs.djangoproject.com/en/5.0/ref/settings/ +""" + +import os +from pathlib import Path + +# Build paths inside the project like this: BASE_DIR / 'subdir'. +BASE_DIR = Path(__file__).resolve().parent.parent + + +# Quick-start development settings - unsuitable for production +# See https://docs.djangoproject.com/en/5.0/howto/deployment/checklist/ + +# SECURITY WARNING: keep the secret key used in production secret! +SECRET_KEY = 'django-insecure-6ejm^s9r+sfik-rihc)#x%@%^^_^9x13$b8g@stv@xk$ak+hat' + +# SECURITY WARNING: don't run with debug turned on in production! +DEBUG = True + +ALLOWED_HOSTS = ['10.191.157.193'] + + +# Application definition + +INSTALLED_APPS = [ + 'django.contrib.admin', + 'django.contrib.auth', + 'django.contrib.contenttypes', + 'django.contrib.sessions', + 'django.contrib.messages', + 'django.contrib.staticfiles', + 'users', +] + +MIDDLEWARE = [ + 'django.middleware.security.SecurityMiddleware', + 'django.contrib.sessions.middleware.SessionMiddleware', + 'django.middleware.common.CommonMiddleware', + 'django.middleware.csrf.CsrfViewMiddleware', + 'django.contrib.auth.middleware.AuthenticationMiddleware', + 'django.contrib.messages.middleware.MessageMiddleware', + 'django.middleware.clickjacking.XFrameOptionsMiddleware', +] + +ROOT_URLCONF = 'miclave.urls' + +TEMPLATES = [ + { + 'BACKEND': 'django.template.backends.django.DjangoTemplates', + 'DIRS': [], + 'APP_DIRS': True, + 'OPTIONS': { + 'context_processors': [ + 'django.template.context_processors.debug', + 'django.template.context_processors.request', + 'django.contrib.auth.context_processors.auth', + 'django.contrib.messages.context_processors.messages', + ], + }, + }, +] + +WSGI_APPLICATION = 'miclave.wsgi.application' + + +# Database +# https://docs.djangoproject.com/en/5.0/ref/settings/#databases + +DATABASES = { + 'default': { + 'ENGINE': 'django.db.backends.sqlite3', + 'NAME': BASE_DIR / 'db.sqlite3', + } +} + + +# Password validation +# https://docs.djangoproject.com/en/5.0/ref/settings/#auth-password-validators + +AUTH_PASSWORD_VALIDATORS = [ + { + 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator', + }, + { + 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', + }, + { + 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator', + }, + { + 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator', + }, +] + + +# Internationalization +# https://docs.djangoproject.com/en/5.0/topics/i18n/ + +LANGUAGE_CODE = 'en-us' + +TIME_ZONE = 'UTC' + +USE_I18N = True + +USE_TZ = True + + +# Static files (CSS, JavaScript, Images) +# https://docs.djangoproject.com/en/5.0/howto/static-files/ + +STATIC_URL = 'static/' + +STATIC_ROOT = os.path.join(BASE_DIR, 'staticfiles') + +STATICFILES_DIRS = [ + os.path.join(BASE_DIR, 'static'), +] + +# Default primary key field type +# https://docs.djangoproject.com/en/5.0/ref/settings/#default-auto-field + +DEFAULT_AUTO_FIELD = 'django.db.models.BigAutoField' diff --git a/miclave/urls.py b/miclave/urls.py new file mode 100644 index 0000000..9528db1 --- /dev/null +++ b/miclave/urls.py @@ -0,0 +1,24 @@ +""" +URL configuration for miclave project. + +The `urlpatterns` list routes URLs to views. For more information please see: + https://docs.djangoproject.com/en/5.0/topics/http/urls/ +Examples: +Function views + 1. Add an import: from my_app import views + 2. Add a URL to urlpatterns: path('', views.home, name='home') +Class-based views + 1. Add an import: from other_app.views import Home + 2. Add a URL to urlpatterns: path('', Home.as_view(), name='home') +Including another URLconf + 1. Import the include() function: from django.urls import include, path + 2. Add a URL to urlpatterns: path('blog/', include('blog.urls')) +""" +from django.contrib import admin +from django.urls import include, path + +urlpatterns = [ + path('admin/', admin.site.urls), + path('users/', include('users.urls')), +] + diff --git a/miclave/wsgi.py b/miclave/wsgi.py new file mode 100644 index 0000000..11b36fa --- /dev/null +++ b/miclave/wsgi.py @@ -0,0 +1,16 @@ +""" +WSGI config for miclave project. + +It exposes the WSGI callable as a module-level variable named ``application``. + +For more information on this file, see +https://docs.djangoproject.com/en/5.0/howto/deployment/wsgi/ +""" + +import os + +from django.core.wsgi import get_wsgi_application + +os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'miclave.settings') + +application = get_wsgi_application() diff --git a/static/css/pico.min.css b/static/css/pico.min.css new file mode 100644 index 0000000..2cfd2e4 --- /dev/null +++ b/static/css/pico.min.css @@ -0,0 +1,4 @@ +@charset "UTF-8";/*! + * Pico CSS ✨ v2.0.6 (https://picocss.com) + * Copyright 2019-2024 - Licensed under MIT + */:root{--pico-font-family-emoji:"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--pico-font-family-sans-serif:system-ui,"Segoe UI",Roboto,Oxygen,Ubuntu,Cantarell,Helvetica,Arial,"Helvetica Neue",sans-serif,var(--pico-font-family-emoji);--pico-font-family-monospace:ui-monospace,SFMono-Regular,"SF Mono",Menlo,Consolas,"Liberation Mono",monospace,var(--pico-font-family-emoji);--pico-font-family:var(--pico-font-family-sans-serif);--pico-line-height:1.5;--pico-font-weight:400;--pico-font-size:100%;--pico-text-underline-offset:0.1rem;--pico-border-radius:0.25rem;--pico-border-width:0.0625rem;--pico-outline-width:0.125rem;--pico-transition:0.2s ease-in-out;--pico-spacing:1rem;--pico-typography-spacing-vertical:1rem;--pico-block-spacing-vertical:var(--pico-spacing);--pico-block-spacing-horizontal:var(--pico-spacing);--pico-grid-column-gap:var(--pico-spacing);--pico-grid-row-gap:var(--pico-spacing);--pico-form-element-spacing-vertical:0.75rem;--pico-form-element-spacing-horizontal:1rem;--pico-group-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-primary-focus);--pico-group-box-shadow-focus-with-input:0 0 0 0.0625rem var(--pico-form-element-border-color);--pico-modal-overlay-backdrop-filter:blur(0.375rem);--pico-nav-element-spacing-vertical:1rem;--pico-nav-element-spacing-horizontal:0.5rem;--pico-nav-link-spacing-vertical:0.5rem;--pico-nav-link-spacing-horizontal:0.5rem;--pico-nav-breadcrumb-divider:">";--pico-icon-checkbox:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-minus:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='5' y1='12' x2='19' y2='12'%3E%3C/line%3E%3C/svg%3E");--pico-icon-chevron:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='6 9 12 15 18 9'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-date:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Crect x='3' y='4' width='18' height='18' rx='2' ry='2'%3E%3C/rect%3E%3Cline x1='16' y1='2' x2='16' y2='6'%3E%3C/line%3E%3Cline x1='8' y1='2' x2='8' y2='6'%3E%3C/line%3E%3Cline x1='3' y1='10' x2='21' y2='10'%3E%3C/line%3E%3C/svg%3E");--pico-icon-time:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cpolyline points='12 6 12 12 16 14'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-search:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='1.5' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E");--pico-icon-close:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");--pico-icon-loading:url("data:image/svg+xml,%3Csvg fill='none' height='24' width='24' viewBox='0 0 24 24' xmlns='http://www.w3.org/2000/svg' %3E%3Cstyle%3E g %7B animation: rotate 2s linear infinite; transform-origin: center center; %7D circle %7B stroke-dasharray: 75,100; stroke-dashoffset: -5; animation: dash 1.5s ease-in-out infinite; stroke-linecap: round; %7D @keyframes rotate %7B 0%25 %7B transform: rotate(0deg); %7D 100%25 %7B transform: rotate(360deg); %7D %7D @keyframes dash %7B 0%25 %7B stroke-dasharray: 1,100; stroke-dashoffset: 0; %7D 50%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -17.5; %7D 100%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -62; %7D %7D %3C/style%3E%3Cg%3E%3Ccircle cx='12' cy='12' r='10' fill='none' stroke='rgb(136, 145, 164)' stroke-width='4' /%3E%3C/g%3E%3C/svg%3E")}@media (min-width:576px){:root{--pico-font-size:106.25%}}@media (min-width:768px){:root{--pico-font-size:112.5%}}@media (min-width:1024px){:root{--pico-font-size:118.75%}}@media (min-width:1280px){:root{--pico-font-size:125%}}@media (min-width:1536px){:root{--pico-font-size:131.25%}}a{--pico-text-decoration:underline}a.contrast,a.secondary{--pico-text-decoration:underline}small{--pico-font-size:0.875em}h1,h2,h3,h4,h5,h6{--pico-font-weight:700}h1{--pico-font-size:2rem;--pico-line-height:1.125;--pico-typography-spacing-top:3rem}h2{--pico-font-size:1.75rem;--pico-line-height:1.15;--pico-typography-spacing-top:2.625rem}h3{--pico-font-size:1.5rem;--pico-line-height:1.175;--pico-typography-spacing-top:2.25rem}h4{--pico-font-size:1.25rem;--pico-line-height:1.2;--pico-typography-spacing-top:1.874rem}h5{--pico-font-size:1.125rem;--pico-line-height:1.225;--pico-typography-spacing-top:1.6875rem}h6{--pico-font-size:1rem;--pico-line-height:1.25;--pico-typography-spacing-top:1.5rem}tfoot td,tfoot th,thead td,thead th{--pico-font-weight:600;--pico-border-width:0.1875rem}code,kbd,pre,samp{--pico-font-family:var(--pico-font-family-monospace)}kbd{--pico-font-weight:bolder}:where(select,textarea),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-outline-width:0.0625rem}[type=search]{--pico-border-radius:5rem}[type=checkbox],[type=radio]{--pico-border-width:0.125rem}[type=checkbox][role=switch]{--pico-border-width:0.1875rem}details.dropdown summary:not([role=button]){--pico-outline-width:0.0625rem}nav details.dropdown summary:focus-visible{--pico-outline-width:0.125rem}[role=search]{--pico-border-radius:5rem}[role=group]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus),[role=search]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[role=group]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus),[role=search]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=submit],[role=search] button{--pico-form-element-spacing-horizontal:2rem}details summary[role=button]:not(.outline)::after{filter:brightness(0) invert(1)}[aria-busy=true]:not(input,select,textarea):is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0) invert(1)}:root:not([data-theme=dark]),[data-theme=light]{--pico-background-color:#fff;--pico-color:#373c44;--pico-text-selection-color:rgba(116, 139, 248, 0.25);--pico-muted-color:#646b79;--pico-muted-border-color:#e7eaf0;--pico-primary:#2060df;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(32, 96, 223, 0.5);--pico-primary-hover:#184eb8;--pico-primary-hover-background:#1d59d0;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(116, 139, 248, 0.5);--pico-primary-inverse:#fff;--pico-secondary:#5d6b89;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(93, 107, 137, 0.5);--pico-secondary-hover:#48536b;--pico-secondary-hover-background:#48536b;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(93, 107, 137, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#181c25;--pico-contrast-background:#181c25;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(24, 28, 37, 0.5);--pico-contrast-hover:#000;--pico-contrast-hover-background:#000;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-secondary-hover);--pico-contrast-focus:rgba(93, 107, 137, 0.25);--pico-contrast-inverse:#fff;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(129, 145, 181, 0.01698),0.0335rem 0.067rem 0.402rem rgba(129, 145, 181, 0.024),0.0625rem 0.125rem 0.75rem rgba(129, 145, 181, 0.03),0.1125rem 0.225rem 1.35rem rgba(129, 145, 181, 0.036),0.2085rem 0.417rem 2.502rem rgba(129, 145, 181, 0.04302),0.5rem 1rem 6rem rgba(129, 145, 181, 0.06),0 0 0 0.0625rem rgba(129, 145, 181, 0.015);--pico-h1-color:#2d3138;--pico-h2-color:#373c44;--pico-h3-color:#424751;--pico-h4-color:#4d535e;--pico-h5-color:#5c6370;--pico-h6-color:#646b79;--pico-mark-background-color:#fde7c0;--pico-mark-color:#0f1114;--pico-ins-color:#1d6a54;--pico-del-color:#883935;--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:#f3f5f7;--pico-code-color:#646b79;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:#fbfcfc;--pico-form-element-selected-background-color:#dfe3eb;--pico-form-element-border-color:#cfd5e2;--pico-form-element-color:#23262c;--pico-form-element-placeholder-color:var(--pico-muted-color);--pico-form-element-active-background-color:#fff;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:#b86a6b;--pico-form-element-invalid-active-border-color:#c84f48;--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#4c9b8a;--pico-form-element-valid-active-border-color:#279977;--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#bfc7d9;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#dfe3eb;--pico-range-active-border-color:#bfc7d9;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:var(--pico-background-color);--pico-card-border-color:var(--pico-muted-border-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:#fbfcfc;--pico-dropdown-background-color:#fff;--pico-dropdown-border-color:#eff1f4;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#eff1f4;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(232, 234, 237, 0.75);--pico-progress-background-color:#dfe3eb;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(76, 155, 138)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(200, 79, 72)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E");color-scheme:light}:root:not([data-theme=dark]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),[data-theme=light] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}@media only screen and (prefers-color-scheme:dark){:root:not([data-theme]){--pico-background-color:#13171f;--pico-color:#c2c7d0;--pico-text-selection-color:rgba(137, 153, 249, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#8999f9;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(137, 153, 249, 0.5);--pico-primary-hover:#aeb5fb;--pico-primary-hover-background:#3c71f7;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(137, 153, 249, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 9, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 9, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 9, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 9, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 9, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 9, 12, 0.06),0 0 0 0.0625rem rgba(7, 9, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:#ce7e7b;--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:#1a1f28;--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:#1c212c;--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:#1a1f28;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:#964a50;--pico-form-element-invalid-active-border-color:#b7403b;--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:#16896a;--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:#1a1f28;--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(8, 9, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(150, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E");color-scheme:dark}:root:not([data-theme]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}:root:not([data-theme]) details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}:root:not([data-theme]) [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}}[data-theme=dark]{--pico-background-color:#13171f;--pico-color:#c2c7d0;--pico-text-selection-color:rgba(137, 153, 249, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#8999f9;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(137, 153, 249, 0.5);--pico-primary-hover:#aeb5fb;--pico-primary-hover-background:#3c71f7;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(137, 153, 249, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 9, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 9, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 9, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 9, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 9, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 9, 12, 0.06),0 0 0 0.0625rem rgba(7, 9, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:#ce7e7b;--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:#1a1f28;--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:#1c212c;--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:#1a1f28;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:#964a50;--pico-form-element-invalid-active-border-color:#b7403b;--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:#16896a;--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:#1a1f28;--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(8, 9, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(150, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E");color-scheme:dark}[data-theme=dark] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}[data-theme=dark] details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}[data-theme=dark] [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}[type=checkbox],[type=radio],[type=range],progress{accent-color:var(--pico-primary)}*,::after,::before{box-sizing:border-box;background-repeat:no-repeat}::after,::before{text-decoration:inherit;vertical-align:inherit}:where(:root){-webkit-tap-highlight-color:transparent;-webkit-text-size-adjust:100%;-moz-text-size-adjust:100%;text-size-adjust:100%;background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family);text-underline-offset:var(--pico-text-underline-offset);text-rendering:optimizeLegibility;overflow-wrap:break-word;-moz-tab-size:4;-o-tab-size:4;tab-size:4}body{width:100%;margin:0}main{display:block}body>footer,body>header,body>main{padding-block:var(--pico-block-spacing-vertical)}section{margin-bottom:var(--pico-block-spacing-vertical)}.container,.container-fluid{width:100%;margin-right:auto;margin-left:auto;padding-right:var(--pico-spacing);padding-left:var(--pico-spacing)}@media (min-width:576px){.container{max-width:510px;padding-right:0;padding-left:0}}@media (min-width:768px){.container{max-width:700px}}@media (min-width:1024px){.container{max-width:950px}}@media (min-width:1280px){.container{max-width:1200px}}@media (min-width:1536px){.container{max-width:1450px}}.grid{grid-column-gap:var(--pico-grid-column-gap);grid-row-gap:var(--pico-grid-row-gap);display:grid;grid-template-columns:1fr}@media (min-width:768px){.grid{grid-template-columns:repeat(auto-fit,minmax(0%,1fr))}}.grid>*{min-width:0}.overflow-auto{overflow:auto}b,strong{font-weight:bolder}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}address,blockquote,dl,ol,p,pre,table,ul{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-style:normal;font-weight:var(--pico-font-weight)}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family)}h1{--pico-color:var(--pico-h1-color)}h2{--pico-color:var(--pico-h2-color)}h3{--pico-color:var(--pico-h3-color)}h4{--pico-color:var(--pico-h4-color)}h5{--pico-color:var(--pico-h5-color)}h6{--pico-color:var(--pico-h6-color)}:where(article,address,blockquote,dl,figure,form,ol,p,pre,table,ul)~:is(h1,h2,h3,h4,h5,h6){margin-top:var(--pico-typography-spacing-top)}p{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup>*{margin-top:0;margin-bottom:0}hgroup>:not(:first-child):last-child{--pico-color:var(--pico-muted-color);--pico-font-weight:unset;font-size:1rem}:where(ol,ul) li{margin-bottom:calc(var(--pico-typography-spacing-vertical) * .25)}:where(dl,ol,ul) :where(dl,ol,ul){margin:0;margin-top:calc(var(--pico-typography-spacing-vertical) * .25)}ul li{list-style:square}mark{padding:.125rem .25rem;background-color:var(--pico-mark-background-color);color:var(--pico-mark-color);vertical-align:baseline}blockquote{display:block;margin:var(--pico-typography-spacing-vertical) 0;padding:var(--pico-spacing);border-right:none;border-left:.25rem solid var(--pico-blockquote-border-color);border-inline-start:0.25rem solid var(--pico-blockquote-border-color);border-inline-end:none}blockquote footer{margin-top:calc(var(--pico-typography-spacing-vertical) * .5);color:var(--pico-blockquote-footer-color)}abbr[title]{border-bottom:1px dotted;text-decoration:none;cursor:help}ins{color:var(--pico-ins-color);text-decoration:none}del{color:var(--pico-del-color)}::-moz-selection{background-color:var(--pico-text-selection-color)}::selection{background-color:var(--pico-text-selection-color)}:where(a:not([role=button])),[role=link]{--pico-color:var(--pico-primary);--pico-background-color:transparent;--pico-underline:var(--pico-primary-underline);outline:0;background-color:var(--pico-background-color);color:var(--pico-color);-webkit-text-decoration:var(--pico-text-decoration);text-decoration:var(--pico-text-decoration);text-decoration-color:var(--pico-underline);text-underline-offset:0.125em;transition:background-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition)}:where(a:not([role=button])):is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-primary-hover);--pico-underline:var(--pico-primary-hover-underline);--pico-text-decoration:underline}:where(a:not([role=button])):focus-visible,[role=link]:focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}:where(a:not([role=button])).secondary,[role=link].secondary{--pico-color:var(--pico-secondary);--pico-underline:var(--pico-secondary-underline)}:where(a:not([role=button])).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-underline:var(--pico-secondary-hover-underline)}:where(a:not([role=button])).contrast,[role=link].contrast{--pico-color:var(--pico-contrast);--pico-underline:var(--pico-contrast-underline)}:where(a:not([role=button])).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-underline:var(--pico-contrast-hover-underline)}a[role=button]{display:inline-block}button{margin:0;overflow:visible;font-family:inherit;text-transform:none}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[role=button],[type=button],[type=file]::file-selector-button,[type=reset],[type=submit],button{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);--pico-color:var(--pico-primary-inverse);--pico-box-shadow:var(--pico-button-box-shadow, 0 0 0 rgba(0, 0, 0, 0));padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:1rem;line-height:var(--pico-line-height);text-align:center;text-decoration:none;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}[role=button]:is(:hover,:active,:focus),[role=button]:is([aria-current]:not([aria-current=false])),[type=button]:is(:hover,:active,:focus),[type=button]:is([aria-current]:not([aria-current=false])),[type=file]::file-selector-button:is(:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])),[type=reset]:is(:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false])),[type=submit]:is(:hover,:active,:focus),[type=submit]:is([aria-current]:not([aria-current=false])),button:is(:hover,:active,:focus),button:is([aria-current]:not([aria-current=false])){--pico-background-color:var(--pico-primary-hover-background);--pico-border-color:var(--pico-primary-hover-border);--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0));--pico-color:var(--pico-primary-inverse)}[role=button]:focus,[role=button]:is([aria-current]:not([aria-current=false])):focus,[type=button]:focus,[type=button]:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus,[type=submit]:focus,[type=submit]:is([aria-current]:not([aria-current=false])):focus,button:focus,button:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}[type=button],[type=reset],[type=submit]{margin-bottom:var(--pico-spacing)}:is(button,[type=submit],[type=button],[role=button]).secondary,[type=file]::file-selector-button,[type=reset]{--pico-background-color:var(--pico-secondary-background);--pico-border-color:var(--pico-secondary-border);--pico-color:var(--pico-secondary-inverse);cursor:pointer}:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border);--pico-color:var(--pico-secondary-inverse)}:is(button,[type=submit],[type=button],[role=button]).secondary:focus,:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}:is(button,[type=submit],[type=button],[role=button]).contrast{--pico-background-color:var(--pico-contrast-background);--pico-border-color:var(--pico-contrast-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-contrast-hover-background);--pico-border-color:var(--pico-contrast-hover-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:focus,:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}:is(button,[type=submit],[type=button],[role=button]).outline,[type=reset].outline{--pico-background-color:transparent;--pico-color:var(--pico-primary);--pico-border-color:var(--pico-primary)}:is(button,[type=submit],[type=button],[role=button]).outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:transparent;--pico-color:var(--pico-primary-hover);--pico-border-color:var(--pico-primary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary,[type=reset].outline{--pico-color:var(--pico-secondary);--pico-border-color:var(--pico-secondary)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-border-color:var(--pico-secondary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast{--pico-color:var(--pico-contrast);--pico-border-color:var(--pico-contrast)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-border-color:var(--pico-contrast-hover)}:where(button,[type=submit],[type=reset],[type=button],[role=button])[disabled],:where(fieldset[disabled]) :is(button,[type=submit],[type=button],[type=reset],[role=button]){opacity:.5;pointer-events:none}:where(table){width:100%;border-collapse:collapse;border-spacing:0;text-indent:0}td,th{padding:calc(var(--pico-spacing)/ 2) var(--pico-spacing);border-bottom:var(--pico-border-width) solid var(--pico-table-border-color);background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);text-align:left;text-align:start}tfoot td,tfoot th{border-top:var(--pico-border-width) solid var(--pico-table-border-color);border-bottom:0}table.striped tbody tr:nth-child(odd) td,table.striped tbody tr:nth-child(odd) th{background-color:var(--pico-table-row-stripped-background-color)}:where(audio,canvas,iframe,img,svg,video){vertical-align:middle}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}:where(iframe){border-style:none}img{max-width:100%;height:auto;border-style:none}:where(svg:not([fill])){fill:currentColor}svg:not(:root){overflow:hidden}code,kbd,pre,samp{font-size:.875em;font-family:var(--pico-font-family)}pre code{font-size:inherit;font-family:inherit}pre{-ms-overflow-style:scrollbar;overflow:auto}code,kbd,pre{border-radius:var(--pico-border-radius);background:var(--pico-code-background-color);color:var(--pico-code-color);font-weight:var(--pico-font-weight);line-height:initial}code,kbd{display:inline-block;padding:.375rem}pre{display:block;margin-bottom:var(--pico-spacing);overflow-x:auto}pre>code{display:block;padding:var(--pico-spacing);background:0 0;line-height:var(--pico-line-height)}kbd{background-color:var(--pico-code-kbd-background-color);color:var(--pico-code-kbd-color);vertical-align:baseline}figure{display:block;margin:0;padding:0}figure figcaption{padding:calc(var(--pico-spacing) * .5) 0;color:var(--pico-muted-color)}hr{height:0;margin:var(--pico-typography-spacing-vertical) 0;border:0;border-top:1px solid var(--pico-muted-border-color);color:inherit}[hidden],template{display:none!important}canvas{display:inline-block}input,optgroup,select,textarea{margin:0;font-size:1rem;line-height:var(--pico-line-height);font-family:inherit;letter-spacing:inherit}input{overflow:visible}select{text-transform:none}legend{max-width:100%;padding:0;color:inherit;white-space:normal}textarea{overflow:auto}[type=checkbox],[type=radio]{padding:0}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}::-moz-focus-inner{padding:0;border-style:none}:-moz-focusring{outline:0}:-moz-ui-invalid{box-shadow:none}::-ms-expand{display:none}[type=file],[type=range]{padding:0;border-width:0}input:not([type=checkbox],[type=radio],[type=range]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2)}fieldset{width:100%;margin:0;margin-bottom:var(--pico-spacing);padding:0;border:0}fieldset legend,label{display:block;margin-bottom:calc(var(--pico-spacing) * .375);color:var(--pico-color);font-weight:var(--pico-form-label-font-weight,var(--pico-font-weight))}fieldset legend{margin-bottom:calc(var(--pico-spacing) * .5)}button[type=submit],input:not([type=checkbox],[type=radio]),select,textarea{width:100%}input:not([type=checkbox],[type=radio],[type=range],[type=file]),select,textarea{-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal)}input,select,textarea{--pico-background-color:var(--pico-form-element-background-color);--pico-border-color:var(--pico-form-element-border-color);--pico-color:var(--pico-form-element-color);--pico-box-shadow:none;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[readonly]):is(:active,:focus){--pico-background-color:var(--pico-form-element-active-background-color)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[role=switch],[readonly]):is(:active,:focus){--pico-border-color:var(--pico-form-element-active-border-color)}:where(select,textarea):not([readonly]):focus,input:not([type=submit],[type=button],[type=reset],[type=range],[type=file],[readonly]):focus{--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}:where(fieldset[disabled]) :is(input:not([type=submit],[type=button],[type=reset]),select,textarea),input:not([type=submit],[type=button],[type=reset])[disabled],label[aria-disabled=true],select[disabled],textarea[disabled]{opacity:var(--pico-form-element-disabled-opacity);pointer-events:none}label[aria-disabled=true] input[disabled]{opacity:1}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid]{padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal)!important;padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=false]:not(select){background-image:var(--pico-icon-valid)}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=true]:not(select){background-image:var(--pico-icon-invalid)}:where(input,select,textarea)[aria-invalid=false]{--pico-border-color:var(--pico-form-element-valid-border-color)}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus){--pico-border-color:var(--pico-form-element-valid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-valid-focus-color)!important}:where(input,select,textarea)[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus){--pico-border-color:var(--pico-form-element-invalid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-invalid-focus-color)!important}[dir=rtl] :where(input,select,textarea):not([type=checkbox],[type=radio]):is([aria-invalid],[aria-invalid=true],[aria-invalid=false]){background-position:center left .75rem}input::-webkit-input-placeholder,input::placeholder,select:invalid,textarea::-webkit-input-placeholder,textarea::placeholder{color:var(--pico-form-element-placeholder-color);opacity:1}input:not([type=checkbox],[type=radio]),select,textarea{margin-bottom:var(--pico-spacing)}select::-ms-expand{border:0;background-color:transparent}select:not([multiple],[size]){padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal);padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);background-image:var(--pico-icon-chevron);background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}select[multiple] option:checked{background:var(--pico-form-element-selected-background-color);color:var(--pico-form-element-color)}[dir=rtl] select:not([multiple],[size]){background-position:center left .75rem}textarea{display:block;resize:vertical}textarea[aria-invalid]{--pico-icon-height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);background-position:top right .75rem!important;background-size:1rem var(--pico-icon-height)!important}:where(input,select,textarea,fieldset,.grid)+small{display:block;width:100%;margin-top:calc(var(--pico-spacing) * -.75);margin-bottom:var(--pico-spacing);color:var(--pico-muted-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=false]+small{color:var(--pico-ins-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=true]+small{color:var(--pico-del-color)}label>:where(input,select,textarea){margin-top:calc(var(--pico-spacing) * .25)}label:has([type=checkbox],[type=radio]){width:-moz-fit-content;width:fit-content;cursor:pointer}[type=checkbox],[type=radio]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:1.25em;height:1.25em;margin-top:-.125em;margin-inline-end:.5em;border-width:var(--pico-border-width);vertical-align:middle;cursor:pointer}[type=checkbox]::-ms-check,[type=radio]::-ms-check{display:none}[type=checkbox]:checked,[type=checkbox]:checked:active,[type=checkbox]:checked:focus,[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-checkbox);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=checkbox]~label,[type=radio]~label{display:inline-block;margin-bottom:0;cursor:pointer}[type=checkbox]~label:not(:last-of-type),[type=radio]~label:not(:last-of-type){margin-inline-end:1em}[type=checkbox]:indeterminate{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-minus);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=radio]{border-radius:50%}[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-inverse);border-width:.35em;background-image:none}[type=checkbox][role=switch]{--pico-background-color:var(--pico-switch-background-color);--pico-color:var(--pico-switch-color);width:2.25em;height:1.25em;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:1.25em;background-color:var(--pico-background-color);line-height:1.25em}[type=checkbox][role=switch]:not([aria-invalid]){--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:before{display:block;aspect-ratio:1;height:100%;border-radius:50%;background-color:var(--pico-color);box-shadow:var(--pico-switch-thumb-box-shadow);content:"";transition:margin .1s ease-in-out}[type=checkbox][role=switch]:focus{--pico-background-color:var(--pico-switch-background-color);--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:checked{--pico-background-color:var(--pico-switch-checked-background-color);--pico-border-color:var(--pico-switch-checked-background-color);background-image:none}[type=checkbox][role=switch]:checked::before{margin-inline-start:calc(2.25em - 1.25em)}[type=checkbox][role=switch][disabled]{--pico-background-color:var(--pico-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus{--pico-background-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true]{--pico-background-color:var(--pico-form-element-invalid-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus,[type=radio][aria-invalid=false]:checked,[type=radio][aria-invalid=false]:checked:active,[type=radio][aria-invalid=false]:checked:focus{--pico-border-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true],[type=radio]:checked:active[aria-invalid=true],[type=radio]:checked:focus[aria-invalid=true],[type=radio]:checked[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}[type=color]::-webkit-color-swatch-wrapper{padding:0}[type=color]::-moz-focus-inner{padding:0}[type=color]::-webkit-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}[type=color]::-moz-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}input:not([type=checkbox],[type=radio],[type=range],[type=file]):is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){--pico-icon-position:0.75rem;--pico-icon-width:1rem;padding-right:calc(var(--pico-icon-width) + var(--pico-icon-position));background-image:var(--pico-icon-date);background-position:center right var(--pico-icon-position);background-size:var(--pico-icon-width) auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=time]{background-image:var(--pico-icon-time)}[type=date]::-webkit-calendar-picker-indicator,[type=datetime-local]::-webkit-calendar-picker-indicator,[type=month]::-webkit-calendar-picker-indicator,[type=time]::-webkit-calendar-picker-indicator,[type=week]::-webkit-calendar-picker-indicator{width:var(--pico-icon-width);margin-right:calc(var(--pico-icon-width) * -1);margin-left:var(--pico-icon-position);opacity:0}@-moz-document url-prefix(){[type=date],[type=datetime-local],[type=month],[type=time],[type=week]{padding-right:var(--pico-form-element-spacing-horizontal)!important;background-image:none!important}}[dir=rtl] :is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){text-align:right}[type=file]{--pico-color:var(--pico-muted-color);margin-left:calc(var(--pico-outline-width) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) 0;padding-left:var(--pico-outline-width);border:0;border-radius:0;background:0 0}[type=file]::file-selector-button{margin-right:calc(var(--pico-spacing)/ 2);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal)}[type=file]:is(:hover,:active,:focus)::file-selector-button{--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border)}[type=file]:focus::file-selector-button{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[type=range]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:100%;height:1.25rem;background:0 0}[type=range]::-webkit-slider-runnable-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-webkit-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-moz-range-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-moz-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-ms-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-ms-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-webkit-slider-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-webkit-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-moz-range-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-moz-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-ms-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-ms-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]:active,[type=range]:focus-within{--pico-range-border-color:var(--pico-range-active-border-color);--pico-range-thumb-color:var(--pico-range-thumb-active-color)}[type=range]:active::-webkit-slider-thumb{transform:scale(1.25)}[type=range]:active::-moz-range-thumb{transform:scale(1.25)}[type=range]:active::-ms-thumb{transform:scale(1.25)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem);background-image:var(--pico-icon-search);background-position:center left calc(var(--pico-form-element-spacing-horizontal) + .125rem);background-size:1rem auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem)!important;background-position:center left 1.125rem,center right .75rem}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=false]{background-image:var(--pico-icon-search),var(--pico-icon-valid)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=true]{background-image:var(--pico-icon-search),var(--pico-icon-invalid)}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{background-position:center right 1.125rem}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{background-position:center right 1.125rem,center left .75rem}details{display:block;margin-bottom:var(--pico-spacing)}details summary{line-height:1rem;list-style-type:none;cursor:pointer;transition:color var(--pico-transition)}details summary:not([role]){color:var(--pico-accordion-close-summary-color)}details summary::-webkit-details-marker{display:none}details summary::marker{display:none}details summary::-moz-list-bullet{list-style-type:none}details summary::after{display:block;width:1rem;height:1rem;margin-inline-start:calc(var(--pico-spacing,1rem) * .5);float:right;transform:rotate(-90deg);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:"";transition:transform var(--pico-transition)}details summary:focus{outline:0}details summary:focus:not([role]){color:var(--pico-accordion-active-summary-color)}details summary:focus-visible:not([role]){outline:var(--pico-outline-width) solid var(--pico-primary-focus);outline-offset:calc(var(--pico-spacing,1rem) * 0.5);color:var(--pico-primary)}details summary[role=button]{width:100%;text-align:left}details summary[role=button]::after{height:calc(1rem * var(--pico-line-height,1.5))}details[open]>summary{margin-bottom:var(--pico-spacing)}details[open]>summary:not([role]):not(:focus){color:var(--pico-accordion-open-summary-color)}details[open]>summary::after{transform:rotate(0)}[dir=rtl] details summary{text-align:right}[dir=rtl] details summary::after{float:left;background-position:left center}article{margin-bottom:var(--pico-block-spacing-vertical);padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal);border-radius:var(--pico-border-radius);background:var(--pico-card-background-color);box-shadow:var(--pico-card-box-shadow)}article>footer,article>header{margin-right:calc(var(--pico-block-spacing-horizontal) * -1);margin-left:calc(var(--pico-block-spacing-horizontal) * -1);padding:calc(var(--pico-block-spacing-vertical) * .66) var(--pico-block-spacing-horizontal);background-color:var(--pico-card-sectioning-background-color)}article>header{margin-top:calc(var(--pico-block-spacing-vertical) * -1);margin-bottom:var(--pico-block-spacing-vertical);border-bottom:var(--pico-border-width) solid var(--pico-card-border-color);border-top-right-radius:var(--pico-border-radius);border-top-left-radius:var(--pico-border-radius)}article>footer{margin-top:var(--pico-block-spacing-vertical);margin-bottom:calc(var(--pico-block-spacing-vertical) * -1);border-top:var(--pico-border-width) solid var(--pico-card-border-color);border-bottom-right-radius:var(--pico-border-radius);border-bottom-left-radius:var(--pico-border-radius)}details.dropdown{position:relative;border-bottom:none}details.dropdown summary::after,details.dropdown>a::after,details.dropdown>button::after{display:block;width:1rem;height:calc(1rem * var(--pico-line-height,1.5));margin-inline-start:.25rem;float:right;transform:rotate(0) translateX(.2rem);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:""}nav details.dropdown{margin-bottom:0}details.dropdown summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-form-element-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-form-element-background-color);color:var(--pico-form-element-placeholder-color);line-height:inherit;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}details.dropdown summary:not([role]):active,details.dropdown summary:not([role]):focus{border-color:var(--pico-form-element-active-border-color);background-color:var(--pico-form-element-active-background-color)}details.dropdown summary:not([role]):focus{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}details.dropdown summary:not([role]):focus-visible{outline:0}details.dropdown summary:not([role])[aria-invalid=false]{--pico-form-element-border-color:var(--pico-form-element-valid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-valid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-valid-focus-color)}details.dropdown summary:not([role])[aria-invalid=true]{--pico-form-element-border-color:var(--pico-form-element-invalid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-invalid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-invalid-focus-color)}nav details.dropdown{display:inline;margin:calc(var(--pico-nav-element-spacing-vertical) * -1) 0}nav details.dropdown summary::after{transform:rotate(0) translateX(0)}nav details.dropdown summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-nav-link-spacing-vertical) * 2);padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav details.dropdown summary:not([role]):focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}details.dropdown summary+ul{display:flex;z-index:99;position:absolute;left:0;flex-direction:column;width:100%;min-width:-moz-fit-content;min-width:fit-content;margin:0;margin-top:var(--pico-outline-width);padding:0;border:var(--pico-border-width) solid var(--pico-dropdown-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-dropdown-background-color);box-shadow:var(--pico-dropdown-box-shadow);color:var(--pico-dropdown-color);white-space:nowrap;opacity:0;transition:opacity var(--pico-transition),transform 0s ease-in-out 1s}details.dropdown summary+ul[dir=rtl]{right:0;left:auto}details.dropdown summary+ul li{width:100%;margin-bottom:0;padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);list-style:none}details.dropdown summary+ul li:first-of-type{margin-top:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown summary+ul li:last-of-type{margin-bottom:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown summary+ul li a{display:block;margin:calc(var(--pico-form-element-spacing-vertical) * -.5) calc(var(--pico-form-element-spacing-horizontal) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);overflow:hidden;border-radius:0;color:var(--pico-dropdown-color);text-decoration:none;text-overflow:ellipsis}details.dropdown summary+ul li a:active,details.dropdown summary+ul li a:focus,details.dropdown summary+ul li a:focus-visible,details.dropdown summary+ul li a:hover,details.dropdown summary+ul li a[aria-current]:not([aria-current=false]){background-color:var(--pico-dropdown-hover-background-color)}details.dropdown summary+ul li label{width:100%}details.dropdown summary+ul li:has(label):hover{background-color:var(--pico-dropdown-hover-background-color)}details.dropdown[open] summary{margin-bottom:0}details.dropdown[open] summary+ul{transform:scaleY(1);opacity:1;transition:opacity var(--pico-transition),transform 0s ease-in-out 0s}details.dropdown[open] summary::before{display:block;z-index:1;position:fixed;width:100vw;height:100vh;inset:0;background:0 0;content:"";cursor:default}label>details.dropdown{margin-top:calc(var(--pico-spacing) * .25)}[role=group],[role=search]{display:inline-flex;position:relative;width:100%;margin-bottom:var(--pico-spacing);border-radius:var(--pico-border-radius);box-shadow:var(--pico-group-box-shadow,0 0 0 transparent);vertical-align:middle;transition:box-shadow var(--pico-transition)}[role=group] input:not([type=checkbox],[type=radio]),[role=group] select,[role=group]>*,[role=search] input:not([type=checkbox],[type=radio]),[role=search] select,[role=search]>*{position:relative;flex:1 1 auto;margin-bottom:0}[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=group]>:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child),[role=search]>:not(:first-child){margin-left:0;border-top-left-radius:0;border-bottom-left-radius:0}[role=group] input:not([type=checkbox],[type=radio]):not(:last-child),[role=group] select:not(:last-child),[role=group]>:not(:last-child),[role=search] input:not([type=checkbox],[type=radio]):not(:last-child),[role=search] select:not(:last-child),[role=search]>:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}[role=group] input:not([type=checkbox],[type=radio]):focus,[role=group] select:focus,[role=group]>:focus,[role=search] input:not([type=checkbox],[type=radio]):focus,[role=search] select:focus,[role=search]>:focus{z-index:2}[role=group] [role=button]:not(:first-child),[role=group] [type=button]:not(:first-child),[role=group] [type=reset]:not(:first-child),[role=group] [type=submit]:not(:first-child),[role=group] button:not(:first-child),[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=search] [role=button]:not(:first-child),[role=search] [type=button]:not(:first-child),[role=search] [type=reset]:not(:first-child),[role=search] [type=submit]:not(:first-child),[role=search] button:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child){margin-left:calc(var(--pico-border-width) * -1)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=reset],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=reset],[role=search] [type=submit],[role=search] button{width:auto}@supports selector(:has(*)){[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-button)}[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select,[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select{border-color:transparent}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus),[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-input)}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) button,[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) button{--pico-button-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-border);--pico-button-hover-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-hover-border)}[role=group] [role=button]:focus,[role=group] [type=button]:focus,[role=group] [type=reset]:focus,[role=group] [type=submit]:focus,[role=group] button:focus,[role=search] [role=button]:focus,[role=search] [type=button]:focus,[role=search] [type=reset]:focus,[role=search] [type=submit]:focus,[role=search] button:focus{box-shadow:none}}[role=search]>:first-child{border-top-left-radius:5rem;border-bottom-left-radius:5rem}[role=search]>:last-child{border-top-right-radius:5rem;border-bottom-right-radius:5rem}[aria-busy=true]:not(input,select,textarea,html){white-space:nowrap}[aria-busy=true]:not(input,select,textarea,html)::before{display:inline-block;width:1em;height:1em;background-image:var(--pico-icon-loading);background-size:1em auto;background-repeat:no-repeat;content:"";vertical-align:-.125em}[aria-busy=true]:not(input,select,textarea,html):not(:empty)::before{margin-inline-end:calc(var(--pico-spacing) * .5)}[aria-busy=true]:not(input,select,textarea,html):empty{text-align:center}[role=button][aria-busy=true],[type=button][aria-busy=true],[type=reset][aria-busy=true],[type=submit][aria-busy=true],a[aria-busy=true],button[aria-busy=true]{pointer-events:none}:root{--pico-scrollbar-width:0px}dialog{display:flex;z-index:999;position:fixed;top:0;right:0;bottom:0;left:0;align-items:center;justify-content:center;width:inherit;min-width:100%;height:inherit;min-height:100%;padding:0;border:0;-webkit-backdrop-filter:var(--pico-modal-overlay-backdrop-filter);backdrop-filter:var(--pico-modal-overlay-backdrop-filter);background-color:var(--pico-modal-overlay-background-color);color:var(--pico-color)}dialog article{width:100%;max-height:calc(100vh - var(--pico-spacing) * 2);margin:var(--pico-spacing);overflow:auto}@media (min-width:576px){dialog article{max-width:510px}}@media (min-width:768px){dialog article{max-width:700px}}dialog article>header>*{margin-bottom:0}dialog article>header .close,dialog article>header :is(a,button)[rel=prev]{margin:0;margin-left:var(--pico-spacing);padding:0;float:right}dialog article>footer{text-align:right}dialog article>footer [role=button],dialog article>footer button{margin-bottom:0}dialog article>footer [role=button]:not(:first-of-type),dialog article>footer button:not(:first-of-type){margin-left:calc(var(--pico-spacing) * .5)}dialog article .close,dialog article :is(a,button)[rel=prev]{display:block;width:1rem;height:1rem;margin-top:calc(var(--pico-spacing) * -1);margin-bottom:var(--pico-spacing);margin-left:auto;border:none;background-image:var(--pico-icon-close);background-position:center;background-size:auto 1rem;background-repeat:no-repeat;background-color:transparent;opacity:.5;transition:opacity var(--pico-transition)}dialog article .close:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),dialog article :is(a,button)[rel=prev]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){opacity:1}dialog:not([open]),dialog[open=false]{display:none}.modal-is-open{padding-right:var(--pico-scrollbar-width,0);overflow:hidden;pointer-events:none;touch-action:none}.modal-is-open dialog{pointer-events:auto;touch-action:auto}:where(.modal-is-opening,.modal-is-closing) dialog,:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-duration:.2s;animation-timing-function:ease-in-out;animation-fill-mode:both}:where(.modal-is-opening,.modal-is-closing) dialog{animation-duration:.8s;animation-name:modal-overlay}:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-delay:.2s;animation-name:modal}.modal-is-closing dialog,.modal-is-closing dialog>article{animation-delay:0s;animation-direction:reverse}@keyframes modal-overlay{from{-webkit-backdrop-filter:none;backdrop-filter:none;background-color:transparent}}@keyframes modal{from{transform:translateY(-100%);opacity:0}}:where(nav li)::before{float:left;content:"​"}nav,nav ul{display:flex}nav{justify-content:space-between;overflow:visible}nav ol,nav ul{align-items:center;margin-bottom:0;padding:0;list-style:none}nav ol:first-of-type,nav ul:first-of-type{margin-left:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav ol:last-of-type,nav ul:last-of-type{margin-right:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav li{display:inline-block;margin:0;padding:var(--pico-nav-element-spacing-vertical) var(--pico-nav-element-spacing-horizontal)}nav li :where(a,[role=link]){display:inline-block;margin:calc(var(--pico-nav-link-spacing-vertical) * -1) calc(var(--pico-nav-link-spacing-horizontal) * -1);padding:var(--pico-nav-link-spacing-vertical) var(--pico-nav-link-spacing-horizontal);border-radius:var(--pico-border-radius)}nav li :where(a,[role=link]):not(:hover){text-decoration:none}nav li [role=button],nav li [type=button],nav li button,nav li input:not([type=checkbox],[type=radio],[type=range],[type=file]),nav li select{height:auto;margin-right:inherit;margin-bottom:0;margin-left:inherit;padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb]{align-items:center;justify-content:start}nav[aria-label=breadcrumb] ul li:not(:first-child){margin-inline-start:var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb] ul li a{margin:calc(var(--pico-nav-link-spacing-vertical) * -1) 0;margin-inline-start:calc(var(--pico-nav-link-spacing-horizontal) * -1)}nav[aria-label=breadcrumb] ul li:not(:last-child)::after{display:inline-block;position:absolute;width:calc(var(--pico-nav-link-spacing-horizontal) * 4);margin:0 calc(var(--pico-nav-link-spacing-horizontal) * -1);content:var(--pico-nav-breadcrumb-divider);color:var(--pico-muted-color);text-align:center;text-decoration:none;white-space:nowrap}nav[aria-label=breadcrumb] a[aria-current]:not([aria-current=false]){background-color:transparent;color:inherit;text-decoration:none;pointer-events:none}aside li,aside nav,aside ol,aside ul{display:block}aside li{padding:calc(var(--pico-nav-element-spacing-vertical) * .5) var(--pico-nav-element-spacing-horizontal)}aside li a{display:block}aside li [role=button]{margin:inherit}[dir=rtl] nav[aria-label=breadcrumb] ul li:not(:last-child) ::after{content:"\\"}progress{display:inline-block;vertical-align:baseline}progress{-webkit-appearance:none;-moz-appearance:none;display:inline-block;appearance:none;width:100%;height:.5rem;margin-bottom:calc(var(--pico-spacing) * .5);overflow:hidden;border:0;border-radius:var(--pico-border-radius);background-color:var(--pico-progress-background-color);color:var(--pico-progress-color)}progress::-webkit-progress-bar{border-radius:var(--pico-border-radius);background:0 0}progress[value]::-webkit-progress-value{background-color:var(--pico-progress-color);-webkit-transition:inline-size var(--pico-transition);transition:inline-size var(--pico-transition)}progress::-moz-progress-bar{background-color:var(--pico-progress-color)}@media (prefers-reduced-motion:no-preference){progress:indeterminate{background:var(--pico-progress-background-color) linear-gradient(to right,var(--pico-progress-color) 30%,var(--pico-progress-background-color) 30%) top left/150% 150% no-repeat;animation:progress-indeterminate 1s linear infinite}progress:indeterminate[value]::-webkit-progress-value{background-color:transparent}progress:indeterminate::-moz-progress-bar{background-color:transparent}}@media (prefers-reduced-motion:no-preference){[dir=rtl] progress:indeterminate{animation-direction:reverse}}@keyframes progress-indeterminate{0%{background-position:200% 0}100%{background-position:-200% 0}}[data-tooltip]{position:relative}[data-tooltip]:not(a,button,input){border-bottom:1px dotted;text-decoration:none;cursor:help}[data-tooltip]::after,[data-tooltip]::before,[data-tooltip][data-placement=top]::after,[data-tooltip][data-placement=top]::before{display:block;z-index:99;position:absolute;bottom:100%;left:50%;padding:.25rem .5rem;overflow:hidden;transform:translate(-50%,-.25rem);border-radius:var(--pico-border-radius);background:var(--pico-tooltip-background-color);content:attr(data-tooltip);color:var(--pico-tooltip-color);font-style:normal;font-weight:var(--pico-font-weight);font-size:.875rem;text-decoration:none;text-overflow:ellipsis;white-space:nowrap;opacity:0;pointer-events:none}[data-tooltip]::after,[data-tooltip][data-placement=top]::after{padding:0;transform:translate(-50%,0);border-top:.3rem solid;border-right:.3rem solid transparent;border-left:.3rem solid transparent;border-radius:0;background-color:transparent;content:"";color:var(--pico-tooltip-background-color)}[data-tooltip][data-placement=bottom]::after,[data-tooltip][data-placement=bottom]::before{top:100%;bottom:auto;transform:translate(-50%,.25rem)}[data-tooltip][data-placement=bottom]:after{transform:translate(-50%,-.3rem);border:.3rem solid transparent;border-bottom:.3rem solid}[data-tooltip][data-placement=left]::after,[data-tooltip][data-placement=left]::before{top:50%;right:100%;bottom:auto;left:auto;transform:translate(-.25rem,-50%)}[data-tooltip][data-placement=left]:after{transform:translate(.3rem,-50%);border:.3rem solid transparent;border-left:.3rem solid}[data-tooltip][data-placement=right]::after,[data-tooltip][data-placement=right]::before{top:50%;right:auto;bottom:auto;left:100%;transform:translate(.25rem,-50%)}[data-tooltip][data-placement=right]:after{transform:translate(-.3rem,-50%);border:.3rem solid transparent;border-right:.3rem solid}[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{opacity:1}@media (hover:hover) and (pointer:fine){[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{--pico-tooltip-slide-to:translate(-50%, -0.25rem);transform:translate(-50%,.75rem);animation-duration:.2s;animation-fill-mode:forwards;animation-name:tooltip-slide;opacity:0}[data-tooltip]:focus::after,[data-tooltip]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, 0rem);transform:translate(-50%,-.25rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:focus::before,[data-tooltip][data-placement=bottom]:hover::after,[data-tooltip][data-placement=bottom]:hover::before{--pico-tooltip-slide-to:translate(-50%, 0.25rem);transform:translate(-50%,-.75rem);animation-name:tooltip-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, -0.3rem);transform:translate(-50%,-.5rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:focus::before,[data-tooltip][data-placement=left]:hover::after,[data-tooltip][data-placement=left]:hover::before{--pico-tooltip-slide-to:translate(-0.25rem, -50%);transform:translate(.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:hover::after{--pico-tooltip-caret-slide-to:translate(0.3rem, -50%);transform:translate(.05rem,-50%);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:focus::before,[data-tooltip][data-placement=right]:hover::after,[data-tooltip][data-placement=right]:hover::before{--pico-tooltip-slide-to:translate(0.25rem, -50%);transform:translate(-.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:hover::after{--pico-tooltip-caret-slide-to:translate(-0.3rem, -50%);transform:translate(-.05rem,-50%);animation-name:tooltip-caret-slide}}@keyframes tooltip-slide{to{transform:var(--pico-tooltip-slide-to);opacity:1}}@keyframes tooltip-caret-slide{50%{opacity:0}to{transform:var(--pico-tooltip-caret-slide-to);opacity:1}}[aria-controls]{cursor:pointer}[aria-disabled=true],[disabled]{cursor:not-allowed}[aria-hidden=false][hidden]{display:initial}[aria-hidden=false][hidden]:not(:focus){clip:rect(0,0,0,0);position:absolute}[tabindex],a,area,button,input,label,select,summary,textarea{-ms-touch-action:manipulation}[dir=rtl]{direction:rtl}@media (prefers-reduced-motion:reduce){:not([aria-busy=true]),:not([aria-busy=true])::after,:not([aria-busy=true])::before{background-attachment:initial!important;animation-duration:1ms!important;animation-delay:-1ms!important;animation-iteration-count:1!important;scroll-behavior:auto!important;transition-delay:0s!important;transition-duration:0s!important}} \ No newline at end of file diff --git a/staticfiles/admin/css/autocomplete.css b/staticfiles/admin/css/autocomplete.css new file mode 100644 index 0000000..69c94e7 --- /dev/null +++ b/staticfiles/admin/css/autocomplete.css @@ -0,0 +1,275 @@ +select.admin-autocomplete { + width: 20em; +} + +.select2-container--admin-autocomplete.select2-container { + min-height: 30px; +} + +.select2-container--admin-autocomplete .select2-selection--single, +.select2-container--admin-autocomplete .select2-selection--multiple { + min-height: 30px; + padding: 0; +} + +.select2-container--admin-autocomplete.select2-container--focus .select2-selection, +.select2-container--admin-autocomplete.select2-container--open .select2-selection { + border-color: var(--body-quiet-color); + min-height: 30px; +} + +.select2-container--admin-autocomplete.select2-container--focus .select2-selection.select2-selection--single, +.select2-container--admin-autocomplete.select2-container--open .select2-selection.select2-selection--single { + padding: 0; +} + +.select2-container--admin-autocomplete.select2-container--focus .select2-selection.select2-selection--multiple, +.select2-container--admin-autocomplete.select2-container--open .select2-selection.select2-selection--multiple { + padding: 0; +} + +.select2-container--admin-autocomplete .select2-selection--single { + background-color: var(--body-bg); + border: 1px solid var(--border-color); + border-radius: 4px; +} + +.select2-container--admin-autocomplete .select2-selection--single .select2-selection__rendered { + color: var(--body-fg); + line-height: 30px; +} + +.select2-container--admin-autocomplete .select2-selection--single .select2-selection__clear { + cursor: pointer; + float: right; + font-weight: bold; +} + +.select2-container--admin-autocomplete .select2-selection--single .select2-selection__placeholder { + color: var(--body-quiet-color); +} + +.select2-container--admin-autocomplete .select2-selection--single .select2-selection__arrow { + height: 26px; + position: absolute; + top: 1px; + right: 1px; + width: 20px; +} + +.select2-container--admin-autocomplete .select2-selection--single .select2-selection__arrow b { + border-color: #888 transparent transparent transparent; + border-style: solid; + border-width: 5px 4px 0 4px; + height: 0; + left: 50%; + margin-left: -4px; + margin-top: -2px; + position: absolute; + top: 50%; + width: 0; +} + +.select2-container--admin-autocomplete[dir="rtl"] .select2-selection--single .select2-selection__clear { + float: left; +} + +.select2-container--admin-autocomplete[dir="rtl"] .select2-selection--single .select2-selection__arrow { + left: 1px; + right: auto; +} + +.select2-container--admin-autocomplete.select2-container--disabled .select2-selection--single { + background-color: var(--darkened-bg); + cursor: default; +} + +.select2-container--admin-autocomplete.select2-container--disabled .select2-selection--single .select2-selection__clear { + display: none; +} + +.select2-container--admin-autocomplete.select2-container--open .select2-selection--single .select2-selection__arrow b { + border-color: transparent transparent #888 transparent; + border-width: 0 4px 5px 4px; +} + +.select2-container--admin-autocomplete .select2-selection--multiple { + background-color: var(--body-bg); + border: 1px solid var(--border-color); + border-radius: 4px; + cursor: text; +} + +.select2-container--admin-autocomplete .select2-selection--multiple .select2-selection__rendered { + box-sizing: border-box; + list-style: none; + margin: 0; + padding: 0 10px 5px 5px; + width: 100%; + display: flex; + flex-wrap: wrap; +} + +.select2-container--admin-autocomplete .select2-selection--multiple .select2-selection__rendered li { + list-style: none; +} + +.select2-container--admin-autocomplete .select2-selection--multiple .select2-selection__placeholder { + color: var(--body-quiet-color); + margin-top: 5px; + float: left; +} + +.select2-container--admin-autocomplete .select2-selection--multiple .select2-selection__clear { + cursor: pointer; + float: right; + font-weight: bold; + margin: 5px; + position: absolute; + right: 0; +} + +.select2-container--admin-autocomplete .select2-selection--multiple .select2-selection__choice { + background-color: var(--darkened-bg); + border: 1px solid var(--border-color); + border-radius: 4px; + cursor: default; + float: left; + margin-right: 5px; + margin-top: 5px; + padding: 0 5px; +} + +.select2-container--admin-autocomplete .select2-selection--multiple .select2-selection__choice__remove { + color: var(--body-quiet-color); + cursor: pointer; + display: inline-block; + font-weight: bold; + margin-right: 2px; +} + +.select2-container--admin-autocomplete .select2-selection--multiple .select2-selection__choice__remove:hover { + color: var(--body-fg); +} + +.select2-container--admin-autocomplete[dir="rtl"] .select2-selection--multiple .select2-selection__choice, .select2-container--admin-autocomplete[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder, .select2-container--admin-autocomplete[dir="rtl"] .select2-selection--multiple .select2-search--inline { + float: right; +} + +.select2-container--admin-autocomplete[dir="rtl"] .select2-selection--multiple .select2-selection__choice { + margin-left: 5px; + margin-right: auto; +} + +.select2-container--admin-autocomplete[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove { + margin-left: 2px; + margin-right: auto; +} + +.select2-container--admin-autocomplete.select2-container--focus .select2-selection--multiple { + border: solid var(--body-quiet-color) 1px; + outline: 0; +} + +.select2-container--admin-autocomplete.select2-container--disabled .select2-selection--multiple { + background-color: var(--darkened-bg); + cursor: default; +} + +.select2-container--admin-autocomplete.select2-container--disabled .select2-selection__choice__remove { + display: none; +} + +.select2-container--admin-autocomplete.select2-container--open.select2-container--above .select2-selection--single, .select2-container--admin-autocomplete.select2-container--open.select2-container--above .select2-selection--multiple { + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.select2-container--admin-autocomplete.select2-container--open.select2-container--below .select2-selection--single, .select2-container--admin-autocomplete.select2-container--open.select2-container--below .select2-selection--multiple { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +.select2-container--admin-autocomplete .select2-search--dropdown { + background: var(--darkened-bg); +} + +.select2-container--admin-autocomplete .select2-search--dropdown .select2-search__field { + background: var(--body-bg); + color: var(--body-fg); + border: 1px solid var(--border-color); + border-radius: 4px; +} + +.select2-container--admin-autocomplete .select2-search--inline .select2-search__field { + background: transparent; + color: var(--body-fg); + border: none; + outline: 0; + box-shadow: none; + -webkit-appearance: textfield; +} + +.select2-container--admin-autocomplete .select2-results > .select2-results__options { + max-height: 200px; + overflow-y: auto; + color: var(--body-fg); + background: var(--body-bg); +} + +.select2-container--admin-autocomplete .select2-results__option[role=group] { + padding: 0; +} + +.select2-container--admin-autocomplete .select2-results__option[aria-disabled=true] { + color: var(--body-quiet-color); +} + +.select2-container--admin-autocomplete .select2-results__option[aria-selected=true] { + background-color: var(--selected-bg); + color: var(--body-fg); +} + +.select2-container--admin-autocomplete .select2-results__option .select2-results__option { + padding-left: 1em; +} + +.select2-container--admin-autocomplete .select2-results__option .select2-results__option .select2-results__group { + padding-left: 0; +} + +.select2-container--admin-autocomplete .select2-results__option .select2-results__option .select2-results__option { + margin-left: -1em; + padding-left: 2em; +} + +.select2-container--admin-autocomplete .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -2em; + padding-left: 3em; +} + +.select2-container--admin-autocomplete .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -3em; + padding-left: 4em; +} + +.select2-container--admin-autocomplete .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -4em; + padding-left: 5em; +} + +.select2-container--admin-autocomplete .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -5em; + padding-left: 6em; +} + +.select2-container--admin-autocomplete .select2-results__option--highlighted[aria-selected] { + background-color: var(--primary); + color: var(--primary-fg); +} + +.select2-container--admin-autocomplete .select2-results__group { + cursor: default; + display: block; + padding: 6px; +} diff --git a/staticfiles/admin/css/base.css b/staticfiles/admin/css/base.css new file mode 100644 index 0000000..44f2fc8 --- /dev/null +++ b/staticfiles/admin/css/base.css @@ -0,0 +1,1156 @@ +/* + DJANGO Admin styles +*/ + +/* VARIABLE DEFINITIONS */ +html[data-theme="light"], +:root { + --primary: #79aec8; + --secondary: #417690; + --accent: #f5dd5d; + --primary-fg: #fff; + + --body-fg: #333; + --body-bg: #fff; + --body-quiet-color: #666; + --body-loud-color: #000; + + --header-color: #ffc; + --header-branding-color: var(--accent); + --header-bg: var(--secondary); + --header-link-color: var(--primary-fg); + + --breadcrumbs-fg: #c4dce8; + --breadcrumbs-link-fg: var(--body-bg); + --breadcrumbs-bg: #264b5d; + + --link-fg: #417893; + --link-hover-color: #036; + --link-selected-fg: var(--secondary); + + --hairline-color: #e8e8e8; + --border-color: #ccc; + + --error-fg: #ba2121; + + --message-success-bg: #dfd; + --message-warning-bg: #ffc; + --message-error-bg: #ffefef; + + --darkened-bg: #f8f8f8; /* A bit darker than --body-bg */ + --selected-bg: #e4e4e4; /* E.g. selected table cells */ + --selected-row: #ffc; + + --button-fg: #fff; + --button-bg: var(--secondary); + --button-hover-bg: #205067; + --default-button-bg: #205067; + --default-button-hover-bg: var(--secondary); + --close-button-bg: #747474; + --close-button-hover-bg: #333; + --delete-button-bg: #ba2121; + --delete-button-hover-bg: #a41515; + + --object-tools-fg: var(--button-fg); + --object-tools-bg: var(--close-button-bg); + --object-tools-hover-bg: var(--close-button-hover-bg); + + --font-family-primary: + "Segoe UI", + system-ui, + Roboto, + "Helvetica Neue", + Arial, + sans-serif, + "Apple Color Emoji", + "Segoe UI Emoji", + "Segoe UI Symbol", + "Noto Color Emoji"; + --font-family-monospace: + ui-monospace, + Menlo, + Monaco, + "Cascadia Mono", + "Segoe UI Mono", + "Roboto Mono", + "Oxygen Mono", + "Ubuntu Monospace", + "Source Code Pro", + "Fira Mono", + "Droid Sans Mono", + "Courier New", + monospace, + "Apple Color Emoji", + "Segoe UI Emoji", + "Segoe UI Symbol", + "Noto Color Emoji"; +} + +html, body { + height: 100%; +} + +body { + margin: 0; + padding: 0; + font-size: 0.875rem; + font-family: var(--font-family-primary); + color: var(--body-fg); + background: var(--body-bg); +} + +/* LINKS */ + +a:link, a:visited { + color: var(--link-fg); + text-decoration: none; + transition: color 0.15s, background 0.15s; +} + +a:focus, a:hover { + color: var(--link-hover-color); +} + +a:focus { + text-decoration: underline; +} + +a img { + border: none; +} + +a.section:link, a.section:visited { + color: var(--header-link-color); + text-decoration: none; +} + +a.section:focus, a.section:hover { + text-decoration: underline; +} + +/* GLOBAL DEFAULTS */ + +p, ol, ul, dl { + margin: .2em 0 .8em 0; +} + +p { + padding: 0; + line-height: 140%; +} + +h1,h2,h3,h4,h5 { + font-weight: bold; +} + +h1 { + margin: 0 0 20px; + font-weight: 300; + font-size: 1.25rem; + color: var(--body-quiet-color); +} + +h2 { + font-size: 1rem; + margin: 1em 0 .5em 0; +} + +h2.subhead { + font-weight: normal; + margin-top: 0; +} + +h3 { + font-size: 0.875rem; + margin: .8em 0 .3em 0; + color: var(--body-quiet-color); + font-weight: bold; +} + +h4 { + font-size: 0.75rem; + margin: 1em 0 .8em 0; + padding-bottom: 3px; +} + +h5 { + font-size: 0.625rem; + margin: 1.5em 0 .5em 0; + color: var(--body-quiet-color); + text-transform: uppercase; + letter-spacing: 1px; +} + +ul > li { + list-style-type: square; + padding: 1px 0; +} + +li ul { + margin-bottom: 0; +} + +li, dt, dd { + font-size: 0.8125rem; + line-height: 1.25rem; +} + +dt { + font-weight: bold; + margin-top: 4px; +} + +dd { + margin-left: 0; +} + +form { + margin: 0; + padding: 0; +} + +fieldset { + margin: 0; + min-width: 0; + padding: 0; + border: none; + border-top: 1px solid var(--hairline-color); +} + +blockquote { + font-size: 0.6875rem; + color: #777; + margin-left: 2px; + padding-left: 10px; + border-left: 5px solid #ddd; +} + +code, pre { + font-family: var(--font-family-monospace); + color: var(--body-quiet-color); + font-size: 0.75rem; + overflow-x: auto; +} + +pre.literal-block { + margin: 10px; + background: var(--darkened-bg); + padding: 6px 8px; +} + +code strong { + color: #930; +} + +hr { + clear: both; + color: var(--hairline-color); + background-color: var(--hairline-color); + height: 1px; + border: none; + margin: 0; + padding: 0; + line-height: 1px; +} + +/* TEXT STYLES & MODIFIERS */ + +.small { + font-size: 0.6875rem; +} + +.mini { + font-size: 0.625rem; +} + +.help, p.help, form p.help, div.help, form div.help, div.help li { + font-size: 0.6875rem; + color: var(--body-quiet-color); +} + +div.help ul { + margin-bottom: 0; +} + +.help-tooltip { + cursor: help; +} + +p img, h1 img, h2 img, h3 img, h4 img, td img { + vertical-align: middle; +} + +.quiet, a.quiet:link, a.quiet:visited { + color: var(--body-quiet-color); + font-weight: normal; +} + +.clear { + clear: both; +} + +.nowrap { + white-space: nowrap; +} + +.hidden { + display: none !important; +} + +/* TABLES */ + +table { + border-collapse: collapse; + border-color: var(--border-color); +} + +td, th { + font-size: 0.8125rem; + line-height: 1rem; + border-bottom: 1px solid var(--hairline-color); + vertical-align: top; + padding: 8px; +} + +th { + font-weight: 600; + text-align: left; +} + +thead th, +tfoot td { + color: var(--body-quiet-color); + padding: 5px 10px; + font-size: 0.6875rem; + background: var(--body-bg); + border: none; + border-top: 1px solid var(--hairline-color); + border-bottom: 1px solid var(--hairline-color); +} + +tfoot td { + border-bottom: none; + border-top: 1px solid var(--hairline-color); +} + +thead th.required { + color: var(--body-loud-color); +} + +tr.alt { + background: var(--darkened-bg); +} + +tr:nth-child(odd), .row-form-errors { + background: var(--body-bg); +} + +tr:nth-child(even), +tr:nth-child(even) .errorlist, +tr:nth-child(odd) + .row-form-errors, +tr:nth-child(odd) + .row-form-errors .errorlist { + background: var(--darkened-bg); +} + +/* SORTABLE TABLES */ + +thead th { + padding: 5px 10px; + line-height: normal; + text-transform: uppercase; + background: var(--darkened-bg); +} + +thead th a:link, thead th a:visited { + color: var(--body-quiet-color); +} + +thead th.sorted { + background: var(--selected-bg); +} + +thead th.sorted .text { + padding-right: 42px; +} + +table thead th .text span { + padding: 8px 10px; + display: block; +} + +table thead th .text a { + display: block; + cursor: pointer; + padding: 8px 10px; +} + +table thead th .text a:focus, table thead th .text a:hover { + background: var(--selected-bg); +} + +thead th.sorted a.sortremove { + visibility: hidden; +} + +table thead th.sorted:hover a.sortremove { + visibility: visible; +} + +table thead th.sorted .sortoptions { + display: block; + padding: 9px 5px 0 5px; + float: right; + text-align: right; +} + +table thead th.sorted .sortpriority { + font-size: .8em; + min-width: 12px; + text-align: center; + vertical-align: 3px; + margin-left: 2px; + margin-right: 2px; +} + +table thead th.sorted .sortoptions a { + position: relative; + width: 14px; + height: 14px; + display: inline-block; + background: url(../img/sorting-icons.svg) 0 0 no-repeat; + background-size: 14px auto; +} + +table thead th.sorted .sortoptions a.sortremove { + background-position: 0 0; +} + +table thead th.sorted .sortoptions a.sortremove:after { + content: '\\'; + position: absolute; + top: -6px; + left: 3px; + font-weight: 200; + font-size: 1.125rem; + color: var(--body-quiet-color); +} + +table thead th.sorted .sortoptions a.sortremove:focus:after, +table thead th.sorted .sortoptions a.sortremove:hover:after { + color: var(--link-fg); +} + +table thead th.sorted .sortoptions a.sortremove:focus, +table thead th.sorted .sortoptions a.sortremove:hover { + background-position: 0 -14px; +} + +table thead th.sorted .sortoptions a.ascending { + background-position: 0 -28px; +} + +table thead th.sorted .sortoptions a.ascending:focus, +table thead th.sorted .sortoptions a.ascending:hover { + background-position: 0 -42px; +} + +table thead th.sorted .sortoptions a.descending { + top: 1px; + background-position: 0 -56px; +} + +table thead th.sorted .sortoptions a.descending:focus, +table thead th.sorted .sortoptions a.descending:hover { + background-position: 0 -70px; +} + +/* FORM DEFAULTS */ + +input, textarea, select, .form-row p, form .button { + margin: 2px 0; + padding: 2px 3px; + vertical-align: middle; + font-family: var(--font-family-primary); + font-weight: normal; + font-size: 0.8125rem; +} +.form-row div.help { + padding: 2px 3px; +} + +textarea { + vertical-align: top; +} + +input[type=text], input[type=password], input[type=email], input[type=url], +input[type=number], input[type=tel], textarea, select, .vTextField { + border: 1px solid var(--border-color); + border-radius: 4px; + padding: 5px 6px; + margin-top: 0; + color: var(--body-fg); + background-color: var(--body-bg); +} + +input[type=text]:focus, input[type=password]:focus, input[type=email]:focus, +input[type=url]:focus, input[type=number]:focus, input[type=tel]:focus, +textarea:focus, select:focus, .vTextField:focus { + border-color: var(--body-quiet-color); +} + +select { + height: 1.875rem; +} + +select[multiple] { + /* Allow HTML size attribute to override the height in the rule above. */ + height: auto; + min-height: 150px; +} + +/* FORM BUTTONS */ + +.button, input[type=submit], input[type=button], .submit-row input, a.button { + background: var(--button-bg); + padding: 10px 15px; + border: none; + border-radius: 4px; + color: var(--button-fg); + cursor: pointer; + transition: background 0.15s; +} + +a.button { + padding: 4px 5px; +} + +.button:active, input[type=submit]:active, input[type=button]:active, +.button:focus, input[type=submit]:focus, input[type=button]:focus, +.button:hover, input[type=submit]:hover, input[type=button]:hover { + background: var(--button-hover-bg); +} + +.button[disabled], input[type=submit][disabled], input[type=button][disabled] { + opacity: 0.4; +} + +.button.default, input[type=submit].default, .submit-row input.default { + border: none; + font-weight: 400; + background: var(--default-button-bg); +} + +.button.default:active, input[type=submit].default:active, +.button.default:focus, input[type=submit].default:focus, +.button.default:hover, input[type=submit].default:hover { + background: var(--default-button-hover-bg); +} + +.button[disabled].default, +input[type=submit][disabled].default, +input[type=button][disabled].default { + opacity: 0.4; +} + + +/* MODULES */ + +.module { + border: none; + margin-bottom: 30px; + background: var(--body-bg); +} + +.module p, .module ul, .module h3, .module h4, .module dl, .module pre { + padding-left: 10px; + padding-right: 10px; +} + +.module blockquote { + margin-left: 12px; +} + +.module ul, .module ol { + margin-left: 1.5em; +} + +.module h3 { + margin-top: .6em; +} + +.module h2, .module caption, .inline-group h2 { + margin: 0; + padding: 8px; + font-weight: 400; + font-size: 0.8125rem; + text-align: left; + background: var(--header-bg); + color: var(--header-link-color); +} + +.module caption, +.inline-group h2 { + font-size: 0.75rem; + letter-spacing: 0.5px; + text-transform: uppercase; +} + +.module table { + border-collapse: collapse; +} + +/* MESSAGES & ERRORS */ + +ul.messagelist { + padding: 0; + margin: 0; +} + +ul.messagelist li { + display: block; + font-weight: 400; + font-size: 0.8125rem; + padding: 10px 10px 10px 65px; + margin: 0 0 10px 0; + background: var(--message-success-bg) url(../img/icon-yes.svg) 40px 12px no-repeat; + background-size: 16px auto; + color: var(--body-fg); + word-break: break-word; +} + +ul.messagelist li.warning { + background: var(--message-warning-bg) url(../img/icon-alert.svg) 40px 14px no-repeat; + background-size: 14px auto; +} + +ul.messagelist li.error { + background: var(--message-error-bg) url(../img/icon-no.svg) 40px 12px no-repeat; + background-size: 16px auto; +} + +.errornote { + font-size: 0.875rem; + font-weight: 700; + display: block; + padding: 10px 12px; + margin: 0 0 10px 0; + color: var(--error-fg); + border: 1px solid var(--error-fg); + border-radius: 4px; + background-color: var(--body-bg); + background-position: 5px 12px; + overflow-wrap: break-word; +} + +ul.errorlist { + margin: 0 0 4px; + padding: 0; + color: var(--error-fg); + background: var(--body-bg); +} + +ul.errorlist li { + font-size: 0.8125rem; + display: block; + margin-bottom: 4px; + overflow-wrap: break-word; +} + +ul.errorlist li:first-child { + margin-top: 0; +} + +ul.errorlist li a { + color: inherit; + text-decoration: underline; +} + +td ul.errorlist { + margin: 0; + padding: 0; +} + +td ul.errorlist li { + margin: 0; +} + +.form-row.errors { + margin: 0; + border: none; + border-bottom: 1px solid var(--hairline-color); + background: none; +} + +.form-row.errors ul.errorlist li { + padding-left: 0; +} + +.errors input, .errors select, .errors textarea, +td ul.errorlist + input, td ul.errorlist + select, td ul.errorlist + textarea { + border: 1px solid var(--error-fg); +} + +.description { + font-size: 0.75rem; + padding: 5px 0 0 12px; +} + +/* BREADCRUMBS */ + +div.breadcrumbs { + background: var(--breadcrumbs-bg); + padding: 10px 40px; + border: none; + color: var(--breadcrumbs-fg); + text-align: left; +} + +div.breadcrumbs a { + color: var(--breadcrumbs-link-fg); +} + +div.breadcrumbs a:focus, div.breadcrumbs a:hover { + color: var(--breadcrumbs-fg); +} + +/* ACTION ICONS */ + +.viewlink, .inlineviewlink { + padding-left: 16px; + background: url(../img/icon-viewlink.svg) 0 1px no-repeat; +} + +.hidelink { + padding-left: 16px; + background: url(../img/icon-hidelink.svg) 0 1px no-repeat; +} + +.addlink { + padding-left: 16px; + background: url(../img/icon-addlink.svg) 0 1px no-repeat; +} + +.changelink, .inlinechangelink { + padding-left: 16px; + background: url(../img/icon-changelink.svg) 0 1px no-repeat; +} + +.deletelink { + padding-left: 16px; + background: url(../img/icon-deletelink.svg) 0 1px no-repeat; +} + +a.deletelink:link, a.deletelink:visited { + color: #CC3434; /* XXX Probably unused? */ +} + +a.deletelink:focus, a.deletelink:hover { + color: #993333; /* XXX Probably unused? */ + text-decoration: none; +} + +/* OBJECT TOOLS */ + +.object-tools { + font-size: 0.625rem; + font-weight: bold; + padding-left: 0; + float: right; + position: relative; + margin-top: -48px; +} + +.object-tools li { + display: block; + float: left; + margin-left: 5px; + height: 1rem; +} + +.object-tools a { + border-radius: 15px; +} + +.object-tools a:link, .object-tools a:visited { + display: block; + float: left; + padding: 3px 12px; + background: var(--object-tools-bg); + color: var(--object-tools-fg); + font-weight: 400; + font-size: 0.6875rem; + text-transform: uppercase; + letter-spacing: 0.5px; +} + +.object-tools a:focus, .object-tools a:hover { + background-color: var(--object-tools-hover-bg); +} + +.object-tools a:focus{ + text-decoration: none; +} + +.object-tools a.viewsitelink, .object-tools a.addlink { + background-repeat: no-repeat; + background-position: right 7px center; + padding-right: 26px; +} + +.object-tools a.viewsitelink { + background-image: url(../img/tooltag-arrowright.svg); +} + +.object-tools a.addlink { + background-image: url(../img/tooltag-add.svg); +} + +/* OBJECT HISTORY */ + +#change-history table { + width: 100%; +} + +#change-history table tbody th { + width: 16em; +} + +#change-history .paginator { + color: var(--body-quiet-color); + border-bottom: 1px solid var(--hairline-color); + background: var(--body-bg); + overflow: hidden; +} + +/* PAGE STRUCTURE */ + +#container { + position: relative; + width: 100%; + min-width: 980px; + padding: 0; + display: flex; + flex-direction: column; + height: 100%; +} + +#container > .main { + display: flex; + flex: 1 0 auto; +} + +.main > .content { + flex: 1 0; + max-width: 100%; +} + +.skip-to-content-link { + position: absolute; + top: -999px; + margin: 5px; + padding: 5px; + background: var(--body-bg); + z-index: 1; +} + +.skip-to-content-link:focus { + left: 0px; + top: 0px; +} + +#content { + padding: 20px 40px; +} + +.dashboard #content { + width: 600px; +} + +#content-main { + float: left; + width: 100%; +} + +#content-related { + float: right; + width: 260px; + position: relative; + margin-right: -300px; +} + +#footer { + clear: both; + padding: 10px; +} + +/* COLUMN TYPES */ + +.colMS { + margin-right: 300px; +} + +.colSM { + margin-left: 300px; +} + +.colSM #content-related { + float: left; + margin-right: 0; + margin-left: -300px; +} + +.colSM #content-main { + float: right; +} + +.popup .colM { + width: auto; +} + +/* HEADER */ + +#header { + width: auto; + height: auto; + display: flex; + justify-content: space-between; + align-items: center; + padding: 10px 40px; + background: var(--header-bg); + color: var(--header-color); +} + +#header a:link, #header a:visited, #logout-form button { + color: var(--header-link-color); +} + +#header a:focus , #header a:hover { + text-decoration: underline; +} + +#branding { + display: flex; +} + +#site-name { + padding: 0; + margin: 0; + margin-inline-end: 20px; + font-weight: 300; + font-size: 1.5rem; + color: var(--header-branding-color); +} + +#site-name a:link, #site-name a:visited { + color: var(--accent); +} + +#branding h2 { + padding: 0 10px; + font-size: 0.875rem; + margin: -8px 0 8px 0; + font-weight: normal; + color: var(--header-color); +} + +#branding a:hover { + text-decoration: none; +} + +#logout-form { + display: inline; +} + +#logout-form button { + background: none; + border: 0; + cursor: pointer; + font-family: var(--font-family-primary); +} + +#user-tools { + float: right; + margin: 0 0 0 20px; + text-align: right; +} + +#user-tools, #logout-form button{ + padding: 0; + font-weight: 300; + font-size: 0.6875rem; + letter-spacing: 0.5px; + text-transform: uppercase; +} + +#user-tools a, #logout-form button { + border-bottom: 1px solid rgba(255, 255, 255, 0.25); +} + +#user-tools a:focus, #user-tools a:hover, +#logout-form button:active, #logout-form button:hover { + text-decoration: none; + border-bottom: 0; +} + +#logout-form button:active, #logout-form button:hover { + margin-bottom: 1px; +} + +/* SIDEBAR */ + +#content-related { + background: var(--darkened-bg); +} + +#content-related .module { + background: none; +} + +#content-related h3 { + color: var(--body-quiet-color); + padding: 0 16px; + margin: 0 0 16px; +} + +#content-related h4 { + font-size: 0.8125rem; +} + +#content-related p { + padding-left: 16px; + padding-right: 16px; +} + +#content-related .actionlist { + padding: 0; + margin: 16px; +} + +#content-related .actionlist li { + line-height: 1.2; + margin-bottom: 10px; + padding-left: 18px; +} + +#content-related .module h2 { + background: none; + padding: 16px; + margin-bottom: 16px; + border-bottom: 1px solid var(--hairline-color); + font-size: 1.125rem; + color: var(--body-fg); +} + +.delete-confirmation form input[type="submit"] { + background: var(--delete-button-bg); + border-radius: 4px; + padding: 10px 15px; + color: var(--button-fg); +} + +.delete-confirmation form input[type="submit"]:active, +.delete-confirmation form input[type="submit"]:focus, +.delete-confirmation form input[type="submit"]:hover { + background: var(--delete-button-hover-bg); +} + +.delete-confirmation form .cancel-link { + display: inline-block; + vertical-align: middle; + height: 0.9375rem; + line-height: 0.9375rem; + border-radius: 4px; + padding: 10px 15px; + color: var(--button-fg); + background: var(--close-button-bg); + margin: 0 0 0 10px; +} + +.delete-confirmation form .cancel-link:active, +.delete-confirmation form .cancel-link:focus, +.delete-confirmation form .cancel-link:hover { + background: var(--close-button-hover-bg); +} + +/* POPUP */ +.popup #content { + padding: 20px; +} + +.popup #container { + min-width: 0; +} + +.popup #header { + padding: 10px 20px; +} + +/* PAGINATOR */ + +.paginator { + display: flex; + align-items: center; + gap: 4px; + font-size: 0.8125rem; + padding-top: 10px; + padding-bottom: 10px; + line-height: 22px; + margin: 0; + border-top: 1px solid var(--hairline-color); + width: 100%; +} + +.paginator a:link, .paginator a:visited { + padding: 2px 6px; + background: var(--button-bg); + text-decoration: none; + color: var(--button-fg); +} + +.paginator a.showall { + border: none; + background: none; + color: var(--link-fg); +} + +.paginator a.showall:focus, .paginator a.showall:hover { + background: none; + color: var(--link-hover-color); +} + +.paginator .end { + margin-right: 6px; +} + +.paginator .this-page { + padding: 2px 6px; + font-weight: bold; + font-size: 0.8125rem; + vertical-align: top; +} + +.paginator a:focus, .paginator a:hover { + color: white; + background: var(--link-hover-color); +} + +.paginator input { + margin-left: auto; +} + +.base-svgs { + display: none; +} + +.visually-hidden { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + overflow: hidden; + clip: rect(0,0,0,0); + white-space: nowrap; + border: 0; + color: var(--body-fg); + background-color: var(--body-bg); +} diff --git a/staticfiles/admin/css/changelists.css b/staticfiles/admin/css/changelists.css new file mode 100644 index 0000000..573c389 --- /dev/null +++ b/staticfiles/admin/css/changelists.css @@ -0,0 +1,338 @@ +/* CHANGELISTS */ + +#changelist { + display: flex; + align-items: flex-start; + justify-content: space-between; +} + +#changelist .changelist-form-container { + flex: 1 1 auto; + min-width: 0; +} + +#changelist table { + width: 100%; +} + +.change-list .hiddenfields { display:none; } + +.change-list .filtered table { + border-right: none; +} + +.change-list .filtered { + min-height: 400px; +} + +.change-list .filtered .results, .change-list .filtered .paginator, +.filtered #toolbar, .filtered div.xfull { + width: auto; +} + +.change-list .filtered table tbody th { + padding-right: 1em; +} + +#changelist-form .results { + overflow-x: auto; + width: 100%; +} + +#changelist .toplinks { + border-bottom: 1px solid var(--hairline-color); +} + +#changelist .paginator { + color: var(--body-quiet-color); + border-bottom: 1px solid var(--hairline-color); + background: var(--body-bg); + overflow: hidden; +} + +/* CHANGELIST TABLES */ + +#changelist table thead th { + padding: 0; + white-space: nowrap; + vertical-align: middle; +} + +#changelist table thead th.action-checkbox-column { + width: 1.5em; + text-align: center; +} + +#changelist table tbody td.action-checkbox { + text-align: center; +} + +#changelist table tfoot { + color: var(--body-quiet-color); +} + +/* TOOLBAR */ + +#toolbar { + padding: 8px 10px; + margin-bottom: 15px; + border-top: 1px solid var(--hairline-color); + border-bottom: 1px solid var(--hairline-color); + background: var(--darkened-bg); + color: var(--body-quiet-color); +} + +#toolbar form input { + border-radius: 4px; + font-size: 0.875rem; + padding: 5px; + color: var(--body-fg); +} + +#toolbar #searchbar { + height: 1.1875rem; + border: 1px solid var(--border-color); + padding: 2px 5px; + margin: 0; + vertical-align: top; + font-size: 0.8125rem; + max-width: 100%; +} + +#toolbar #searchbar:focus { + border-color: var(--body-quiet-color); +} + +#toolbar form input[type="submit"] { + border: 1px solid var(--border-color); + font-size: 0.8125rem; + padding: 4px 8px; + margin: 0; + vertical-align: middle; + background: var(--body-bg); + box-shadow: 0 -15px 20px -10px rgba(0, 0, 0, 0.15) inset; + cursor: pointer; + color: var(--body-fg); +} + +#toolbar form input[type="submit"]:focus, +#toolbar form input[type="submit"]:hover { + border-color: var(--body-quiet-color); +} + +#changelist-search img { + vertical-align: middle; + margin-right: 4px; +} + +#changelist-search .help { + word-break: break-word; +} + +/* FILTER COLUMN */ + +#changelist-filter { + flex: 0 0 240px; + order: 1; + background: var(--darkened-bg); + border-left: none; + margin: 0 0 0 30px; +} + +#changelist-filter h2 { + font-size: 0.875rem; + text-transform: uppercase; + letter-spacing: 0.5px; + padding: 5px 15px; + margin-bottom: 12px; + border-bottom: none; +} + +#changelist-filter h3, +#changelist-filter details summary { + font-weight: 400; + padding: 0 15px; + margin-bottom: 10px; + cursor: pointer; +} + +#changelist-filter details summary > * { + display: inline; +} + +#changelist-filter details > summary { + list-style-type: none; +} + +#changelist-filter details > summary::-webkit-details-marker { + display: none; +} + +#changelist-filter details > summary::before { + content: '→'; + font-weight: bold; + color: var(--link-hover-color); +} + +#changelist-filter details[open] > summary::before { + content: '↓'; +} + +#changelist-filter ul { + margin: 5px 0; + padding: 0 15px 15px; + border-bottom: 1px solid var(--hairline-color); +} + +#changelist-filter ul:last-child { + border-bottom: none; +} + +#changelist-filter li { + list-style-type: none; + margin-left: 0; + padding-left: 0; +} + +#changelist-filter a { + display: block; + color: var(--body-quiet-color); + word-break: break-word; +} + +#changelist-filter li.selected { + border-left: 5px solid var(--hairline-color); + padding-left: 10px; + margin-left: -15px; +} + +#changelist-filter li.selected a { + color: var(--link-selected-fg); +} + +#changelist-filter a:focus, #changelist-filter a:hover, +#changelist-filter li.selected a:focus, +#changelist-filter li.selected a:hover { + color: var(--link-hover-color); +} + +#changelist-filter #changelist-filter-extra-actions { + font-size: 0.8125rem; + margin-bottom: 10px; + border-bottom: 1px solid var(--hairline-color); +} + +/* DATE DRILLDOWN */ + +.change-list .toplinks { + display: flex; + padding-bottom: 5px; + flex-wrap: wrap; + gap: 3px 17px; + font-weight: bold; +} + +.change-list .toplinks a { + font-size: 0.8125rem; +} + +.change-list .toplinks .date-back { + color: var(--body-quiet-color); +} + +.change-list .toplinks .date-back:focus, +.change-list .toplinks .date-back:hover { + color: var(--link-hover-color); +} + +/* ACTIONS */ + +.filtered .actions { + border-right: none; +} + +#changelist table input { + margin: 0; + vertical-align: baseline; +} + +/* Once the :has() pseudo-class is supported by all browsers, the tr.selected + selector and the JS adding the class can be removed. */ +#changelist tbody tr.selected { + background-color: var(--selected-row); +} + +#changelist tbody tr:has(.action-select:checked) { + background-color: var(--selected-row); +} + +@media (forced-colors: active) { + #changelist tbody tr.selected { + background-color: SelectedItem; + } + #changelist tbody tr:has(.action-select:checked) { + background-color: SelectedItem; + } +} + +#changelist .actions { + padding: 10px; + background: var(--body-bg); + border-top: none; + border-bottom: none; + line-height: 1.5rem; + color: var(--body-quiet-color); + width: 100%; +} + +#changelist .actions span.all, +#changelist .actions span.action-counter, +#changelist .actions span.clear, +#changelist .actions span.question { + font-size: 0.8125rem; + margin: 0 0.5em; +} + +#changelist .actions:last-child { + border-bottom: none; +} + +#changelist .actions select { + vertical-align: top; + height: 1.5rem; + color: var(--body-fg); + border: 1px solid var(--border-color); + border-radius: 4px; + font-size: 0.875rem; + padding: 0 0 0 4px; + margin: 0; + margin-left: 10px; +} + +#changelist .actions select:focus { + border-color: var(--body-quiet-color); +} + +#changelist .actions label { + display: inline-block; + vertical-align: middle; + font-size: 0.8125rem; +} + +#changelist .actions .button { + font-size: 0.8125rem; + border: 1px solid var(--border-color); + border-radius: 4px; + background: var(--body-bg); + box-shadow: 0 -15px 20px -10px rgba(0, 0, 0, 0.15) inset; + cursor: pointer; + height: 1.5rem; + line-height: 1; + padding: 4px 8px; + margin: 0; + color: var(--body-fg); +} + +#changelist .actions .button:focus, #changelist .actions .button:hover { + border-color: var(--body-quiet-color); +} diff --git a/staticfiles/admin/css/dark_mode.css b/staticfiles/admin/css/dark_mode.css new file mode 100644 index 0000000..c49b6bc --- /dev/null +++ b/staticfiles/admin/css/dark_mode.css @@ -0,0 +1,124 @@ +@media (prefers-color-scheme: dark) { + :root { + --primary: #264b5d; + --primary-fg: #f7f7f7; + + --body-fg: #eeeeee; + --body-bg: #121212; + --body-quiet-color: #e0e0e0; + --body-loud-color: #ffffff; + + --breadcrumbs-link-fg: #e0e0e0; + --breadcrumbs-bg: var(--primary); + + --link-fg: #81d4fa; + --link-hover-color: #4ac1f7; + --link-selected-fg: #6f94c6; + + --hairline-color: #272727; + --border-color: #353535; + + --error-fg: #e35f5f; + --message-success-bg: #006b1b; + --message-warning-bg: #583305; + --message-error-bg: #570808; + + --darkened-bg: #212121; + --selected-bg: #1b1b1b; + --selected-row: #00363a; + + --close-button-bg: #333333; + --close-button-hover-bg: #666666; + } + } + + +html[data-theme="dark"] { + --primary: #264b5d; + --primary-fg: #f7f7f7; + + --body-fg: #eeeeee; + --body-bg: #121212; + --body-quiet-color: #e0e0e0; + --body-loud-color: #ffffff; + + --breadcrumbs-link-fg: #e0e0e0; + --breadcrumbs-bg: var(--primary); + + --link-fg: #81d4fa; + --link-hover-color: #4ac1f7; + --link-selected-fg: #6f94c6; + + --hairline-color: #272727; + --border-color: #353535; + + --error-fg: #e35f5f; + --message-success-bg: #006b1b; + --message-warning-bg: #583305; + --message-error-bg: #570808; + + --darkened-bg: #212121; + --selected-bg: #1b1b1b; + --selected-row: #00363a; + + --close-button-bg: #333333; + --close-button-hover-bg: #666666; +} + +/* THEME SWITCH */ +.theme-toggle { + cursor: pointer; + border: none; + padding: 0; + background: transparent; + vertical-align: middle; + margin-inline-start: 5px; + margin-top: -1px; +} + +.theme-toggle svg { + vertical-align: middle; + height: 1rem; + width: 1rem; + display: none; +} + +/* +Fully hide screen reader text so we only show the one matching the current +theme. +*/ +.theme-toggle .visually-hidden { + display: none; +} + +html[data-theme="auto"] .theme-toggle .theme-label-when-auto { + display: block; +} + +html[data-theme="dark"] .theme-toggle .theme-label-when-dark { + display: block; +} + +html[data-theme="light"] .theme-toggle .theme-label-when-light { + display: block; +} + +/* ICONS */ +.theme-toggle svg.theme-icon-when-auto, +.theme-toggle svg.theme-icon-when-dark, +.theme-toggle svg.theme-icon-when-light { + fill: var(--header-link-color); + color: var(--header-bg); +} + +html[data-theme="auto"] .theme-toggle svg.theme-icon-when-auto { + display: block; +} + +html[data-theme="dark"] .theme-toggle svg.theme-icon-when-dark { + display: block; +} + +html[data-theme="light"] .theme-toggle svg.theme-icon-when-light { + display: block; +} diff --git a/staticfiles/admin/css/dashboard.css b/staticfiles/admin/css/dashboard.css new file mode 100644 index 0000000..242b81a --- /dev/null +++ b/staticfiles/admin/css/dashboard.css @@ -0,0 +1,29 @@ +/* DASHBOARD */ +.dashboard td, .dashboard th { + word-break: break-word; +} + +.dashboard .module table th { + width: 100%; +} + +.dashboard .module table td { + white-space: nowrap; +} + +.dashboard .module table td a { + display: block; + padding-right: .6em; +} + +/* RECENT ACTIONS MODULE */ + +.module ul.actionlist { + margin-left: 0; +} + +ul.actionlist li { + list-style-type: none; + overflow: hidden; + text-overflow: ellipsis; +} diff --git a/staticfiles/admin/css/forms.css b/staticfiles/admin/css/forms.css new file mode 100644 index 0000000..9a8dad0 --- /dev/null +++ b/staticfiles/admin/css/forms.css @@ -0,0 +1,534 @@ +@import url('widgets.css'); + +/* FORM ROWS */ + +.form-row { + overflow: hidden; + padding: 10px; + font-size: 0.8125rem; + border-bottom: 1px solid var(--hairline-color); +} + +.form-row img, .form-row input { + vertical-align: middle; +} + +.form-row label input[type="checkbox"] { + margin-top: 0; + vertical-align: 0; +} + +form .form-row p { + padding-left: 0; +} + +.flex-container { + display: flex; +} + +.form-multiline { + flex-wrap: wrap; +} + +.form-multiline > div { + padding-bottom: 10px; +} + +/* FORM LABELS */ + +label { + font-weight: normal; + color: var(--body-quiet-color); + font-size: 0.8125rem; +} + +.required label, label.required { + font-weight: bold; + color: var(--body-fg); +} + +/* RADIO BUTTONS */ + +form div.radiolist div { + padding-right: 7px; +} + +form div.radiolist.inline div { + display: inline-block; +} + +form div.radiolist label { + width: auto; +} + +form div.radiolist input[type="radio"] { + margin: -2px 4px 0 0; + padding: 0; +} + +form ul.inline { + margin-left: 0; + padding: 0; +} + +form ul.inline li { + float: left; + padding-right: 7px; +} + +/* ALIGNED FIELDSETS */ + +.aligned label { + display: block; + padding: 4px 10px 0 0; + min-width: 160px; + width: 160px; + word-wrap: break-word; + line-height: 1; +} + +.aligned label:not(.vCheckboxLabel):after { + content: ''; + display: inline-block; + vertical-align: middle; + height: 1.625rem; +} + +.aligned label + p, .aligned .checkbox-row + div.help, .aligned label + div.readonly { + padding: 6px 0; + margin-top: 0; + margin-bottom: 0; + margin-left: 0; + overflow-wrap: break-word; +} + +.aligned ul label { + display: inline; + float: none; + width: auto; +} + +.aligned .form-row input { + margin-bottom: 0; +} + +.colMS .aligned .vLargeTextField, .colMS .aligned .vXMLLargeTextField { + width: 350px; +} + +form .aligned ul { + margin-left: 160px; + padding-left: 10px; +} + +form .aligned div.radiolist { + display: inline-block; + margin: 0; + padding: 0; +} + +form .aligned p.help, +form .aligned div.help { + margin-top: 0; + margin-left: 160px; + padding-left: 10px; +} + +form .aligned p.date div.help.timezonewarning, +form .aligned p.datetime div.help.timezonewarning, +form .aligned p.time div.help.timezonewarning { + margin-left: 0; + padding-left: 0; + font-weight: normal; +} + +form .aligned p.help:last-child, +form .aligned div.help:last-child { + margin-bottom: 0; + padding-bottom: 0; +} + +form .aligned input + p.help, +form .aligned textarea + p.help, +form .aligned select + p.help, +form .aligned input + div.help, +form .aligned textarea + div.help, +form .aligned select + div.help { + margin-left: 160px; + padding-left: 10px; +} + +form .aligned ul li { + list-style: none; +} + +form .aligned table p { + margin-left: 0; + padding-left: 0; +} + +.aligned .vCheckboxLabel { + float: none; + width: auto; + display: inline-block; + vertical-align: -3px; + padding: 0 0 5px 5px; +} + +.aligned .vCheckboxLabel + p.help, +.aligned .vCheckboxLabel + div.help { + margin-top: -4px; +} + +.colM .aligned .vLargeTextField, .colM .aligned .vXMLLargeTextField { + width: 610px; +} + +fieldset .fieldBox { + margin-right: 20px; +} + +/* WIDE FIELDSETS */ + +.wide label { + width: 200px; +} + +form .wide p, +form .wide ul.errorlist, +form .wide input + p.help, +form .wide input + div.help { + margin-left: 200px; +} + +form .wide p.help, +form .wide div.help { + padding-left: 50px; +} + +form div.help ul { + padding-left: 0; + margin-left: 0; +} + +.colM fieldset.wide .vLargeTextField, .colM fieldset.wide .vXMLLargeTextField { + width: 450px; +} + +/* COLLAPSED FIELDSETS */ + +fieldset.collapsed * { + display: none; +} + +fieldset.collapsed h2, fieldset.collapsed { + display: block; +} + +fieldset.collapsed { + border: 1px solid var(--hairline-color); + border-radius: 4px; + overflow: hidden; +} + +fieldset.collapsed h2 { + background: var(--darkened-bg); + color: var(--body-quiet-color); +} + +fieldset .collapse-toggle { + color: var(--header-link-color); +} + +fieldset.collapsed .collapse-toggle { + background: transparent; + display: inline; + color: var(--link-fg); +} + +/* MONOSPACE TEXTAREAS */ + +fieldset.monospace textarea { + font-family: var(--font-family-monospace); +} + +/* SUBMIT ROW */ + +.submit-row { + padding: 12px 14px 12px; + margin: 0 0 20px; + background: var(--darkened-bg); + border: 1px solid var(--hairline-color); + border-radius: 4px; + overflow: hidden; + display: flex; + gap: 10px; + flex-wrap: wrap; +} + +body.popup .submit-row { + overflow: auto; +} + +.submit-row input { + height: 2.1875rem; + line-height: 0.9375rem; +} + +.submit-row input, .submit-row a { + margin: 0; +} + +.submit-row input.default { + text-transform: uppercase; +} + +.submit-row a.deletelink { + margin-left: auto; +} + +.submit-row a.deletelink { + display: block; + background: var(--delete-button-bg); + border-radius: 4px; + padding: 0.625rem 0.9375rem; + height: 0.9375rem; + line-height: 0.9375rem; + color: var(--button-fg); +} + +.submit-row a.closelink { + display: inline-block; + background: var(--close-button-bg); + border-radius: 4px; + padding: 10px 15px; + height: 0.9375rem; + line-height: 0.9375rem; + color: var(--button-fg); +} + +.submit-row a.deletelink:focus, +.submit-row a.deletelink:hover, +.submit-row a.deletelink:active { + background: var(--delete-button-hover-bg); + text-decoration: none; +} + +.submit-row a.closelink:focus, +.submit-row a.closelink:hover, +.submit-row a.closelink:active { + background: var(--close-button-hover-bg); + text-decoration: none; +} + +/* CUSTOM FORM FIELDS */ + +.vSelectMultipleField { + vertical-align: top; +} + +.vCheckboxField { + border: none; +} + +.vDateField, .vTimeField { + margin-right: 2px; + margin-bottom: 4px; +} + +.vDateField { + min-width: 6.85em; +} + +.vTimeField { + min-width: 4.7em; +} + +.vURLField { + width: 30em; +} + +.vLargeTextField, .vXMLLargeTextField { + width: 48em; +} + +.flatpages-flatpage #id_content { + height: 40.2em; +} + +.module table .vPositiveSmallIntegerField { + width: 2.2em; +} + +.vIntegerField { + width: 5em; +} + +.vBigIntegerField { + width: 10em; +} + +.vForeignKeyRawIdAdminField { + width: 5em; +} + +.vTextField, .vUUIDField { + width: 20em; +} + +/* INLINES */ + +.inline-group { + padding: 0; + margin: 0 0 30px; +} + +.inline-group thead th { + padding: 8px 10px; +} + +.inline-group .aligned label { + width: 160px; +} + +.inline-related { + position: relative; +} + +.inline-related h3 { + margin: 0; + color: var(--body-quiet-color); + padding: 5px; + font-size: 0.8125rem; + background: var(--darkened-bg); + border-top: 1px solid var(--hairline-color); + border-bottom: 1px solid var(--hairline-color); +} + +.inline-related h3 span.delete { + float: right; +} + +.inline-related h3 span.delete label { + margin-left: 2px; + font-size: 0.6875rem; +} + +.inline-related fieldset { + margin: 0; + background: var(--body-bg); + border: none; + width: 100%; +} + +.inline-related fieldset.module h3 { + margin: 0; + padding: 2px 5px 3px 5px; + font-size: 0.6875rem; + text-align: left; + font-weight: bold; + background: #bcd; + color: var(--body-bg); +} + +.inline-group .tabular fieldset.module { + border: none; +} + +.inline-related.tabular fieldset.module table { + width: 100%; + overflow-x: scroll; +} + +.last-related fieldset { + border: none; +} + +.inline-group .tabular tr.has_original td { + padding-top: 2em; +} + +.inline-group .tabular tr td.original { + padding: 2px 0 0 0; + width: 0; + _position: relative; +} + +.inline-group .tabular th.original { + width: 0px; + padding: 0; +} + +.inline-group .tabular td.original p { + position: absolute; + left: 0; + height: 1.1em; + padding: 2px 9px; + overflow: hidden; + font-size: 0.5625rem; + font-weight: bold; + color: var(--body-quiet-color); + _width: 700px; +} + +.inline-group ul.tools { + padding: 0; + margin: 0; + list-style: none; +} + +.inline-group ul.tools li { + display: inline; + padding: 0 5px; +} + +.inline-group div.add-row, +.inline-group .tabular tr.add-row td { + color: var(--body-quiet-color); + background: var(--darkened-bg); + padding: 8px 10px; + border-bottom: 1px solid var(--hairline-color); +} + +.inline-group .tabular tr.add-row td { + padding: 8px 10px; + border-bottom: 1px solid var(--hairline-color); +} + +.inline-group ul.tools a.add, +.inline-group div.add-row a, +.inline-group .tabular tr.add-row td a { + background: url(../img/icon-addlink.svg) 0 1px no-repeat; + padding-left: 16px; + font-size: 0.75rem; +} + +.empty-form { + display: none; +} + +/* RELATED FIELD ADD ONE / LOOKUP */ + +.related-lookup { + margin-left: 5px; + display: inline-block; + vertical-align: middle; + background-repeat: no-repeat; + background-size: 14px; +} + +.related-lookup { + width: 1rem; + height: 1rem; + background-image: url(../img/search.svg); +} + +form .related-widget-wrapper ul { + display: inline-block; + margin-left: 0; + padding-left: 0; +} + +.clearable-file-input input { + margin-top: 0; +} diff --git a/staticfiles/admin/css/login.css b/staticfiles/admin/css/login.css new file mode 100644 index 0000000..389772f --- /dev/null +++ b/staticfiles/admin/css/login.css @@ -0,0 +1,61 @@ +/* LOGIN FORM */ + +.login { + background: var(--darkened-bg); + height: auto; +} + +.login #header { + height: auto; + padding: 15px 16px; + justify-content: center; +} + +.login #header h1 { + font-size: 1.125rem; + margin: 0; +} + +.login #header h1 a { + color: var(--header-link-color); +} + +.login #content { + padding: 20px 20px 0; +} + +.login #container { + background: var(--body-bg); + border: 1px solid var(--hairline-color); + border-radius: 4px; + overflow: hidden; + width: 28em; + min-width: 300px; + margin: 100px auto; + height: auto; +} + +.login .form-row { + padding: 4px 0; +} + +.login .form-row label { + display: block; + line-height: 2em; +} + +.login .form-row #id_username, .login .form-row #id_password { + padding: 8px; + width: 100%; + box-sizing: border-box; +} + +.login .submit-row { + padding: 1em 0 0 0; + margin: 0; + text-align: center; +} + +.login .password-reset-link { + text-align: center; +} diff --git a/staticfiles/admin/css/nav_sidebar.css b/staticfiles/admin/css/nav_sidebar.css new file mode 100644 index 0000000..7eb0de9 --- /dev/null +++ b/staticfiles/admin/css/nav_sidebar.css @@ -0,0 +1,150 @@ +.sticky { + position: sticky; + top: 0; + max-height: 100vh; +} + +.toggle-nav-sidebar { + z-index: 20; + left: 0; + display: flex; + align-items: center; + justify-content: center; + flex: 0 0 23px; + width: 23px; + border: 0; + border-right: 1px solid var(--hairline-color); + background-color: var(--body-bg); + cursor: pointer; + font-size: 1.25rem; + color: var(--link-fg); + padding: 0; +} + +[dir="rtl"] .toggle-nav-sidebar { + border-left: 1px solid var(--hairline-color); + border-right: 0; +} + +.toggle-nav-sidebar:hover, +.toggle-nav-sidebar:focus { + background-color: var(--darkened-bg); +} + +#nav-sidebar { + z-index: 15; + flex: 0 0 275px; + left: -276px; + margin-left: -276px; + border-top: 1px solid transparent; + border-right: 1px solid var(--hairline-color); + background-color: var(--body-bg); + overflow: auto; +} + +[dir="rtl"] #nav-sidebar { + border-left: 1px solid var(--hairline-color); + border-right: 0; + left: 0; + margin-left: 0; + right: -276px; + margin-right: -276px; +} + +.toggle-nav-sidebar::before { + content: '\00BB'; +} + +.main.shifted .toggle-nav-sidebar::before { + content: '\00AB'; +} + +.main > #nav-sidebar { + visibility: hidden; +} + +.main.shifted > #nav-sidebar { + margin-left: 0; + visibility: visible; +} + +[dir="rtl"] .main.shifted > #nav-sidebar { + margin-right: 0; +} + +#nav-sidebar .module th { + width: 100%; + overflow-wrap: anywhere; +} + +#nav-sidebar .module th, +#nav-sidebar .module caption { + padding-left: 16px; +} + +#nav-sidebar .module td { + white-space: nowrap; +} + +[dir="rtl"] #nav-sidebar .module th, +[dir="rtl"] #nav-sidebar .module caption { + padding-left: 8px; + padding-right: 16px; +} + +#nav-sidebar .current-app .section:link, +#nav-sidebar .current-app .section:visited { + color: var(--header-color); + font-weight: bold; +} + +#nav-sidebar .current-model { + background: var(--selected-row); +} + +@media (forced-colors: active) { + #nav-sidebar .current-model { + background-color: SelectedItem; + } +} + +.main > #nav-sidebar + .content { + max-width: calc(100% - 23px); +} + +.main.shifted > #nav-sidebar + .content { + max-width: calc(100% - 299px); +} + +@media (max-width: 767px) { + #nav-sidebar, #toggle-nav-sidebar { + display: none; + } + + .main > #nav-sidebar + .content, + .main.shifted > #nav-sidebar + .content { + max-width: 100%; + } +} + +#nav-filter { + width: 100%; + box-sizing: border-box; + padding: 2px 5px; + margin: 5px 0; + border: 1px solid var(--border-color); + background-color: var(--darkened-bg); + color: var(--body-fg); +} + +#nav-filter:focus { + border-color: var(--body-quiet-color); +} + +#nav-filter.no-results { + background: var(--message-error-bg); +} + +#nav-sidebar table { + width: 100%; +} diff --git a/staticfiles/admin/css/responsive.css b/staticfiles/admin/css/responsive.css new file mode 100644 index 0000000..bb53945 --- /dev/null +++ b/staticfiles/admin/css/responsive.css @@ -0,0 +1,970 @@ +/* Tablets */ + +input[type="submit"], button { + -webkit-appearance: none; + appearance: none; +} + +@media (max-width: 1024px) { + /* Basic */ + + html { + -webkit-text-size-adjust: 100%; + } + + td, th { + padding: 10px; + font-size: 0.875rem; + } + + .small { + font-size: 0.75rem; + } + + /* Layout */ + + #container { + min-width: 0; + } + + #content { + padding: 15px 20px 20px; + } + + div.breadcrumbs { + padding: 10px 30px; + } + + /* Header */ + + #header { + flex-direction: column; + padding: 15px 30px; + justify-content: flex-start; + } + + #site-name { + margin: 0 0 8px; + line-height: 1.2; + } + + #user-tools { + margin: 0; + font-weight: 400; + line-height: 1.85; + text-align: left; + } + + #user-tools a { + display: inline-block; + line-height: 1.4; + } + + /* Dashboard */ + + .dashboard #content { + width: auto; + } + + #content-related { + margin-right: -290px; + } + + .colSM #content-related { + margin-left: -290px; + } + + .colMS { + margin-right: 290px; + } + + .colSM { + margin-left: 290px; + } + + .dashboard .module table td a { + padding-right: 0; + } + + td .changelink, td .addlink { + font-size: 0.8125rem; + } + + /* Changelist */ + + #toolbar { + border: none; + padding: 15px; + } + + #changelist-search > div { + display: flex; + flex-wrap: nowrap; + max-width: 480px; + } + + #changelist-search label { + line-height: 1.375rem; + } + + #toolbar form #searchbar { + flex: 1 0 auto; + width: 0; + height: 1.375rem; + margin: 0 10px 0 6px; + } + + #toolbar form input[type=submit] { + flex: 0 1 auto; + } + + #changelist-search .quiet { + width: 0; + flex: 1 0 auto; + margin: 5px 0 0 25px; + } + + #changelist .actions { + display: flex; + flex-wrap: wrap; + padding: 15px 0; + } + + #changelist .actions label { + display: flex; + } + + #changelist .actions select { + background: var(--body-bg); + } + + #changelist .actions .button { + min-width: 48px; + margin: 0 10px; + } + + #changelist .actions span.all, + #changelist .actions span.clear, + #changelist .actions span.question, + #changelist .actions span.action-counter { + font-size: 0.6875rem; + margin: 0 10px 0 0; + } + + #changelist-filter { + flex-basis: 200px; + } + + .change-list .filtered .results, + .change-list .filtered .paginator, + .filtered #toolbar, + .filtered .actions, + + #changelist .paginator { + border-top-color: var(--hairline-color); /* XXX Is this used at all? */ + } + + #changelist .results + .paginator { + border-top: none; + } + + /* Forms */ + + label { + font-size: 0.875rem; + } + + .form-row input[type=text], + .form-row input[type=password], + .form-row input[type=email], + .form-row input[type=url], + .form-row input[type=tel], + .form-row input[type=number], + .form-row textarea, + .form-row select, + .form-row .vTextField { + box-sizing: border-box; + margin: 0; + padding: 6px 8px; + min-height: 2.25rem; + font-size: 0.875rem; + } + + .form-row select { + height: 2.25rem; + } + + .form-row select[multiple] { + height: auto; + min-height: 0; + } + + fieldset .fieldBox + .fieldBox { + margin-top: 10px; + padding-top: 10px; + border-top: 1px solid var(--hairline-color); + } + + textarea { + max-width: 100%; + max-height: 120px; + } + + .aligned label { + padding-top: 6px; + } + + .aligned .related-lookup, + .aligned .datetimeshortcuts, + .aligned .related-lookup + strong { + align-self: center; + margin-left: 15px; + } + + form .aligned div.radiolist { + margin-left: 2px; + } + + .submit-row { + padding: 8px; + } + + .submit-row a.deletelink { + padding: 10px 7px; + } + + .button, input[type=submit], input[type=button], .submit-row input, a.button { + padding: 7px; + } + + /* Selector */ + + .selector { + display: flex; + width: 100%; + } + + .selector .selector-filter { + display: flex; + align-items: center; + } + + .selector .selector-filter label { + margin: 0 8px 0 0; + } + + .selector .selector-filter input { + width: 100%; + min-height: 0; + flex: 1 1; + } + + .selector-available, .selector-chosen { + width: auto; + flex: 1 1; + display: flex; + flex-direction: column; + } + + .selector select { + width: 100%; + flex: 1 0 auto; + margin-bottom: 5px; + } + + .selector ul.selector-chooser { + width: 26px; + height: 52px; + padding: 2px 0; + border-radius: 20px; + transform: translateY(-10px); + } + + .selector-add, .selector-remove { + width: 20px; + height: 20px; + background-size: 20px auto; + } + + .selector-add { + background-position: 0 -120px; + } + + .selector-remove { + background-position: 0 -80px; + } + + a.selector-chooseall, a.selector-clearall { + align-self: center; + } + + .stacked { + flex-direction: column; + max-width: 480px; + } + + .stacked > * { + flex: 0 1 auto; + } + + .stacked select { + margin-bottom: 0; + } + + .stacked .selector-available, .stacked .selector-chosen { + width: auto; + } + + .stacked ul.selector-chooser { + width: 52px; + height: 26px; + padding: 0 2px; + transform: none; + } + + .stacked .selector-chooser li { + padding: 3px; + } + + .stacked .selector-add, .stacked .selector-remove { + background-size: 20px auto; + } + + .stacked .selector-add { + background-position: 0 -40px; + } + + .stacked .active.selector-add { + background-position: 0 -40px; + } + + .active.selector-add:focus, .active.selector-add:hover { + background-position: 0 -140px; + } + + .stacked .active.selector-add:focus, .stacked .active.selector-add:hover { + background-position: 0 -60px; + } + + .stacked .selector-remove { + background-position: 0 0; + } + + .stacked .active.selector-remove { + background-position: 0 0; + } + + .active.selector-remove:focus, .active.selector-remove:hover { + background-position: 0 -100px; + } + + .stacked .active.selector-remove:focus, .stacked .active.selector-remove:hover { + background-position: 0 -20px; + } + + .help-tooltip, .selector .help-icon { + display: none; + } + + .datetime input { + width: 50%; + max-width: 120px; + } + + .datetime span { + font-size: 0.8125rem; + } + + .datetime .timezonewarning { + display: block; + font-size: 0.6875rem; + color: var(--body-quiet-color); + } + + .datetimeshortcuts { + color: var(--border-color); /* XXX Redundant, .datetime span also sets #ccc */ + } + + .form-row .datetime input.vDateField, .form-row .datetime input.vTimeField { + width: 75%; + } + + .inline-group { + overflow: auto; + } + + /* Messages */ + + ul.messagelist li { + padding-left: 55px; + background-position: 30px 12px; + } + + ul.messagelist li.error { + background-position: 30px 12px; + } + + ul.messagelist li.warning { + background-position: 30px 14px; + } + + /* Login */ + + .login #header { + padding: 15px 20px; + } + + .login #site-name { + margin: 0; + } + + /* GIS */ + + div.olMap { + max-width: calc(100vw - 30px); + max-height: 300px; + } + + .olMap + .clear_features { + display: block; + margin-top: 10px; + } + + /* Docs */ + + .module table.xfull { + width: 100%; + } + + pre.literal-block { + overflow: auto; + } +} + +/* Mobile */ + +@media (max-width: 767px) { + /* Layout */ + + #header, #content, #footer { + padding: 15px; + } + + #footer:empty { + padding: 0; + } + + div.breadcrumbs { + padding: 10px 15px; + } + + /* Dashboard */ + + .colMS, .colSM { + margin: 0; + } + + #content-related, .colSM #content-related { + width: 100%; + margin: 0; + } + + #content-related .module { + margin-bottom: 0; + } + + #content-related .module h2 { + padding: 10px 15px; + font-size: 1rem; + } + + /* Changelist */ + + #changelist { + align-items: stretch; + flex-direction: column; + } + + #toolbar { + padding: 10px; + } + + #changelist-filter { + margin-left: 0; + } + + #changelist .actions label { + flex: 1 1; + } + + #changelist .actions select { + flex: 1 0; + width: 100%; + } + + #changelist .actions span { + flex: 1 0 100%; + } + + #changelist-filter { + position: static; + width: auto; + margin-top: 30px; + } + + .object-tools { + float: none; + margin: 0 0 15px; + padding: 0; + overflow: hidden; + } + + .object-tools li { + height: auto; + margin-left: 0; + } + + .object-tools li + li { + margin-left: 15px; + } + + /* Forms */ + + .form-row { + padding: 15px 0; + } + + .aligned .form-row, + .aligned .form-row > div { + max-width: 100vw; + } + + .aligned .form-row > div { + width: calc(100vw - 30px); + } + + .flex-container { + flex-flow: column; + } + + .flex-container.checkbox-row { + flex-flow: row; + } + + textarea { + max-width: none; + } + + .vURLField { + width: auto; + } + + fieldset .fieldBox + .fieldBox { + margin-top: 15px; + padding-top: 15px; + } + + fieldset.collapsed .form-row { + display: none; + } + + .aligned label { + width: 100%; + min-width: auto; + padding: 0 0 10px; + } + + .aligned label:after { + max-height: 0; + } + + .aligned .form-row input, + .aligned .form-row select, + .aligned .form-row textarea { + flex: 1 1 auto; + max-width: 100%; + } + + .aligned .checkbox-row input { + flex: 0 1 auto; + margin: 0; + } + + .aligned .vCheckboxLabel { + flex: 1 0; + padding: 1px 0 0 5px; + } + + .aligned label + p, + .aligned label + div.help, + .aligned label + div.readonly { + padding: 0; + margin-left: 0; + } + + .aligned p.file-upload { + font-size: 0.8125rem; + } + + span.clearable-file-input { + margin-left: 15px; + } + + span.clearable-file-input label { + font-size: 0.8125rem; + padding-bottom: 0; + } + + .aligned .timezonewarning { + flex: 1 0 100%; + margin-top: 5px; + } + + form .aligned .form-row div.help { + width: 100%; + margin: 5px 0 0; + padding: 0; + } + + form .aligned ul, + form .aligned ul.errorlist { + margin-left: 0; + padding-left: 0; + } + + form .aligned div.radiolist { + margin-top: 5px; + margin-right: 15px; + margin-bottom: -3px; + } + + form .aligned div.radiolist:not(.inline) div + div { + margin-top: 5px; + } + + /* Related widget */ + + .related-widget-wrapper { + width: 100%; + display: flex; + align-items: flex-start; + } + + .related-widget-wrapper .selector { + order: 1; + } + + .related-widget-wrapper > a { + order: 2; + } + + .related-widget-wrapper .radiolist ~ a { + align-self: flex-end; + } + + .related-widget-wrapper > select ~ a { + align-self: center; + } + + /* Selector */ + + .selector { + flex-direction: column; + gap: 10px 0; + } + + .selector-available, .selector-chosen { + flex: 1 1 auto; + } + + .selector select { + max-height: 96px; + } + + .selector ul.selector-chooser { + display: block; + width: 52px; + height: 26px; + padding: 0 2px; + transform: none; + } + + .selector ul.selector-chooser li { + float: left; + } + + .selector-remove { + background-position: 0 0; + } + + .active.selector-remove:focus, .active.selector-remove:hover { + background-position: 0 -20px; + } + + .selector-add { + background-position: 0 -40px; + } + + .active.selector-add:focus, .active.selector-add:hover { + background-position: 0 -60px; + } + + /* Inlines */ + + .inline-group[data-inline-type="stacked"] .inline-related { + border: 1px solid var(--hairline-color); + border-radius: 4px; + margin-top: 15px; + overflow: auto; + } + + .inline-group[data-inline-type="stacked"] .inline-related > * { + box-sizing: border-box; + } + + .inline-group[data-inline-type="stacked"] .inline-related .module { + padding: 0 10px; + } + + .inline-group[data-inline-type="stacked"] .inline-related .module .form-row { + border-top: 1px solid var(--hairline-color); + border-bottom: none; + } + + .inline-group[data-inline-type="stacked"] .inline-related .module .form-row:first-child { + border-top: none; + } + + .inline-group[data-inline-type="stacked"] .inline-related h3 { + padding: 10px; + border-top-width: 0; + border-bottom-width: 2px; + display: flex; + flex-wrap: wrap; + align-items: center; + } + + .inline-group[data-inline-type="stacked"] .inline-related h3 .inline_label { + margin-right: auto; + } + + .inline-group[data-inline-type="stacked"] .inline-related h3 span.delete { + float: none; + flex: 1 1 100%; + margin-top: 5px; + } + + .inline-group[data-inline-type="stacked"] .aligned .form-row > div:not([class]) { + width: 100%; + } + + .inline-group[data-inline-type="stacked"] .aligned label { + width: 100%; + } + + .inline-group[data-inline-type="stacked"] div.add-row { + margin-top: 15px; + border: 1px solid var(--hairline-color); + border-radius: 4px; + } + + .inline-group div.add-row, + .inline-group .tabular tr.add-row td { + padding: 0; + } + + .inline-group div.add-row a, + .inline-group .tabular tr.add-row td a { + display: block; + padding: 8px 10px 8px 26px; + background-position: 8px 9px; + } + + /* Submit row */ + + .submit-row { + padding: 10px; + margin: 0 0 15px; + flex-direction: column; + gap: 8px; + } + + .submit-row input, .submit-row input.default, .submit-row a { + text-align: center; + } + + .submit-row a.closelink { + padding: 10px 0; + text-align: center; + } + + .submit-row a.deletelink { + margin: 0; + } + + /* Messages */ + + ul.messagelist li { + padding-left: 40px; + background-position: 15px 12px; + } + + ul.messagelist li.error { + background-position: 15px 12px; + } + + ul.messagelist li.warning { + background-position: 15px 14px; + } + + /* Paginator */ + + .paginator .this-page, .paginator a:link, .paginator a:visited { + padding: 4px 10px; + } + + /* Login */ + + body.login { + padding: 0 15px; + } + + .login #container { + width: auto; + max-width: 480px; + margin: 50px auto; + } + + .login #header, + .login #content { + padding: 15px; + } + + .login #content-main { + float: none; + } + + .login .form-row { + padding: 0; + } + + .login .form-row + .form-row { + margin-top: 15px; + } + + .login .form-row label { + margin: 0 0 5px; + line-height: 1.2; + } + + .login .submit-row { + padding: 15px 0 0; + } + + .login br { + display: none; + } + + .login .submit-row input { + margin: 0; + text-transform: uppercase; + } + + .errornote { + margin: 0 0 20px; + padding: 8px 12px; + font-size: 0.8125rem; + } + + /* Calendar and clock */ + + .calendarbox, .clockbox { + position: fixed !important; + top: 50% !important; + left: 50% !important; + transform: translate(-50%, -50%); + margin: 0; + border: none; + overflow: visible; + } + + .calendarbox:before, .clockbox:before { + content: ''; + position: fixed; + top: 50%; + left: 50%; + width: 100vw; + height: 100vh; + background: rgba(0, 0, 0, 0.75); + transform: translate(-50%, -50%); + } + + .calendarbox > *, .clockbox > * { + position: relative; + z-index: 1; + } + + .calendarbox > div:first-child { + z-index: 2; + } + + .calendarbox .calendar, .clockbox h2 { + border-radius: 4px 4px 0 0; + overflow: hidden; + } + + .calendarbox .calendar-cancel, .clockbox .calendar-cancel { + border-radius: 0 0 4px 4px; + overflow: hidden; + } + + .calendar-shortcuts { + padding: 10px 0; + font-size: 0.75rem; + line-height: 0.75rem; + } + + .calendar-shortcuts a { + margin: 0 4px; + } + + .timelist a { + background: var(--body-bg); + padding: 4px; + } + + .calendar-cancel { + padding: 8px 10px; + } + + .clockbox h2 { + padding: 8px 15px; + } + + .calendar caption { + padding: 10px; + } + + .calendarbox .calendarnav-previous, .calendarbox .calendarnav-next { + z-index: 1; + top: 10px; + } + + /* History */ + + table#change-history tbody th, table#change-history tbody td { + font-size: 0.8125rem; + word-break: break-word; + } + + table#change-history tbody th { + width: auto; + } + + /* Docs */ + + table.model tbody th, table.model tbody td { + font-size: 0.8125rem; + word-break: break-word; + } +} diff --git a/staticfiles/admin/css/responsive_rtl.css b/staticfiles/admin/css/responsive_rtl.css new file mode 100644 index 0000000..31dc8ff --- /dev/null +++ b/staticfiles/admin/css/responsive_rtl.css @@ -0,0 +1,84 @@ +/* TABLETS */ + +@media (max-width: 1024px) { + [dir="rtl"] .colMS { + margin-right: 0; + } + + [dir="rtl"] #user-tools { + text-align: right; + } + + [dir="rtl"] #changelist .actions label { + padding-left: 10px; + padding-right: 0; + } + + [dir="rtl"] #changelist .actions select { + margin-left: 0; + margin-right: 15px; + } + + [dir="rtl"] .change-list .filtered .results, + [dir="rtl"] .change-list .filtered .paginator, + [dir="rtl"] .filtered #toolbar, + [dir="rtl"] .filtered div.xfull, + [dir="rtl"] .filtered .actions, + [dir="rtl"] #changelist-filter { + margin-left: 0; + } + + [dir="rtl"] .inline-group ul.tools a.add, + [dir="rtl"] .inline-group div.add-row a, + [dir="rtl"] .inline-group .tabular tr.add-row td a { + padding: 8px 26px 8px 10px; + background-position: calc(100% - 8px) 9px; + } + + [dir="rtl"] .related-widget-wrapper-link + .selector { + margin-right: 0; + margin-left: 15px; + } + + [dir="rtl"] .selector .selector-filter label { + margin-right: 0; + margin-left: 8px; + } + + [dir="rtl"] .object-tools li { + float: right; + } + + [dir="rtl"] .object-tools li + li { + margin-left: 0; + margin-right: 15px; + } + + [dir="rtl"] .dashboard .module table td a { + padding-left: 0; + padding-right: 16px; + } +} + +/* MOBILE */ + +@media (max-width: 767px) { + [dir="rtl"] .aligned .related-lookup, + [dir="rtl"] .aligned .datetimeshortcuts { + margin-left: 0; + margin-right: 15px; + } + + [dir="rtl"] .aligned ul, + [dir="rtl"] form .aligned ul.errorlist { + margin-right: 0; + } + + [dir="rtl"] #changelist-filter { + margin-left: 0; + margin-right: 0; + } + [dir="rtl"] .aligned .vCheckboxLabel { + padding: 1px 5px 0 0; + } +} diff --git a/staticfiles/admin/css/rtl.css b/staticfiles/admin/css/rtl.css new file mode 100644 index 0000000..9027c7e --- /dev/null +++ b/staticfiles/admin/css/rtl.css @@ -0,0 +1,302 @@ +/* GLOBAL */ + +th { + text-align: right; +} + +.module h2, .module caption { + text-align: right; +} + +.module ul, .module ol { + margin-left: 0; + margin-right: 1.5em; +} + +.viewlink, .addlink, .changelink, .hidelink { + padding-left: 0; + padding-right: 16px; + background-position: 100% 1px; +} + +.deletelink { + padding-left: 0; + padding-right: 16px; + background-position: 100% 1px; +} + +.object-tools { + float: left; +} + +thead th:first-child, +tfoot td:first-child { + border-left: none; +} + +/* LAYOUT */ + +#user-tools { + right: auto; + left: 0; + text-align: left; +} + +div.breadcrumbs { + text-align: right; +} + +#content-main { + float: right; +} + +#content-related { + float: left; + margin-left: -300px; + margin-right: auto; +} + +.colMS { + margin-left: 300px; + margin-right: 0; +} + +/* SORTABLE TABLES */ + +table thead th.sorted .sortoptions { + float: left; +} + +thead th.sorted .text { + padding-right: 0; + padding-left: 42px; +} + +/* dashboard styles */ + +.dashboard .module table td a { + padding-left: .6em; + padding-right: 16px; +} + +/* changelists styles */ + +.change-list .filtered table { + border-left: none; + border-right: 0px none; +} + +#changelist-filter { + border-left: none; + border-right: none; + margin-left: 0; + margin-right: 30px; +} + +#changelist-filter li.selected { + border-left: none; + padding-left: 10px; + margin-left: 0; + border-right: 5px solid var(--hairline-color); + padding-right: 10px; + margin-right: -15px; +} + +#changelist table tbody td:first-child, #changelist table tbody th:first-child { + border-right: none; + border-left: none; +} + +.paginator .end { + margin-left: 6px; + margin-right: 0; +} + +.paginator input { + margin-left: 0; + margin-right: auto; +} + +/* FORMS */ + +.aligned label { + padding: 0 0 3px 1em; +} + +.submit-row a.deletelink { + margin-left: 0; + margin-right: auto; +} + +.vDateField, .vTimeField { + margin-left: 2px; +} + +.aligned .form-row input { + margin-left: 5px; +} + +form .aligned ul { + margin-right: 163px; + padding-right: 10px; + margin-left: 0; + padding-left: 0; +} + +form ul.inline li { + float: right; + padding-right: 0; + padding-left: 7px; +} + +form .aligned p.help, +form .aligned div.help { + margin-right: 160px; + padding-right: 10px; +} + +form div.help ul, +form .aligned .checkbox-row + .help, +form .aligned p.date div.help.timezonewarning, +form .aligned p.datetime div.help.timezonewarning, +form .aligned p.time div.help.timezonewarning { + margin-right: 0; + padding-right: 0; +} + +form .wide p.help, form .wide div.help { + padding-left: 0; + padding-right: 50px; +} + +form .wide p, +form .wide ul.errorlist, +form .wide input + p.help, +form .wide input + div.help { + margin-right: 200px; + margin-left: 0px; +} + +.submit-row { + text-align: right; +} + +fieldset .fieldBox { + margin-left: 20px; + margin-right: 0; +} + +.errorlist li { + background-position: 100% 12px; + padding: 0; +} + +.errornote { + background-position: 100% 12px; + padding: 10px 12px; +} + +/* WIDGETS */ + +.calendarnav-previous { + top: 0; + left: auto; + right: 10px; + background: url(../img/calendar-icons.svg) 0 -30px no-repeat; +} + +.calendarbox .calendarnav-previous:focus, +.calendarbox .calendarnav-previous:hover { + background-position: 0 -45px; +} + +.calendarnav-next { + top: 0; + right: auto; + left: 10px; + background: url(../img/calendar-icons.svg) 0 0 no-repeat; +} + +.calendarbox .calendarnav-next:focus, +.calendarbox .calendarnav-next:hover { + background-position: 0 -15px; +} + +.calendar caption, .calendarbox h2 { + text-align: center; +} + +.selector { + float: right; +} + +.selector .selector-filter { + text-align: right; +} + +.selector-add { + background: url(../img/selector-icons.svg) 0 -64px no-repeat; +} + +.active.selector-add:focus, .active.selector-add:hover { + background-position: 0 -80px; +} + +.selector-remove { + background: url(../img/selector-icons.svg) 0 -96px no-repeat; +} + +.active.selector-remove:focus, .active.selector-remove:hover { + background-position: 0 -112px; +} + +a.selector-chooseall { + background: url(../img/selector-icons.svg) right -128px no-repeat; +} + +a.active.selector-chooseall:focus, a.active.selector-chooseall:hover { + background-position: 100% -144px; +} + +a.selector-clearall { + background: url(../img/selector-icons.svg) 0 -160px no-repeat; +} + +a.active.selector-clearall:focus, a.active.selector-clearall:hover { + background-position: 0 -176px; +} + +.inline-deletelink { + float: left; +} + +form .form-row p.datetime { + overflow: hidden; +} + +.related-widget-wrapper { + float: right; +} + +/* MISC */ + +.inline-related h2, .inline-group h2 { + text-align: right +} + +.inline-related h3 span.delete { + padding-right: 20px; + padding-left: inherit; + left: 10px; + right: inherit; + float:left; +} + +.inline-related h3 span.delete label { + margin-left: inherit; + margin-right: 2px; +} + +.selector .selector-chooser { + margin: 0; +} diff --git a/staticfiles/admin/css/vendor/select2/LICENSE-SELECT2.md b/staticfiles/admin/css/vendor/select2/LICENSE-SELECT2.md new file mode 100644 index 0000000..8cb8a2b --- /dev/null +++ b/staticfiles/admin/css/vendor/select2/LICENSE-SELECT2.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2012-2017 Kevin Brown, Igor Vaynberg, and Select2 contributors + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/staticfiles/admin/css/vendor/select2/select2.css b/staticfiles/admin/css/vendor/select2/select2.css new file mode 100644 index 0000000..750b320 --- /dev/null +++ b/staticfiles/admin/css/vendor/select2/select2.css @@ -0,0 +1,481 @@ +.select2-container { + box-sizing: border-box; + display: inline-block; + margin: 0; + position: relative; + vertical-align: middle; } + .select2-container .select2-selection--single { + box-sizing: border-box; + cursor: pointer; + display: block; + height: 28px; + user-select: none; + -webkit-user-select: none; } + .select2-container .select2-selection--single .select2-selection__rendered { + display: block; + padding-left: 8px; + padding-right: 20px; + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; } + .select2-container .select2-selection--single .select2-selection__clear { + position: relative; } + .select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered { + padding-right: 8px; + padding-left: 20px; } + .select2-container .select2-selection--multiple { + box-sizing: border-box; + cursor: pointer; + display: block; + min-height: 32px; + user-select: none; + -webkit-user-select: none; } + .select2-container .select2-selection--multiple .select2-selection__rendered { + display: inline-block; + overflow: hidden; + padding-left: 8px; + text-overflow: ellipsis; + white-space: nowrap; } + .select2-container .select2-search--inline { + float: left; } + .select2-container .select2-search--inline .select2-search__field { + box-sizing: border-box; + border: none; + font-size: 100%; + margin-top: 5px; + padding: 0; } + .select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button { + -webkit-appearance: none; } + +.select2-dropdown { + background-color: white; + border: 1px solid #aaa; + border-radius: 4px; + box-sizing: border-box; + display: block; + position: absolute; + left: -100000px; + width: 100%; + z-index: 1051; } + +.select2-results { + display: block; } + +.select2-results__options { + list-style: none; + margin: 0; + padding: 0; } + +.select2-results__option { + padding: 6px; + user-select: none; + -webkit-user-select: none; } + .select2-results__option[aria-selected] { + cursor: pointer; } + +.select2-container--open .select2-dropdown { + left: 0; } + +.select2-container--open .select2-dropdown--above { + border-bottom: none; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; } + +.select2-container--open .select2-dropdown--below { + border-top: none; + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.select2-search--dropdown { + display: block; + padding: 4px; } + .select2-search--dropdown .select2-search__field { + padding: 4px; + width: 100%; + box-sizing: border-box; } + .select2-search--dropdown .select2-search__field::-webkit-search-cancel-button { + -webkit-appearance: none; } + .select2-search--dropdown.select2-search--hide { + display: none; } + +.select2-close-mask { + border: 0; + margin: 0; + padding: 0; + display: block; + position: fixed; + left: 0; + top: 0; + min-height: 100%; + min-width: 100%; + height: auto; + width: auto; + opacity: 0; + z-index: 99; + background-color: #fff; + filter: alpha(opacity=0); } + +.select2-hidden-accessible { + border: 0 !important; + clip: rect(0 0 0 0) !important; + -webkit-clip-path: inset(50%) !important; + clip-path: inset(50%) !important; + height: 1px !important; + overflow: hidden !important; + padding: 0 !important; + position: absolute !important; + width: 1px !important; + white-space: nowrap !important; } + +.select2-container--default .select2-selection--single { + background-color: #fff; + border: 1px solid #aaa; + border-radius: 4px; } + .select2-container--default .select2-selection--single .select2-selection__rendered { + color: #444; + line-height: 28px; } + .select2-container--default .select2-selection--single .select2-selection__clear { + cursor: pointer; + float: right; + font-weight: bold; } + .select2-container--default .select2-selection--single .select2-selection__placeholder { + color: #999; } + .select2-container--default .select2-selection--single .select2-selection__arrow { + height: 26px; + position: absolute; + top: 1px; + right: 1px; + width: 20px; } + .select2-container--default .select2-selection--single .select2-selection__arrow b { + border-color: #888 transparent transparent transparent; + border-style: solid; + border-width: 5px 4px 0 4px; + height: 0; + left: 50%; + margin-left: -4px; + margin-top: -2px; + position: absolute; + top: 50%; + width: 0; } + +.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear { + float: left; } + +.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow { + left: 1px; + right: auto; } + +.select2-container--default.select2-container--disabled .select2-selection--single { + background-color: #eee; + cursor: default; } + .select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear { + display: none; } + +.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b { + border-color: transparent transparent #888 transparent; + border-width: 0 4px 5px 4px; } + +.select2-container--default .select2-selection--multiple { + background-color: white; + border: 1px solid #aaa; + border-radius: 4px; + cursor: text; } + .select2-container--default .select2-selection--multiple .select2-selection__rendered { + box-sizing: border-box; + list-style: none; + margin: 0; + padding: 0 5px; + width: 100%; } + .select2-container--default .select2-selection--multiple .select2-selection__rendered li { + list-style: none; } + .select2-container--default .select2-selection--multiple .select2-selection__clear { + cursor: pointer; + float: right; + font-weight: bold; + margin-top: 5px; + margin-right: 10px; + padding: 1px; } + .select2-container--default .select2-selection--multiple .select2-selection__choice { + background-color: #e4e4e4; + border: 1px solid #aaa; + border-radius: 4px; + cursor: default; + float: left; + margin-right: 5px; + margin-top: 5px; + padding: 0 5px; } + .select2-container--default .select2-selection--multiple .select2-selection__choice__remove { + color: #999; + cursor: pointer; + display: inline-block; + font-weight: bold; + margin-right: 2px; } + .select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover { + color: #333; } + +.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice, .select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline { + float: right; } + +.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice { + margin-left: 5px; + margin-right: auto; } + +.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove { + margin-left: 2px; + margin-right: auto; } + +.select2-container--default.select2-container--focus .select2-selection--multiple { + border: solid black 1px; + outline: 0; } + +.select2-container--default.select2-container--disabled .select2-selection--multiple { + background-color: #eee; + cursor: default; } + +.select2-container--default.select2-container--disabled .select2-selection__choice__remove { + display: none; } + +.select2-container--default.select2-container--open.select2-container--above .select2-selection--single, .select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple { + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.select2-container--default.select2-container--open.select2-container--below .select2-selection--single, .select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; } + +.select2-container--default .select2-search--dropdown .select2-search__field { + border: 1px solid #aaa; } + +.select2-container--default .select2-search--inline .select2-search__field { + background: transparent; + border: none; + outline: 0; + box-shadow: none; + -webkit-appearance: textfield; } + +.select2-container--default .select2-results > .select2-results__options { + max-height: 200px; + overflow-y: auto; } + +.select2-container--default .select2-results__option[role=group] { + padding: 0; } + +.select2-container--default .select2-results__option[aria-disabled=true] { + color: #999; } + +.select2-container--default .select2-results__option[aria-selected=true] { + background-color: #ddd; } + +.select2-container--default .select2-results__option .select2-results__option { + padding-left: 1em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__group { + padding-left: 0; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option { + margin-left: -1em; + padding-left: 2em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -2em; + padding-left: 3em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -3em; + padding-left: 4em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -4em; + padding-left: 5em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -5em; + padding-left: 6em; } + +.select2-container--default .select2-results__option--highlighted[aria-selected] { + background-color: #5897fb; + color: white; } + +.select2-container--default .select2-results__group { + cursor: default; + display: block; + padding: 6px; } + +.select2-container--classic .select2-selection--single { + background-color: #f7f7f7; + border: 1px solid #aaa; + border-radius: 4px; + outline: 0; + background-image: -webkit-linear-gradient(top, white 50%, #eeeeee 100%); + background-image: -o-linear-gradient(top, white 50%, #eeeeee 100%); + background-image: linear-gradient(to bottom, white 50%, #eeeeee 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0); } + .select2-container--classic .select2-selection--single:focus { + border: 1px solid #5897fb; } + .select2-container--classic .select2-selection--single .select2-selection__rendered { + color: #444; + line-height: 28px; } + .select2-container--classic .select2-selection--single .select2-selection__clear { + cursor: pointer; + float: right; + font-weight: bold; + margin-right: 10px; } + .select2-container--classic .select2-selection--single .select2-selection__placeholder { + color: #999; } + .select2-container--classic .select2-selection--single .select2-selection__arrow { + background-color: #ddd; + border: none; + border-left: 1px solid #aaa; + border-top-right-radius: 4px; + border-bottom-right-radius: 4px; + height: 26px; + position: absolute; + top: 1px; + right: 1px; + width: 20px; + background-image: -webkit-linear-gradient(top, #eeeeee 50%, #cccccc 100%); + background-image: -o-linear-gradient(top, #eeeeee 50%, #cccccc 100%); + background-image: linear-gradient(to bottom, #eeeeee 50%, #cccccc 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0); } + .select2-container--classic .select2-selection--single .select2-selection__arrow b { + border-color: #888 transparent transparent transparent; + border-style: solid; + border-width: 5px 4px 0 4px; + height: 0; + left: 50%; + margin-left: -4px; + margin-top: -2px; + position: absolute; + top: 50%; + width: 0; } + +.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear { + float: left; } + +.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow { + border: none; + border-right: 1px solid #aaa; + border-radius: 0; + border-top-left-radius: 4px; + border-bottom-left-radius: 4px; + left: 1px; + right: auto; } + +.select2-container--classic.select2-container--open .select2-selection--single { + border: 1px solid #5897fb; } + .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow { + background: transparent; + border: none; } + .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b { + border-color: transparent transparent #888 transparent; + border-width: 0 4px 5px 4px; } + +.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single { + border-top: none; + border-top-left-radius: 0; + border-top-right-radius: 0; + background-image: -webkit-linear-gradient(top, white 0%, #eeeeee 50%); + background-image: -o-linear-gradient(top, white 0%, #eeeeee 50%); + background-image: linear-gradient(to bottom, white 0%, #eeeeee 50%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0); } + +.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single { + border-bottom: none; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; + background-image: -webkit-linear-gradient(top, #eeeeee 50%, white 100%); + background-image: -o-linear-gradient(top, #eeeeee 50%, white 100%); + background-image: linear-gradient(to bottom, #eeeeee 50%, white 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0); } + +.select2-container--classic .select2-selection--multiple { + background-color: white; + border: 1px solid #aaa; + border-radius: 4px; + cursor: text; + outline: 0; } + .select2-container--classic .select2-selection--multiple:focus { + border: 1px solid #5897fb; } + .select2-container--classic .select2-selection--multiple .select2-selection__rendered { + list-style: none; + margin: 0; + padding: 0 5px; } + .select2-container--classic .select2-selection--multiple .select2-selection__clear { + display: none; } + .select2-container--classic .select2-selection--multiple .select2-selection__choice { + background-color: #e4e4e4; + border: 1px solid #aaa; + border-radius: 4px; + cursor: default; + float: left; + margin-right: 5px; + margin-top: 5px; + padding: 0 5px; } + .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove { + color: #888; + cursor: pointer; + display: inline-block; + font-weight: bold; + margin-right: 2px; } + .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover { + color: #555; } + +.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice { + float: right; + margin-left: 5px; + margin-right: auto; } + +.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove { + margin-left: 2px; + margin-right: auto; } + +.select2-container--classic.select2-container--open .select2-selection--multiple { + border: 1px solid #5897fb; } + +.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple { + border-top: none; + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple { + border-bottom: none; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; } + +.select2-container--classic .select2-search--dropdown .select2-search__field { + border: 1px solid #aaa; + outline: 0; } + +.select2-container--classic .select2-search--inline .select2-search__field { + outline: 0; + box-shadow: none; } + +.select2-container--classic .select2-dropdown { + background-color: white; + border: 1px solid transparent; } + +.select2-container--classic .select2-dropdown--above { + border-bottom: none; } + +.select2-container--classic .select2-dropdown--below { + border-top: none; } + +.select2-container--classic .select2-results > .select2-results__options { + max-height: 200px; + overflow-y: auto; } + +.select2-container--classic .select2-results__option[role=group] { + padding: 0; } + +.select2-container--classic .select2-results__option[aria-disabled=true] { + color: grey; } + +.select2-container--classic .select2-results__option--highlighted[aria-selected] { + background-color: #3875d7; + color: white; } + +.select2-container--classic .select2-results__group { + cursor: default; + display: block; + padding: 6px; } + +.select2-container--classic.select2-container--open .select2-dropdown { + border-color: #5897fb; } diff --git a/staticfiles/admin/css/vendor/select2/select2.min.css b/staticfiles/admin/css/vendor/select2/select2.min.css new file mode 100644 index 0000000..7c18ad5 --- /dev/null +++ b/staticfiles/admin/css/vendor/select2/select2.min.css @@ -0,0 +1 @@ +.select2-container{box-sizing:border-box;display:inline-block;margin:0;position:relative;vertical-align:middle}.select2-container .select2-selection--single{box-sizing:border-box;cursor:pointer;display:block;height:28px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--single .select2-selection__rendered{display:block;padding-left:8px;padding-right:20px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-selection--single .select2-selection__clear{position:relative}.select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered{padding-right:8px;padding-left:20px}.select2-container .select2-selection--multiple{box-sizing:border-box;cursor:pointer;display:block;min-height:32px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--multiple .select2-selection__rendered{display:inline-block;overflow:hidden;padding-left:8px;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-search--inline{float:left}.select2-container .select2-search--inline .select2-search__field{box-sizing:border-box;border:none;font-size:100%;margin-top:5px;padding:0}.select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-dropdown{background-color:white;border:1px solid #aaa;border-radius:4px;box-sizing:border-box;display:block;position:absolute;left:-100000px;width:100%;z-index:1051}.select2-results{display:block}.select2-results__options{list-style:none;margin:0;padding:0}.select2-results__option{padding:6px;user-select:none;-webkit-user-select:none}.select2-results__option[aria-selected]{cursor:pointer}.select2-container--open .select2-dropdown{left:0}.select2-container--open .select2-dropdown--above{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--open .select2-dropdown--below{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-search--dropdown{display:block;padding:4px}.select2-search--dropdown .select2-search__field{padding:4px;width:100%;box-sizing:border-box}.select2-search--dropdown .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-search--dropdown.select2-search--hide{display:none}.select2-close-mask{border:0;margin:0;padding:0;display:block;position:fixed;left:0;top:0;min-height:100%;min-width:100%;height:auto;width:auto;opacity:0;z-index:99;background-color:#fff;filter:alpha(opacity=0)}.select2-hidden-accessible{border:0 !important;clip:rect(0 0 0 0) !important;-webkit-clip-path:inset(50%) !important;clip-path:inset(50%) !important;height:1px !important;overflow:hidden !important;padding:0 !important;position:absolute !important;width:1px !important;white-space:nowrap !important}.select2-container--default .select2-selection--single{background-color:#fff;border:1px solid #aaa;border-radius:4px}.select2-container--default .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--default .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold}.select2-container--default .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--default .select2-selection--single .select2-selection__arrow{height:26px;position:absolute;top:1px;right:1px;width:20px}.select2-container--default .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow{left:1px;right:auto}.select2-container--default.select2-container--disabled .select2-selection--single{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear{display:none}.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--default .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text}.select2-container--default .select2-selection--multiple .select2-selection__rendered{box-sizing:border-box;list-style:none;margin:0;padding:0 5px;width:100%}.select2-container--default .select2-selection--multiple .select2-selection__rendered li{list-style:none}.select2-container--default .select2-selection--multiple .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-top:5px;margin-right:10px;padding:1px}.select2-container--default .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove{color:#999;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover{color:#333}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline{float:right}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--default.select2-container--focus .select2-selection--multiple{border:solid black 1px;outline:0}.select2-container--default.select2-container--disabled .select2-selection--multiple{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection__choice__remove{display:none}.select2-container--default.select2-container--open.select2-container--above .select2-selection--single,.select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple{border-top-left-radius:0;border-top-right-radius:0}.select2-container--default.select2-container--open.select2-container--below .select2-selection--single,.select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--default .select2-search--dropdown .select2-search__field{border:1px solid #aaa}.select2-container--default .select2-search--inline .select2-search__field{background:transparent;border:none;outline:0;box-shadow:none;-webkit-appearance:textfield}.select2-container--default .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--default .select2-results__option[role=group]{padding:0}.select2-container--default .select2-results__option[aria-disabled=true]{color:#999}.select2-container--default .select2-results__option[aria-selected=true]{background-color:#ddd}.select2-container--default .select2-results__option .select2-results__option{padding-left:1em}.select2-container--default .select2-results__option .select2-results__option .select2-results__group{padding-left:0}.select2-container--default .select2-results__option .select2-results__option .select2-results__option{margin-left:-1em;padding-left:2em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-2em;padding-left:3em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-3em;padding-left:4em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-4em;padding-left:5em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-5em;padding-left:6em}.select2-container--default .select2-results__option--highlighted[aria-selected]{background-color:#5897fb;color:white}.select2-container--default .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic .select2-selection--single{background-color:#f7f7f7;border:1px solid #aaa;border-radius:4px;outline:0;background-image:-webkit-linear-gradient(top, #fff 50%, #eee 100%);background-image:-o-linear-gradient(top, #fff 50%, #eee 100%);background-image:linear-gradient(to bottom, #fff 50%, #eee 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic .select2-selection--single:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--classic .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-right:10px}.select2-container--classic .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--classic .select2-selection--single .select2-selection__arrow{background-color:#ddd;border:none;border-left:1px solid #aaa;border-top-right-radius:4px;border-bottom-right-radius:4px;height:26px;position:absolute;top:1px;right:1px;width:20px;background-image:-webkit-linear-gradient(top, #eee 50%, #ccc 100%);background-image:-o-linear-gradient(top, #eee 50%, #ccc 100%);background-image:linear-gradient(to bottom, #eee 50%, #ccc 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0)}.select2-container--classic .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow{border:none;border-right:1px solid #aaa;border-radius:0;border-top-left-radius:4px;border-bottom-left-radius:4px;left:1px;right:auto}.select2-container--classic.select2-container--open .select2-selection--single{border:1px solid #5897fb}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow{background:transparent;border:none}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single{border-top:none;border-top-left-radius:0;border-top-right-radius:0;background-image:-webkit-linear-gradient(top, #fff 0%, #eee 50%);background-image:-o-linear-gradient(top, #fff 0%, #eee 50%);background-image:linear-gradient(to bottom, #fff 0%, #eee 50%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0;background-image:-webkit-linear-gradient(top, #eee 50%, #fff 100%);background-image:-o-linear-gradient(top, #eee 50%, #fff 100%);background-image:linear-gradient(to bottom, #eee 50%, #fff 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0)}.select2-container--classic .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text;outline:0}.select2-container--classic .select2-selection--multiple:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--multiple .select2-selection__rendered{list-style:none;margin:0;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__clear{display:none}.select2-container--classic .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove{color:#888;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover{color:#555}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{float:right;margin-left:5px;margin-right:auto}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--classic.select2-container--open .select2-selection--multiple{border:1px solid #5897fb}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--classic .select2-search--dropdown .select2-search__field{border:1px solid #aaa;outline:0}.select2-container--classic .select2-search--inline .select2-search__field{outline:0;box-shadow:none}.select2-container--classic .select2-dropdown{background-color:#fff;border:1px solid transparent}.select2-container--classic .select2-dropdown--above{border-bottom:none}.select2-container--classic .select2-dropdown--below{border-top:none}.select2-container--classic .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--classic .select2-results__option[role=group]{padding:0}.select2-container--classic .select2-results__option[aria-disabled=true]{color:grey}.select2-container--classic .select2-results__option--highlighted[aria-selected]{background-color:#3875d7;color:#fff}.select2-container--classic .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic.select2-container--open .select2-dropdown{border-color:#5897fb} diff --git a/staticfiles/admin/css/widgets.css b/staticfiles/admin/css/widgets.css new file mode 100644 index 0000000..d3d4732 --- /dev/null +++ b/staticfiles/admin/css/widgets.css @@ -0,0 +1,603 @@ +/* SELECTOR (FILTER INTERFACE) */ + +.selector { + display: flex; + flex-grow: 1; + gap: 0 10px; +} + +.selector select { + height: 17.2em; + flex: 1 0 auto; + overflow: scroll; + width: 100%; +} + +.selector-available, .selector-chosen { + text-align: center; + display: flex; + flex-direction: column; + flex: 1 1; +} + +.selector-available h2, .selector-chosen h2 { + border: 1px solid var(--border-color); + border-radius: 4px 4px 0 0; +} + +.selector-chosen .list-footer-display { + border: 1px solid var(--border-color); + border-top: none; + border-radius: 0 0 4px 4px; + margin: 0 0 10px; + padding: 8px; + text-align: center; + background: var(--primary); + color: var(--header-link-color); + cursor: pointer; +} +.selector-chosen .list-footer-display__clear { + color: var(--breadcrumbs-fg); +} + +.selector-chosen h2 { + background: var(--secondary); + color: var(--header-link-color); +} + +.selector .selector-available h2 { + background: var(--darkened-bg); + color: var(--body-quiet-color); +} + +.selector .selector-filter { + border: 1px solid var(--border-color); + border-width: 0 1px; + padding: 8px; + color: var(--body-quiet-color); + font-size: 0.625rem; + margin: 0; + text-align: left; + display: flex; +} + +.selector .selector-filter label, +.inline-group .aligned .selector .selector-filter label { + float: left; + margin: 7px 0 0; + width: 18px; + height: 18px; + padding: 0; + overflow: hidden; + line-height: 1; + min-width: auto; +} + +.selector-filter input { + flex-grow: 1; +} + +.selector .selector-available input, +.selector .selector-chosen input { + margin-left: 8px; +} + +.selector ul.selector-chooser { + align-self: center; + width: 22px; + background-color: var(--selected-bg); + border-radius: 10px; + margin: 0; + padding: 0; + transform: translateY(-17px); +} + +.selector-chooser li { + margin: 0; + padding: 3px; + list-style-type: none; +} + +.selector select { + padding: 0 10px; + margin: 0 0 10px; + border-radius: 0 0 4px 4px; +} +.selector .selector-chosen--with-filtered select { + margin: 0; + border-radius: 0; + height: 14em; +} + +.selector .selector-chosen:not(.selector-chosen--with-filtered) .list-footer-display { + display: none; +} + +.selector-add, .selector-remove { + width: 16px; + height: 16px; + display: block; + text-indent: -3000px; + overflow: hidden; + cursor: default; + opacity: 0.55; +} + +.active.selector-add, .active.selector-remove { + opacity: 1; +} + +.active.selector-add:hover, .active.selector-remove:hover { + cursor: pointer; +} + +.selector-add { + background: url(../img/selector-icons.svg) 0 -96px no-repeat; +} + +.active.selector-add:focus, .active.selector-add:hover { + background-position: 0 -112px; +} + +.selector-remove { + background: url(../img/selector-icons.svg) 0 -64px no-repeat; +} + +.active.selector-remove:focus, .active.selector-remove:hover { + background-position: 0 -80px; +} + +a.selector-chooseall, a.selector-clearall { + display: inline-block; + height: 16px; + text-align: left; + margin: 0 auto; + overflow: hidden; + font-weight: bold; + line-height: 16px; + color: var(--body-quiet-color); + text-decoration: none; + opacity: 0.55; +} + +a.active.selector-chooseall:focus, a.active.selector-clearall:focus, +a.active.selector-chooseall:hover, a.active.selector-clearall:hover { + color: var(--link-fg); +} + +a.active.selector-chooseall, a.active.selector-clearall { + opacity: 1; +} + +a.active.selector-chooseall:hover, a.active.selector-clearall:hover { + cursor: pointer; +} + +a.selector-chooseall { + padding: 0 18px 0 0; + background: url(../img/selector-icons.svg) right -160px no-repeat; + cursor: default; +} + +a.active.selector-chooseall:focus, a.active.selector-chooseall:hover { + background-position: 100% -176px; +} + +a.selector-clearall { + padding: 0 0 0 18px; + background: url(../img/selector-icons.svg) 0 -128px no-repeat; + cursor: default; +} + +a.active.selector-clearall:focus, a.active.selector-clearall:hover { + background-position: 0 -144px; +} + +/* STACKED SELECTORS */ + +.stacked { + float: left; + width: 490px; + display: block; +} + +.stacked select { + width: 480px; + height: 10.1em; +} + +.stacked .selector-available, .stacked .selector-chosen { + width: 480px; +} + +.stacked .selector-available { + margin-bottom: 0; +} + +.stacked .selector-available input { + width: 422px; +} + +.stacked ul.selector-chooser { + height: 22px; + width: 50px; + margin: 0 0 10px 40%; + background-color: #eee; + border-radius: 10px; + transform: none; +} + +.stacked .selector-chooser li { + float: left; + padding: 3px 3px 3px 5px; +} + +.stacked .selector-chooseall, .stacked .selector-clearall { + display: none; +} + +.stacked .selector-add { + background: url(../img/selector-icons.svg) 0 -32px no-repeat; + cursor: default; +} + +.stacked .active.selector-add { + background-position: 0 -32px; + cursor: pointer; +} + +.stacked .active.selector-add:focus, .stacked .active.selector-add:hover { + background-position: 0 -48px; + cursor: pointer; +} + +.stacked .selector-remove { + background: url(../img/selector-icons.svg) 0 0 no-repeat; + cursor: default; +} + +.stacked .active.selector-remove { + background-position: 0 0px; + cursor: pointer; +} + +.stacked .active.selector-remove:focus, .stacked .active.selector-remove:hover { + background-position: 0 -16px; + cursor: pointer; +} + +.selector .help-icon { + background: url(../img/icon-unknown.svg) 0 0 no-repeat; + display: inline-block; + vertical-align: middle; + margin: -2px 0 0 2px; + width: 13px; + height: 13px; +} + +.selector .selector-chosen .help-icon { + background: url(../img/icon-unknown-alt.svg) 0 0 no-repeat; +} + +.selector .search-label-icon { + background: url(../img/search.svg) 0 0 no-repeat; + display: inline-block; + height: 1.125rem; + width: 1.125rem; +} + +/* DATE AND TIME */ + +p.datetime { + line-height: 20px; + margin: 0; + padding: 0; + color: var(--body-quiet-color); + font-weight: bold; +} + +.datetime span { + white-space: nowrap; + font-weight: normal; + font-size: 0.6875rem; + color: var(--body-quiet-color); +} + +.datetime input, .form-row .datetime input.vDateField, .form-row .datetime input.vTimeField { + margin-left: 5px; + margin-bottom: 4px; +} + +table p.datetime { + font-size: 0.6875rem; + margin-left: 0; + padding-left: 0; +} + +.datetimeshortcuts .clock-icon, .datetimeshortcuts .date-icon { + position: relative; + display: inline-block; + vertical-align: middle; + height: 16px; + width: 16px; + overflow: hidden; +} + +.datetimeshortcuts .clock-icon { + background: url(../img/icon-clock.svg) 0 0 no-repeat; +} + +.datetimeshortcuts a:focus .clock-icon, +.datetimeshortcuts a:hover .clock-icon { + background-position: 0 -16px; +} + +.datetimeshortcuts .date-icon { + background: url(../img/icon-calendar.svg) 0 0 no-repeat; + top: -1px; +} + +.datetimeshortcuts a:focus .date-icon, +.datetimeshortcuts a:hover .date-icon { + background-position: 0 -16px; +} + +.timezonewarning { + font-size: 0.6875rem; + color: var(--body-quiet-color); +} + +/* URL */ + +p.url { + line-height: 20px; + margin: 0; + padding: 0; + color: var(--body-quiet-color); + font-size: 0.6875rem; + font-weight: bold; +} + +.url a { + font-weight: normal; +} + +/* FILE UPLOADS */ + +p.file-upload { + line-height: 20px; + margin: 0; + padding: 0; + color: var(--body-quiet-color); + font-size: 0.6875rem; + font-weight: bold; +} + +.file-upload a { + font-weight: normal; +} + +.file-upload .deletelink { + margin-left: 5px; +} + +span.clearable-file-input label { + color: var(--body-fg); + font-size: 0.6875rem; + display: inline; + float: none; +} + +/* CALENDARS & CLOCKS */ + +.calendarbox, .clockbox { + margin: 5px auto; + font-size: 0.75rem; + width: 19em; + text-align: center; + background: var(--body-bg); + color: var(--body-fg); + border: 1px solid var(--hairline-color); + border-radius: 4px; + box-shadow: 0 2px 4px rgba(0, 0, 0, 0.15); + overflow: hidden; + position: relative; +} + +.clockbox { + width: auto; +} + +.calendar { + margin: 0; + padding: 0; +} + +.calendar table { + margin: 0; + padding: 0; + border-collapse: collapse; + background: white; + width: 100%; +} + +.calendar caption, .calendarbox h2 { + margin: 0; + text-align: center; + border-top: none; + font-weight: 700; + font-size: 0.75rem; + color: #333; + background: var(--accent); +} + +.calendar th { + padding: 8px 5px; + background: var(--darkened-bg); + border-bottom: 1px solid var(--border-color); + font-weight: 400; + font-size: 0.75rem; + text-align: center; + color: var(--body-quiet-color); +} + +.calendar td { + font-weight: 400; + font-size: 0.75rem; + text-align: center; + padding: 0; + border-top: 1px solid var(--hairline-color); + border-bottom: none; +} + +.calendar td.selected a { + background: var(--secondary); + color: var(--button-fg); +} + +.calendar td.nonday { + background: var(--darkened-bg); +} + +.calendar td.today a { + font-weight: 700; +} + +.calendar td a, .timelist a { + display: block; + font-weight: 400; + padding: 6px; + text-decoration: none; + color: var(--body-quiet-color); +} + +.calendar td a:focus, .timelist a:focus, +.calendar td a:hover, .timelist a:hover { + background: var(--primary); + color: white; +} + +.calendar td a:active, .timelist a:active { + background: var(--header-bg); + color: white; +} + +.calendarnav { + font-size: 0.625rem; + text-align: center; + color: #ccc; + margin: 0; + padding: 1px 3px; +} + +.calendarnav a:link, #calendarnav a:visited, +#calendarnav a:focus, #calendarnav a:hover { + color: var(--body-quiet-color); +} + +.calendar-shortcuts { + background: var(--body-bg); + color: var(--body-quiet-color); + font-size: 0.6875rem; + line-height: 0.6875rem; + border-top: 1px solid var(--hairline-color); + padding: 8px 0; +} + +.calendarbox .calendarnav-previous, .calendarbox .calendarnav-next { + display: block; + position: absolute; + top: 8px; + width: 15px; + height: 15px; + text-indent: -9999px; + padding: 0; +} + +.calendarnav-previous { + left: 10px; + background: url(../img/calendar-icons.svg) 0 0 no-repeat; +} + +.calendarbox .calendarnav-previous:focus, +.calendarbox .calendarnav-previous:hover { + background-position: 0 -15px; +} + +.calendarnav-next { + right: 10px; + background: url(../img/calendar-icons.svg) 0 -30px no-repeat; +} + +.calendarbox .calendarnav-next:focus, +.calendarbox .calendarnav-next:hover { + background-position: 0 -45px; +} + +.calendar-cancel { + margin: 0; + padding: 4px 0; + font-size: 0.75rem; + background: var(--close-button-bg); + border-top: 1px solid var(--border-color); + color: var(--button-fg); +} + +.calendar-cancel:focus, .calendar-cancel:hover { + background: var(--close-button-hover-bg); +} + +.calendar-cancel a { + color: var(--button-fg); + display: block; +} + +ul.timelist, .timelist li { + list-style-type: none; + margin: 0; + padding: 0; +} + +.timelist a { + padding: 2px; +} + +/* EDIT INLINE */ + +.inline-deletelink { + float: right; + text-indent: -9999px; + background: url(../img/inline-delete.svg) 0 0 no-repeat; + width: 16px; + height: 16px; + border: 0px none; +} + +.inline-deletelink:focus, .inline-deletelink:hover { + cursor: pointer; +} + +/* RELATED WIDGET WRAPPER */ +.related-widget-wrapper { + display: flex; + gap: 0 10px; + flex-grow: 1; + flex-wrap: wrap; + margin-bottom: 5px; +} + +.related-widget-wrapper-link { + opacity: .6; + filter: grayscale(1); +} + +.related-widget-wrapper-link:link { + opacity: 1; + filter: grayscale(0); +} + +/* GIS MAPS */ +.dj_map { + width: 600px; + height: 400px; +} diff --git a/staticfiles/admin/img/LICENSE b/staticfiles/admin/img/LICENSE new file mode 100644 index 0000000..a4faaa1 --- /dev/null +++ b/staticfiles/admin/img/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2014 Code Charm Ltd + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/staticfiles/admin/img/README.txt b/staticfiles/admin/img/README.txt new file mode 100644 index 0000000..4eb2e49 --- /dev/null +++ b/staticfiles/admin/img/README.txt @@ -0,0 +1,7 @@ +All icons are taken from Font Awesome (http://fontawesome.io/) project. +The Font Awesome font is licensed under the SIL OFL 1.1: +- https://scripts.sil.org/OFL + +SVG icons source: https://github.com/encharm/Font-Awesome-SVG-PNG +Font-Awesome-SVG-PNG is licensed under the MIT license (see file license +in current folder). diff --git a/staticfiles/admin/img/calendar-icons.svg b/staticfiles/admin/img/calendar-icons.svg new file mode 100644 index 0000000..dbf21c3 --- /dev/null +++ b/staticfiles/admin/img/calendar-icons.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/staticfiles/admin/img/gis/move_vertex_off.svg b/staticfiles/admin/img/gis/move_vertex_off.svg new file mode 100644 index 0000000..228854f --- /dev/null +++ b/staticfiles/admin/img/gis/move_vertex_off.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/staticfiles/admin/img/gis/move_vertex_on.svg b/staticfiles/admin/img/gis/move_vertex_on.svg new file mode 100644 index 0000000..96b87fd --- /dev/null +++ b/staticfiles/admin/img/gis/move_vertex_on.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/staticfiles/admin/img/icon-addlink.svg b/staticfiles/admin/img/icon-addlink.svg new file mode 100644 index 0000000..e004fb1 --- /dev/null +++ b/staticfiles/admin/img/icon-addlink.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-alert.svg b/staticfiles/admin/img/icon-alert.svg new file mode 100644 index 0000000..e51ea83 --- /dev/null +++ b/staticfiles/admin/img/icon-alert.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-calendar.svg b/staticfiles/admin/img/icon-calendar.svg new file mode 100644 index 0000000..97910a9 --- /dev/null +++ b/staticfiles/admin/img/icon-calendar.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/staticfiles/admin/img/icon-changelink.svg b/staticfiles/admin/img/icon-changelink.svg new file mode 100644 index 0000000..bbb137a --- /dev/null +++ b/staticfiles/admin/img/icon-changelink.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-clock.svg b/staticfiles/admin/img/icon-clock.svg new file mode 100644 index 0000000..bf9985d --- /dev/null +++ b/staticfiles/admin/img/icon-clock.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/staticfiles/admin/img/icon-deletelink.svg b/staticfiles/admin/img/icon-deletelink.svg new file mode 100644 index 0000000..4059b15 --- /dev/null +++ b/staticfiles/admin/img/icon-deletelink.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-hidelink.svg b/staticfiles/admin/img/icon-hidelink.svg new file mode 100644 index 0000000..2a8b404 --- /dev/null +++ b/staticfiles/admin/img/icon-hidelink.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-no.svg b/staticfiles/admin/img/icon-no.svg new file mode 100644 index 0000000..2e0d383 --- /dev/null +++ b/staticfiles/admin/img/icon-no.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-unknown-alt.svg b/staticfiles/admin/img/icon-unknown-alt.svg new file mode 100644 index 0000000..1c6b99f --- /dev/null +++ b/staticfiles/admin/img/icon-unknown-alt.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-unknown.svg b/staticfiles/admin/img/icon-unknown.svg new file mode 100644 index 0000000..50b4f97 --- /dev/null +++ b/staticfiles/admin/img/icon-unknown.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-viewlink.svg b/staticfiles/admin/img/icon-viewlink.svg new file mode 100644 index 0000000..a1ca1d3 --- /dev/null +++ b/staticfiles/admin/img/icon-viewlink.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/icon-yes.svg b/staticfiles/admin/img/icon-yes.svg new file mode 100644 index 0000000..5883d87 --- /dev/null +++ b/staticfiles/admin/img/icon-yes.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/inline-delete.svg b/staticfiles/admin/img/inline-delete.svg new file mode 100644 index 0000000..17d1ad6 --- /dev/null +++ b/staticfiles/admin/img/inline-delete.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/search.svg b/staticfiles/admin/img/search.svg new file mode 100644 index 0000000..c8c69b2 --- /dev/null +++ b/staticfiles/admin/img/search.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/selector-icons.svg b/staticfiles/admin/img/selector-icons.svg new file mode 100644 index 0000000..926b8e2 --- /dev/null +++ b/staticfiles/admin/img/selector-icons.svg @@ -0,0 +1,34 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/staticfiles/admin/img/sorting-icons.svg b/staticfiles/admin/img/sorting-icons.svg new file mode 100644 index 0000000..7c31ec9 --- /dev/null +++ b/staticfiles/admin/img/sorting-icons.svg @@ -0,0 +1,19 @@ + + + + + + + + + + + + + + + + + + + diff --git a/staticfiles/admin/img/tooltag-add.svg b/staticfiles/admin/img/tooltag-add.svg new file mode 100644 index 0000000..1ca64ae --- /dev/null +++ b/staticfiles/admin/img/tooltag-add.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/img/tooltag-arrowright.svg b/staticfiles/admin/img/tooltag-arrowright.svg new file mode 100644 index 0000000..b664d61 --- /dev/null +++ b/staticfiles/admin/img/tooltag-arrowright.svg @@ -0,0 +1,3 @@ + + + diff --git a/staticfiles/admin/js/SelectBox.js b/staticfiles/admin/js/SelectBox.js new file mode 100644 index 0000000..3db4ec7 --- /dev/null +++ b/staticfiles/admin/js/SelectBox.js @@ -0,0 +1,116 @@ +'use strict'; +{ + const SelectBox = { + cache: {}, + init: function(id) { + const box = document.getElementById(id); + SelectBox.cache[id] = []; + const cache = SelectBox.cache[id]; + for (const node of box.options) { + cache.push({value: node.value, text: node.text, displayed: 1}); + } + }, + redisplay: function(id) { + // Repopulate HTML select box from cache + const box = document.getElementById(id); + const scroll_value_from_top = box.scrollTop; + box.innerHTML = ''; + for (const node of SelectBox.cache[id]) { + if (node.displayed) { + const new_option = new Option(node.text, node.value, false, false); + // Shows a tooltip when hovering over the option + new_option.title = node.text; + box.appendChild(new_option); + } + } + box.scrollTop = scroll_value_from_top; + }, + filter: function(id, text) { + // Redisplay the HTML select box, displaying only the choices containing ALL + // the words in text. (It's an AND search.) + const tokens = text.toLowerCase().split(/\s+/); + for (const node of SelectBox.cache[id]) { + node.displayed = 1; + const node_text = node.text.toLowerCase(); + for (const token of tokens) { + if (!node_text.includes(token)) { + node.displayed = 0; + break; // Once the first token isn't found we're done + } + } + } + SelectBox.redisplay(id); + }, + get_hidden_node_count(id) { + const cache = SelectBox.cache[id] || []; + return cache.filter(node => node.displayed === 0).length; + }, + delete_from_cache: function(id, value) { + let delete_index = null; + const cache = SelectBox.cache[id]; + for (const [i, node] of cache.entries()) { + if (node.value === value) { + delete_index = i; + break; + } + } + cache.splice(delete_index, 1); + }, + add_to_cache: function(id, option) { + SelectBox.cache[id].push({value: option.value, text: option.text, displayed: 1}); + }, + cache_contains: function(id, value) { + // Check if an item is contained in the cache + for (const node of SelectBox.cache[id]) { + if (node.value === value) { + return true; + } + } + return false; + }, + move: function(from, to) { + const from_box = document.getElementById(from); + for (const option of from_box.options) { + const option_value = option.value; + if (option.selected && SelectBox.cache_contains(from, option_value)) { + SelectBox.add_to_cache(to, {value: option_value, text: option.text, displayed: 1}); + SelectBox.delete_from_cache(from, option_value); + } + } + SelectBox.redisplay(from); + SelectBox.redisplay(to); + }, + move_all: function(from, to) { + const from_box = document.getElementById(from); + for (const option of from_box.options) { + const option_value = option.value; + if (SelectBox.cache_contains(from, option_value)) { + SelectBox.add_to_cache(to, {value: option_value, text: option.text, displayed: 1}); + SelectBox.delete_from_cache(from, option_value); + } + } + SelectBox.redisplay(from); + SelectBox.redisplay(to); + }, + sort: function(id) { + SelectBox.cache[id].sort(function(a, b) { + a = a.text.toLowerCase(); + b = b.text.toLowerCase(); + if (a > b) { + return 1; + } + if (a < b) { + return -1; + } + return 0; + } ); + }, + select_all: function(id) { + const box = document.getElementById(id); + for (const option of box.options) { + option.selected = true; + } + } + }; + window.SelectBox = SelectBox; +} diff --git a/staticfiles/admin/js/SelectFilter2.js b/staticfiles/admin/js/SelectFilter2.js new file mode 100644 index 0000000..fc59eba --- /dev/null +++ b/staticfiles/admin/js/SelectFilter2.js @@ -0,0 +1,286 @@ +/*global SelectBox, gettext, interpolate, quickElement, SelectFilter*/ +/* +SelectFilter2 - Turns a multiple-select box into a filter interface. + +Requires core.js and SelectBox.js. +*/ +'use strict'; +{ + window.SelectFilter = { + init: function(field_id, field_name, is_stacked) { + if (field_id.match(/__prefix__/)) { + // Don't initialize on empty forms. + return; + } + const from_box = document.getElementById(field_id); + from_box.id += '_from'; // change its ID + from_box.className = 'filtered'; + + for (const p of from_box.parentNode.getElementsByTagName('p')) { + if (p.classList.contains("info")) { + // Remove

, because it just gets in the way. + from_box.parentNode.removeChild(p); + } else if (p.classList.contains("help")) { + // Move help text up to the top so it isn't below the select + // boxes or wrapped off on the side to the right of the add + // button: + from_box.parentNode.insertBefore(p, from_box.parentNode.firstChild); + } + } + + //

or
+ const selector_div = quickElement('div', from_box.parentNode); + // Make sure the selector div is at the beginning so that the + // add link would be displayed to the right of the widget. + from_box.parentNode.prepend(selector_div); + selector_div.className = is_stacked ? 'selector stacked' : 'selector'; + + //
+ const selector_available = quickElement('div', selector_div); + selector_available.className = 'selector-available'; + const title_available = quickElement('h2', selector_available, interpolate(gettext('Available %s') + ' ', [field_name])); + quickElement( + 'span', title_available, '', + 'class', 'help help-tooltip help-icon', + 'title', interpolate( + gettext( + 'This is the list of available %s. You may choose some by ' + + 'selecting them in the box below and then clicking the ' + + '"Choose" arrow between the two boxes.' + ), + [field_name] + ) + ); + + const filter_p = quickElement('p', selector_available, '', 'id', field_id + '_filter'); + filter_p.className = 'selector-filter'; + + const search_filter_label = quickElement('label', filter_p, '', 'for', field_id + '_input'); + + quickElement( + 'span', search_filter_label, '', + 'class', 'help-tooltip search-label-icon', + 'title', interpolate(gettext("Type into this box to filter down the list of available %s."), [field_name]) + ); + + filter_p.appendChild(document.createTextNode(' ')); + + const filter_input = quickElement('input', filter_p, '', 'type', 'text', 'placeholder', gettext("Filter")); + filter_input.id = field_id + '_input'; + + selector_available.appendChild(from_box); + const choose_all = quickElement('a', selector_available, gettext('Choose all'), 'title', interpolate(gettext('Click to choose all %s at once.'), [field_name]), 'href', '#', 'id', field_id + '_add_all_link'); + choose_all.className = 'selector-chooseall'; + + //
    + const selector_chooser = quickElement('ul', selector_div); + selector_chooser.className = 'selector-chooser'; + const add_link = quickElement('a', quickElement('li', selector_chooser), gettext('Choose'), 'title', gettext('Choose'), 'href', '#', 'id', field_id + '_add_link'); + add_link.className = 'selector-add'; + const remove_link = quickElement('a', quickElement('li', selector_chooser), gettext('Remove'), 'title', gettext('Remove'), 'href', '#', 'id', field_id + '_remove_link'); + remove_link.className = 'selector-remove'; + + //
    + const selector_chosen = quickElement('div', selector_div, '', 'id', field_id + '_selector_chosen'); + selector_chosen.className = 'selector-chosen'; + const title_chosen = quickElement('h2', selector_chosen, interpolate(gettext('Chosen %s') + ' ', [field_name])); + quickElement( + 'span', title_chosen, '', + 'class', 'help help-tooltip help-icon', + 'title', interpolate( + gettext( + 'This is the list of chosen %s. You may remove some by ' + + 'selecting them in the box below and then clicking the ' + + '"Remove" arrow between the two boxes.' + ), + [field_name] + ) + ); + + const filter_selected_p = quickElement('p', selector_chosen, '', 'id', field_id + '_filter_selected'); + filter_selected_p.className = 'selector-filter'; + + const search_filter_selected_label = quickElement('label', filter_selected_p, '', 'for', field_id + '_selected_input'); + + quickElement( + 'span', search_filter_selected_label, '', + 'class', 'help-tooltip search-label-icon', + 'title', interpolate(gettext("Type into this box to filter down the list of selected %s."), [field_name]) + ); + + filter_selected_p.appendChild(document.createTextNode(' ')); + + const filter_selected_input = quickElement('input', filter_selected_p, '', 'type', 'text', 'placeholder', gettext("Filter")); + filter_selected_input.id = field_id + '_selected_input'; + + const to_box = quickElement('select', selector_chosen, '', 'id', field_id + '_to', 'multiple', '', 'size', from_box.size, 'name', from_box.name); + to_box.className = 'filtered'; + + const warning_footer = quickElement('div', selector_chosen, '', 'class', 'list-footer-display'); + quickElement('span', warning_footer, '', 'id', field_id + '_list-footer-display-text'); + quickElement('span', warning_footer, ' (click to clear)', 'class', 'list-footer-display__clear'); + + const clear_all = quickElement('a', selector_chosen, gettext('Remove all'), 'title', interpolate(gettext('Click to remove all chosen %s at once.'), [field_name]), 'href', '#', 'id', field_id + '_remove_all_link'); + clear_all.className = 'selector-clearall'; + + from_box.name = from_box.name + '_old'; + + // Set up the JavaScript event handlers for the select box filter interface + const move_selection = function(e, elem, move_func, from, to) { + if (elem.classList.contains('active')) { + move_func(from, to); + SelectFilter.refresh_icons(field_id); + SelectFilter.refresh_filtered_selects(field_id); + SelectFilter.refresh_filtered_warning(field_id); + } + e.preventDefault(); + }; + choose_all.addEventListener('click', function(e) { + move_selection(e, this, SelectBox.move_all, field_id + '_from', field_id + '_to'); + }); + add_link.addEventListener('click', function(e) { + move_selection(e, this, SelectBox.move, field_id + '_from', field_id + '_to'); + }); + remove_link.addEventListener('click', function(e) { + move_selection(e, this, SelectBox.move, field_id + '_to', field_id + '_from'); + }); + clear_all.addEventListener('click', function(e) { + move_selection(e, this, SelectBox.move_all, field_id + '_to', field_id + '_from'); + }); + warning_footer.addEventListener('click', function(e) { + filter_selected_input.value = ''; + SelectBox.filter(field_id + '_to', ''); + SelectFilter.refresh_filtered_warning(field_id); + SelectFilter.refresh_icons(field_id); + }); + filter_input.addEventListener('keypress', function(e) { + SelectFilter.filter_key_press(e, field_id, '_from', '_to'); + }); + filter_input.addEventListener('keyup', function(e) { + SelectFilter.filter_key_up(e, field_id, '_from'); + }); + filter_input.addEventListener('keydown', function(e) { + SelectFilter.filter_key_down(e, field_id, '_from', '_to'); + }); + filter_selected_input.addEventListener('keypress', function(e) { + SelectFilter.filter_key_press(e, field_id, '_to', '_from'); + }); + filter_selected_input.addEventListener('keyup', function(e) { + SelectFilter.filter_key_up(e, field_id, '_to', '_selected_input'); + }); + filter_selected_input.addEventListener('keydown', function(e) { + SelectFilter.filter_key_down(e, field_id, '_to', '_from'); + }); + selector_div.addEventListener('change', function(e) { + if (e.target.tagName === 'SELECT') { + SelectFilter.refresh_icons(field_id); + } + }); + selector_div.addEventListener('dblclick', function(e) { + if (e.target.tagName === 'OPTION') { + if (e.target.closest('select').id === field_id + '_to') { + SelectBox.move(field_id + '_to', field_id + '_from'); + } else { + SelectBox.move(field_id + '_from', field_id + '_to'); + } + SelectFilter.refresh_icons(field_id); + } + }); + from_box.closest('form').addEventListener('submit', function() { + SelectBox.filter(field_id + '_to', ''); + SelectBox.select_all(field_id + '_to'); + }); + SelectBox.init(field_id + '_from'); + SelectBox.init(field_id + '_to'); + // Move selected from_box options to to_box + SelectBox.move(field_id + '_from', field_id + '_to'); + + // Initial icon refresh + SelectFilter.refresh_icons(field_id); + }, + any_selected: function(field) { + // Temporarily add the required attribute and check validity. + field.required = true; + const any_selected = field.checkValidity(); + field.required = false; + return any_selected; + }, + refresh_filtered_warning: function(field_id) { + const count = SelectBox.get_hidden_node_count(field_id + '_to'); + const selector = document.getElementById(field_id + '_selector_chosen'); + const warning = document.getElementById(field_id + '_list-footer-display-text'); + selector.className = selector.className.replace('selector-chosen--with-filtered', ''); + warning.textContent = interpolate(ngettext( + '%s selected option not visible', + '%s selected options not visible', + count + ), [count]); + if(count > 0) { + selector.className += ' selector-chosen--with-filtered'; + } + }, + refresh_filtered_selects: function(field_id) { + SelectBox.filter(field_id + '_from', document.getElementById(field_id + "_input").value); + SelectBox.filter(field_id + '_to', document.getElementById(field_id + "_selected_input").value); + }, + refresh_icons: function(field_id) { + const from = document.getElementById(field_id + '_from'); + const to = document.getElementById(field_id + '_to'); + // Active if at least one item is selected + document.getElementById(field_id + '_add_link').classList.toggle('active', SelectFilter.any_selected(from)); + document.getElementById(field_id + '_remove_link').classList.toggle('active', SelectFilter.any_selected(to)); + // Active if the corresponding box isn't empty + document.getElementById(field_id + '_add_all_link').classList.toggle('active', from.querySelector('option')); + document.getElementById(field_id + '_remove_all_link').classList.toggle('active', to.querySelector('option')); + SelectFilter.refresh_filtered_warning(field_id); + }, + filter_key_press: function(event, field_id, source, target) { + const source_box = document.getElementById(field_id + source); + // don't submit form if user pressed Enter + if ((event.which && event.which === 13) || (event.keyCode && event.keyCode === 13)) { + source_box.selectedIndex = 0; + SelectBox.move(field_id + source, field_id + target); + source_box.selectedIndex = 0; + event.preventDefault(); + } + }, + filter_key_up: function(event, field_id, source, filter_input) { + const input = filter_input || '_input'; + const source_box = document.getElementById(field_id + source); + const temp = source_box.selectedIndex; + SelectBox.filter(field_id + source, document.getElementById(field_id + input).value); + source_box.selectedIndex = temp; + SelectFilter.refresh_filtered_warning(field_id); + SelectFilter.refresh_icons(field_id); + }, + filter_key_down: function(event, field_id, source, target) { + const source_box = document.getElementById(field_id + source); + // right key (39) or left key (37) + const direction = source === '_from' ? 39 : 37; + // right arrow -- move across + if ((event.which && event.which === direction) || (event.keyCode && event.keyCode === direction)) { + const old_index = source_box.selectedIndex; + SelectBox.move(field_id + source, field_id + target); + SelectFilter.refresh_filtered_selects(field_id); + SelectFilter.refresh_filtered_warning(field_id); + source_box.selectedIndex = (old_index === source_box.length) ? source_box.length - 1 : old_index; + return; + } + // down arrow -- wrap around + if ((event.which && event.which === 40) || (event.keyCode && event.keyCode === 40)) { + source_box.selectedIndex = (source_box.length === source_box.selectedIndex + 1) ? 0 : source_box.selectedIndex + 1; + } + // up arrow -- wrap around + if ((event.which && event.which === 38) || (event.keyCode && event.keyCode === 38)) { + source_box.selectedIndex = (source_box.selectedIndex === 0) ? source_box.length - 1 : source_box.selectedIndex - 1; + } + } + }; + + window.addEventListener('load', function(e) { + document.querySelectorAll('select.selectfilter, select.selectfilterstacked').forEach(function(el) { + const data = el.dataset; + SelectFilter.init(el.id, data.fieldName, parseInt(data.isStacked, 10)); + }); + }); +} diff --git a/staticfiles/admin/js/actions.js b/staticfiles/admin/js/actions.js new file mode 100644 index 0000000..6a2ae91 --- /dev/null +++ b/staticfiles/admin/js/actions.js @@ -0,0 +1,204 @@ +/*global gettext, interpolate, ngettext*/ +'use strict'; +{ + function show(selector) { + document.querySelectorAll(selector).forEach(function(el) { + el.classList.remove('hidden'); + }); + } + + function hide(selector) { + document.querySelectorAll(selector).forEach(function(el) { + el.classList.add('hidden'); + }); + } + + function showQuestion(options) { + hide(options.acrossClears); + show(options.acrossQuestions); + hide(options.allContainer); + } + + function showClear(options) { + show(options.acrossClears); + hide(options.acrossQuestions); + document.querySelector(options.actionContainer).classList.remove(options.selectedClass); + show(options.allContainer); + hide(options.counterContainer); + } + + function reset(options) { + hide(options.acrossClears); + hide(options.acrossQuestions); + hide(options.allContainer); + show(options.counterContainer); + } + + function clearAcross(options) { + reset(options); + const acrossInputs = document.querySelectorAll(options.acrossInput); + acrossInputs.forEach(function(acrossInput) { + acrossInput.value = 0; + }); + document.querySelector(options.actionContainer).classList.remove(options.selectedClass); + } + + function checker(actionCheckboxes, options, checked) { + if (checked) { + showQuestion(options); + } else { + reset(options); + } + actionCheckboxes.forEach(function(el) { + el.checked = checked; + el.closest('tr').classList.toggle(options.selectedClass, checked); + }); + } + + function updateCounter(actionCheckboxes, options) { + const sel = Array.from(actionCheckboxes).filter(function(el) { + return el.checked; + }).length; + const counter = document.querySelector(options.counterContainer); + // data-actions-icnt is defined in the generated HTML + // and contains the total amount of objects in the queryset + const actions_icnt = Number(counter.dataset.actionsIcnt); + counter.textContent = interpolate( + ngettext('%(sel)s of %(cnt)s selected', '%(sel)s of %(cnt)s selected', sel), { + sel: sel, + cnt: actions_icnt + }, true); + const allToggle = document.getElementById(options.allToggleId); + allToggle.checked = sel === actionCheckboxes.length; + if (allToggle.checked) { + showQuestion(options); + } else { + clearAcross(options); + } + } + + const defaults = { + actionContainer: "div.actions", + counterContainer: "span.action-counter", + allContainer: "div.actions span.all", + acrossInput: "div.actions input.select-across", + acrossQuestions: "div.actions span.question", + acrossClears: "div.actions span.clear", + allToggleId: "action-toggle", + selectedClass: "selected" + }; + + window.Actions = function(actionCheckboxes, options) { + options = Object.assign({}, defaults, options); + let list_editable_changed = false; + let lastChecked = null; + let shiftPressed = false; + + document.addEventListener('keydown', (event) => { + shiftPressed = event.shiftKey; + }); + + document.addEventListener('keyup', (event) => { + shiftPressed = event.shiftKey; + }); + + document.getElementById(options.allToggleId).addEventListener('click', function(event) { + checker(actionCheckboxes, options, this.checked); + updateCounter(actionCheckboxes, options); + }); + + document.querySelectorAll(options.acrossQuestions + " a").forEach(function(el) { + el.addEventListener('click', function(event) { + event.preventDefault(); + const acrossInputs = document.querySelectorAll(options.acrossInput); + acrossInputs.forEach(function(acrossInput) { + acrossInput.value = 1; + }); + showClear(options); + }); + }); + + document.querySelectorAll(options.acrossClears + " a").forEach(function(el) { + el.addEventListener('click', function(event) { + event.preventDefault(); + document.getElementById(options.allToggleId).checked = false; + clearAcross(options); + checker(actionCheckboxes, options, false); + updateCounter(actionCheckboxes, options); + }); + }); + + function affectedCheckboxes(target, withModifier) { + const multiSelect = (lastChecked && withModifier && lastChecked !== target); + if (!multiSelect) { + return [target]; + } + const checkboxes = Array.from(actionCheckboxes); + const targetIndex = checkboxes.findIndex(el => el === target); + const lastCheckedIndex = checkboxes.findIndex(el => el === lastChecked); + const startIndex = Math.min(targetIndex, lastCheckedIndex); + const endIndex = Math.max(targetIndex, lastCheckedIndex); + const filtered = checkboxes.filter((el, index) => (startIndex <= index) && (index <= endIndex)); + return filtered; + }; + + Array.from(document.getElementById('result_list').tBodies).forEach(function(el) { + el.addEventListener('change', function(event) { + const target = event.target; + if (target.classList.contains('action-select')) { + const checkboxes = affectedCheckboxes(target, shiftPressed); + checker(checkboxes, options, target.checked); + updateCounter(actionCheckboxes, options); + lastChecked = target; + } else { + list_editable_changed = true; + } + }); + }); + + document.querySelector('#changelist-form button[name=index]').addEventListener('click', function(event) { + if (list_editable_changed) { + const confirmed = confirm(gettext("You have unsaved changes on individual editable fields. If you run an action, your unsaved changes will be lost.")); + if (!confirmed) { + event.preventDefault(); + } + } + }); + + const el = document.querySelector('#changelist-form input[name=_save]'); + // The button does not exist if no fields are editable. + if (el) { + el.addEventListener('click', function(event) { + if (document.querySelector('[name=action]').value) { + const text = list_editable_changed + ? gettext("You have selected an action, but you haven’t saved your changes to individual fields yet. Please click OK to save. You’ll need to re-run the action.") + : gettext("You have selected an action, and you haven’t made any changes on individual fields. You’re probably looking for the Go button rather than the Save button."); + if (!confirm(text)) { + event.preventDefault(); + } + } + }); + } + // Sync counter when navigating to the page, such as through the back + // button. + window.addEventListener('pageshow', (event) => updateCounter(actionCheckboxes, options)); + }; + + // Call function fn when the DOM is loaded and ready. If it is already + // loaded, call the function now. + // http://youmightnotneedjquery.com/#ready + function ready(fn) { + if (document.readyState !== 'loading') { + fn(); + } else { + document.addEventListener('DOMContentLoaded', fn); + } + } + + ready(function() { + const actionsEls = document.querySelectorAll('tr input.action-select'); + if (actionsEls.length > 0) { + Actions(actionsEls); + } + }); +} diff --git a/staticfiles/admin/js/admin/DateTimeShortcuts.js b/staticfiles/admin/js/admin/DateTimeShortcuts.js new file mode 100644 index 0000000..aa1cae9 --- /dev/null +++ b/staticfiles/admin/js/admin/DateTimeShortcuts.js @@ -0,0 +1,408 @@ +/*global Calendar, findPosX, findPosY, get_format, gettext, gettext_noop, interpolate, ngettext, quickElement*/ +// Inserts shortcut buttons after all of the following: +// +// +'use strict'; +{ + const DateTimeShortcuts = { + calendars: [], + calendarInputs: [], + clockInputs: [], + clockHours: { + default_: [ + [gettext_noop('Now'), -1], + [gettext_noop('Midnight'), 0], + [gettext_noop('6 a.m.'), 6], + [gettext_noop('Noon'), 12], + [gettext_noop('6 p.m.'), 18] + ] + }, + dismissClockFunc: [], + dismissCalendarFunc: [], + calendarDivName1: 'calendarbox', // name of calendar
    that gets toggled + calendarDivName2: 'calendarin', // name of
    that contains calendar + calendarLinkName: 'calendarlink', // name of the link that is used to toggle + clockDivName: 'clockbox', // name of clock
    that gets toggled + clockLinkName: 'clocklink', // name of the link that is used to toggle + shortCutsClass: 'datetimeshortcuts', // class of the clock and cal shortcuts + timezoneWarningClass: 'timezonewarning', // class of the warning for timezone mismatch + timezoneOffset: 0, + init: function() { + const serverOffset = document.body.dataset.adminUtcOffset; + if (serverOffset) { + const localOffset = new Date().getTimezoneOffset() * -60; + DateTimeShortcuts.timezoneOffset = localOffset - serverOffset; + } + + for (const inp of document.getElementsByTagName('input')) { + if (inp.type === 'text' && inp.classList.contains('vTimeField')) { + DateTimeShortcuts.addClock(inp); + DateTimeShortcuts.addTimezoneWarning(inp); + } + else if (inp.type === 'text' && inp.classList.contains('vDateField')) { + DateTimeShortcuts.addCalendar(inp); + DateTimeShortcuts.addTimezoneWarning(inp); + } + } + }, + // Return the current time while accounting for the server timezone. + now: function() { + const serverOffset = document.body.dataset.adminUtcOffset; + if (serverOffset) { + const localNow = new Date(); + const localOffset = localNow.getTimezoneOffset() * -60; + localNow.setTime(localNow.getTime() + 1000 * (serverOffset - localOffset)); + return localNow; + } else { + return new Date(); + } + }, + // Add a warning when the time zone in the browser and backend do not match. + addTimezoneWarning: function(inp) { + const warningClass = DateTimeShortcuts.timezoneWarningClass; + let timezoneOffset = DateTimeShortcuts.timezoneOffset / 3600; + + // Only warn if there is a time zone mismatch. + if (!timezoneOffset) { + return; + } + + // Check if warning is already there. + if (inp.parentNode.querySelectorAll('.' + warningClass).length) { + return; + } + + let message; + if (timezoneOffset > 0) { + message = ngettext( + 'Note: You are %s hour ahead of server time.', + 'Note: You are %s hours ahead of server time.', + timezoneOffset + ); + } + else { + timezoneOffset *= -1; + message = ngettext( + 'Note: You are %s hour behind server time.', + 'Note: You are %s hours behind server time.', + timezoneOffset + ); + } + message = interpolate(message, [timezoneOffset]); + + const warning = document.createElement('div'); + warning.classList.add('help', warningClass); + warning.textContent = message; + inp.parentNode.appendChild(warning); + }, + // Add clock widget to a given field + addClock: function(inp) { + const num = DateTimeShortcuts.clockInputs.length; + DateTimeShortcuts.clockInputs[num] = inp; + DateTimeShortcuts.dismissClockFunc[num] = function() { DateTimeShortcuts.dismissClock(num); return true; }; + + // Shortcut links (clock icon and "Now" link) + const shortcuts_span = document.createElement('span'); + shortcuts_span.className = DateTimeShortcuts.shortCutsClass; + inp.parentNode.insertBefore(shortcuts_span, inp.nextSibling); + const now_link = document.createElement('a'); + now_link.href = "#"; + now_link.textContent = gettext('Now'); + now_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.handleClockQuicklink(num, -1); + }); + const clock_link = document.createElement('a'); + clock_link.href = '#'; + clock_link.id = DateTimeShortcuts.clockLinkName + num; + clock_link.addEventListener('click', function(e) { + e.preventDefault(); + // avoid triggering the document click handler to dismiss the clock + e.stopPropagation(); + DateTimeShortcuts.openClock(num); + }); + + quickElement( + 'span', clock_link, '', + 'class', 'clock-icon', + 'title', gettext('Choose a Time') + ); + shortcuts_span.appendChild(document.createTextNode('\u00A0')); + shortcuts_span.appendChild(now_link); + shortcuts_span.appendChild(document.createTextNode('\u00A0|\u00A0')); + shortcuts_span.appendChild(clock_link); + + // Create clock link div + // + // Markup looks like: + //
    + //

    Choose a time

    + // + //

    Cancel

    + //
    + + const clock_box = document.createElement('div'); + clock_box.style.display = 'none'; + clock_box.style.position = 'absolute'; + clock_box.className = 'clockbox module'; + clock_box.id = DateTimeShortcuts.clockDivName + num; + document.body.appendChild(clock_box); + clock_box.addEventListener('click', function(e) { e.stopPropagation(); }); + + quickElement('h2', clock_box, gettext('Choose a time')); + const time_list = quickElement('ul', clock_box); + time_list.className = 'timelist'; + // The list of choices can be overridden in JavaScript like this: + // DateTimeShortcuts.clockHours.name = [['3 a.m.', 3]]; + // where name is the name attribute of the . + const name = typeof DateTimeShortcuts.clockHours[inp.name] === 'undefined' ? 'default_' : inp.name; + DateTimeShortcuts.clockHours[name].forEach(function(element) { + const time_link = quickElement('a', quickElement('li', time_list), gettext(element[0]), 'href', '#'); + time_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.handleClockQuicklink(num, element[1]); + }); + }); + + const cancel_p = quickElement('p', clock_box); + cancel_p.className = 'calendar-cancel'; + const cancel_link = quickElement('a', cancel_p, gettext('Cancel'), 'href', '#'); + cancel_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.dismissClock(num); + }); + + document.addEventListener('keyup', function(event) { + if (event.which === 27) { + // ESC key closes popup + DateTimeShortcuts.dismissClock(num); + event.preventDefault(); + } + }); + }, + openClock: function(num) { + const clock_box = document.getElementById(DateTimeShortcuts.clockDivName + num); + const clock_link = document.getElementById(DateTimeShortcuts.clockLinkName + num); + + // Recalculate the clockbox position + // is it left-to-right or right-to-left layout ? + if (window.getComputedStyle(document.body).direction !== 'rtl') { + clock_box.style.left = findPosX(clock_link) + 17 + 'px'; + } + else { + // since style's width is in em, it'd be tough to calculate + // px value of it. let's use an estimated px for now + clock_box.style.left = findPosX(clock_link) - 110 + 'px'; + } + clock_box.style.top = Math.max(0, findPosY(clock_link) - 30) + 'px'; + + // Show the clock box + clock_box.style.display = 'block'; + document.addEventListener('click', DateTimeShortcuts.dismissClockFunc[num]); + }, + dismissClock: function(num) { + document.getElementById(DateTimeShortcuts.clockDivName + num).style.display = 'none'; + document.removeEventListener('click', DateTimeShortcuts.dismissClockFunc[num]); + }, + handleClockQuicklink: function(num, val) { + let d; + if (val === -1) { + d = DateTimeShortcuts.now(); + } + else { + d = new Date(1970, 1, 1, val, 0, 0, 0); + } + DateTimeShortcuts.clockInputs[num].value = d.strftime(get_format('TIME_INPUT_FORMATS')[0]); + DateTimeShortcuts.clockInputs[num].focus(); + DateTimeShortcuts.dismissClock(num); + }, + // Add calendar widget to a given field. + addCalendar: function(inp) { + const num = DateTimeShortcuts.calendars.length; + + DateTimeShortcuts.calendarInputs[num] = inp; + DateTimeShortcuts.dismissCalendarFunc[num] = function() { DateTimeShortcuts.dismissCalendar(num); return true; }; + + // Shortcut links (calendar icon and "Today" link) + const shortcuts_span = document.createElement('span'); + shortcuts_span.className = DateTimeShortcuts.shortCutsClass; + inp.parentNode.insertBefore(shortcuts_span, inp.nextSibling); + const today_link = document.createElement('a'); + today_link.href = '#'; + today_link.appendChild(document.createTextNode(gettext('Today'))); + today_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.handleCalendarQuickLink(num, 0); + }); + const cal_link = document.createElement('a'); + cal_link.href = '#'; + cal_link.id = DateTimeShortcuts.calendarLinkName + num; + cal_link.addEventListener('click', function(e) { + e.preventDefault(); + // avoid triggering the document click handler to dismiss the calendar + e.stopPropagation(); + DateTimeShortcuts.openCalendar(num); + }); + quickElement( + 'span', cal_link, '', + 'class', 'date-icon', + 'title', gettext('Choose a Date') + ); + shortcuts_span.appendChild(document.createTextNode('\u00A0')); + shortcuts_span.appendChild(today_link); + shortcuts_span.appendChild(document.createTextNode('\u00A0|\u00A0')); + shortcuts_span.appendChild(cal_link); + + // Create calendarbox div. + // + // Markup looks like: + // + //
    + //

    + // + // February 2003 + //

    + //
    + // + //
    + //
    + // Yesterday | Today | Tomorrow + //
    + //

    Cancel

    + //
    + const cal_box = document.createElement('div'); + cal_box.style.display = 'none'; + cal_box.style.position = 'absolute'; + cal_box.className = 'calendarbox module'; + cal_box.id = DateTimeShortcuts.calendarDivName1 + num; + document.body.appendChild(cal_box); + cal_box.addEventListener('click', function(e) { e.stopPropagation(); }); + + // next-prev links + const cal_nav = quickElement('div', cal_box); + const cal_nav_prev = quickElement('a', cal_nav, '<', 'href', '#'); + cal_nav_prev.className = 'calendarnav-previous'; + cal_nav_prev.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.drawPrev(num); + }); + + const cal_nav_next = quickElement('a', cal_nav, '>', 'href', '#'); + cal_nav_next.className = 'calendarnav-next'; + cal_nav_next.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.drawNext(num); + }); + + // main box + const cal_main = quickElement('div', cal_box, '', 'id', DateTimeShortcuts.calendarDivName2 + num); + cal_main.className = 'calendar'; + DateTimeShortcuts.calendars[num] = new Calendar(DateTimeShortcuts.calendarDivName2 + num, DateTimeShortcuts.handleCalendarCallback(num)); + DateTimeShortcuts.calendars[num].drawCurrent(); + + // calendar shortcuts + const shortcuts = quickElement('div', cal_box); + shortcuts.className = 'calendar-shortcuts'; + let day_link = quickElement('a', shortcuts, gettext('Yesterday'), 'href', '#'); + day_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.handleCalendarQuickLink(num, -1); + }); + shortcuts.appendChild(document.createTextNode('\u00A0|\u00A0')); + day_link = quickElement('a', shortcuts, gettext('Today'), 'href', '#'); + day_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.handleCalendarQuickLink(num, 0); + }); + shortcuts.appendChild(document.createTextNode('\u00A0|\u00A0')); + day_link = quickElement('a', shortcuts, gettext('Tomorrow'), 'href', '#'); + day_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.handleCalendarQuickLink(num, +1); + }); + + // cancel bar + const cancel_p = quickElement('p', cal_box); + cancel_p.className = 'calendar-cancel'; + const cancel_link = quickElement('a', cancel_p, gettext('Cancel'), 'href', '#'); + cancel_link.addEventListener('click', function(e) { + e.preventDefault(); + DateTimeShortcuts.dismissCalendar(num); + }); + document.addEventListener('keyup', function(event) { + if (event.which === 27) { + // ESC key closes popup + DateTimeShortcuts.dismissCalendar(num); + event.preventDefault(); + } + }); + }, + openCalendar: function(num) { + const cal_box = document.getElementById(DateTimeShortcuts.calendarDivName1 + num); + const cal_link = document.getElementById(DateTimeShortcuts.calendarLinkName + num); + const inp = DateTimeShortcuts.calendarInputs[num]; + + // Determine if the current value in the input has a valid date. + // If so, draw the calendar with that date's year and month. + if (inp.value) { + const format = get_format('DATE_INPUT_FORMATS')[0]; + const selected = inp.value.strptime(format); + const year = selected.getUTCFullYear(); + const month = selected.getUTCMonth() + 1; + const re = /\d{4}/; + if (re.test(year.toString()) && month >= 1 && month <= 12) { + DateTimeShortcuts.calendars[num].drawDate(month, year, selected); + } + } + + // Recalculate the clockbox position + // is it left-to-right or right-to-left layout ? + if (window.getComputedStyle(document.body).direction !== 'rtl') { + cal_box.style.left = findPosX(cal_link) + 17 + 'px'; + } + else { + // since style's width is in em, it'd be tough to calculate + // px value of it. let's use an estimated px for now + cal_box.style.left = findPosX(cal_link) - 180 + 'px'; + } + cal_box.style.top = Math.max(0, findPosY(cal_link) - 75) + 'px'; + + cal_box.style.display = 'block'; + document.addEventListener('click', DateTimeShortcuts.dismissCalendarFunc[num]); + }, + dismissCalendar: function(num) { + document.getElementById(DateTimeShortcuts.calendarDivName1 + num).style.display = 'none'; + document.removeEventListener('click', DateTimeShortcuts.dismissCalendarFunc[num]); + }, + drawPrev: function(num) { + DateTimeShortcuts.calendars[num].drawPreviousMonth(); + }, + drawNext: function(num) { + DateTimeShortcuts.calendars[num].drawNextMonth(); + }, + handleCalendarCallback: function(num) { + const format = get_format('DATE_INPUT_FORMATS')[0]; + return function(y, m, d) { + DateTimeShortcuts.calendarInputs[num].value = new Date(y, m - 1, d).strftime(format); + DateTimeShortcuts.calendarInputs[num].focus(); + document.getElementById(DateTimeShortcuts.calendarDivName1 + num).style.display = 'none'; + }; + }, + handleCalendarQuickLink: function(num, offset) { + const d = DateTimeShortcuts.now(); + d.setDate(d.getDate() + offset); + DateTimeShortcuts.calendarInputs[num].value = d.strftime(get_format('DATE_INPUT_FORMATS')[0]); + DateTimeShortcuts.calendarInputs[num].focus(); + DateTimeShortcuts.dismissCalendar(num); + } + }; + + window.addEventListener('load', DateTimeShortcuts.init); + window.DateTimeShortcuts = DateTimeShortcuts; +} diff --git a/staticfiles/admin/js/admin/RelatedObjectLookups.js b/staticfiles/admin/js/admin/RelatedObjectLookups.js new file mode 100644 index 0000000..32e3f5b --- /dev/null +++ b/staticfiles/admin/js/admin/RelatedObjectLookups.js @@ -0,0 +1,240 @@ +/*global SelectBox, interpolate*/ +// Handles related-objects functionality: lookup link for raw_id_fields +// and Add Another links. +'use strict'; +{ + const $ = django.jQuery; + let popupIndex = 0; + const relatedWindows = []; + + function dismissChildPopups() { + relatedWindows.forEach(function(win) { + if(!win.closed) { + win.dismissChildPopups(); + win.close(); + } + }); + } + + function setPopupIndex() { + if(document.getElementsByName("_popup").length > 0) { + const index = window.name.lastIndexOf("__") + 2; + popupIndex = parseInt(window.name.substring(index)); + } else { + popupIndex = 0; + } + } + + function addPopupIndex(name) { + return name + "__" + (popupIndex + 1); + } + + function removePopupIndex(name) { + return name.replace(new RegExp("__" + (popupIndex + 1) + "$"), ''); + } + + function showAdminPopup(triggeringLink, name_regexp, add_popup) { + const name = addPopupIndex(triggeringLink.id.replace(name_regexp, '')); + const href = new URL(triggeringLink.href); + if (add_popup) { + href.searchParams.set('_popup', 1); + } + const win = window.open(href, name, 'height=500,width=800,resizable=yes,scrollbars=yes'); + relatedWindows.push(win); + win.focus(); + return false; + } + + function showRelatedObjectLookupPopup(triggeringLink) { + return showAdminPopup(triggeringLink, /^lookup_/, true); + } + + function dismissRelatedLookupPopup(win, chosenId) { + const name = removePopupIndex(win.name); + const elem = document.getElementById(name); + if (elem.classList.contains('vManyToManyRawIdAdminField') && elem.value) { + elem.value += ',' + chosenId; + } else { + document.getElementById(name).value = chosenId; + } + const index = relatedWindows.indexOf(win); + if (index > -1) { + relatedWindows.splice(index, 1); + } + win.close(); + } + + function showRelatedObjectPopup(triggeringLink) { + return showAdminPopup(triggeringLink, /^(change|add|delete)_/, false); + } + + function updateRelatedObjectLinks(triggeringLink) { + const $this = $(triggeringLink); + const siblings = $this.nextAll('.view-related, .change-related, .delete-related'); + if (!siblings.length) { + return; + } + const value = $this.val(); + if (value) { + siblings.each(function() { + const elm = $(this); + elm.attr('href', elm.attr('data-href-template').replace('__fk__', value)); + elm.removeAttr('aria-disabled'); + }); + } else { + siblings.removeAttr('href'); + siblings.attr('aria-disabled', true); + } + } + + function updateRelatedSelectsOptions(currentSelect, win, objId, newRepr, newId) { + // After create/edit a model from the options next to the current + // select (+ or :pencil:) update ForeignKey PK of the rest of selects + // in the page. + + const path = win.location.pathname; + // Extract the model from the popup url '...//add/' or + // '...///change/' depending the action (add or change). + const modelName = path.split('/')[path.split('/').length - (objId ? 4 : 3)]; + // Exclude autocomplete selects. + const selectsRelated = document.querySelectorAll(`[data-model-ref="${modelName}"] select:not(.admin-autocomplete)`); + + selectsRelated.forEach(function(select) { + if (currentSelect === select) { + return; + } + + let option = select.querySelector(`option[value="${objId}"]`); + + if (!option) { + option = new Option(newRepr, newId); + select.options.add(option); + return; + } + + option.textContent = newRepr; + option.value = newId; + }); + } + + function dismissAddRelatedObjectPopup(win, newId, newRepr) { + const name = removePopupIndex(win.name); + const elem = document.getElementById(name); + if (elem) { + const elemName = elem.nodeName.toUpperCase(); + if (elemName === 'SELECT') { + elem.options[elem.options.length] = new Option(newRepr, newId, true, true); + updateRelatedSelectsOptions(elem, win, null, newRepr, newId); + } else if (elemName === 'INPUT') { + if (elem.classList.contains('vManyToManyRawIdAdminField') && elem.value) { + elem.value += ',' + newId; + } else { + elem.value = newId; + } + } + // Trigger a change event to update related links if required. + $(elem).trigger('change'); + } else { + const toId = name + "_to"; + const o = new Option(newRepr, newId); + SelectBox.add_to_cache(toId, o); + SelectBox.redisplay(toId); + } + const index = relatedWindows.indexOf(win); + if (index > -1) { + relatedWindows.splice(index, 1); + } + win.close(); + } + + function dismissChangeRelatedObjectPopup(win, objId, newRepr, newId) { + const id = removePopupIndex(win.name.replace(/^edit_/, '')); + const selectsSelector = interpolate('#%s, #%s_from, #%s_to', [id, id, id]); + const selects = $(selectsSelector); + selects.find('option').each(function() { + if (this.value === objId) { + this.textContent = newRepr; + this.value = newId; + } + }).trigger('change'); + updateRelatedSelectsOptions(selects[0], win, objId, newRepr, newId); + selects.next().find('.select2-selection__rendered').each(function() { + // The element can have a clear button as a child. + // Use the lastChild to modify only the displayed value. + this.lastChild.textContent = newRepr; + this.title = newRepr; + }); + const index = relatedWindows.indexOf(win); + if (index > -1) { + relatedWindows.splice(index, 1); + } + win.close(); + } + + function dismissDeleteRelatedObjectPopup(win, objId) { + const id = removePopupIndex(win.name.replace(/^delete_/, '')); + const selectsSelector = interpolate('#%s, #%s_from, #%s_to', [id, id, id]); + const selects = $(selectsSelector); + selects.find('option').each(function() { + if (this.value === objId) { + $(this).remove(); + } + }).trigger('change'); + const index = relatedWindows.indexOf(win); + if (index > -1) { + relatedWindows.splice(index, 1); + } + win.close(); + } + + window.showRelatedObjectLookupPopup = showRelatedObjectLookupPopup; + window.dismissRelatedLookupPopup = dismissRelatedLookupPopup; + window.showRelatedObjectPopup = showRelatedObjectPopup; + window.updateRelatedObjectLinks = updateRelatedObjectLinks; + window.dismissAddRelatedObjectPopup = dismissAddRelatedObjectPopup; + window.dismissChangeRelatedObjectPopup = dismissChangeRelatedObjectPopup; + window.dismissDeleteRelatedObjectPopup = dismissDeleteRelatedObjectPopup; + window.dismissChildPopups = dismissChildPopups; + + // Kept for backward compatibility + window.showAddAnotherPopup = showRelatedObjectPopup; + window.dismissAddAnotherPopup = dismissAddRelatedObjectPopup; + + window.addEventListener('unload', function(evt) { + window.dismissChildPopups(); + }); + + $(document).ready(function() { + setPopupIndex(); + $("a[data-popup-opener]").on('click', function(event) { + event.preventDefault(); + opener.dismissRelatedLookupPopup(window, $(this).data("popup-opener")); + }); + $('body').on('click', '.related-widget-wrapper-link[data-popup="yes"]', function(e) { + e.preventDefault(); + if (this.href) { + const event = $.Event('django:show-related', {href: this.href}); + $(this).trigger(event); + if (!event.isDefaultPrevented()) { + showRelatedObjectPopup(this); + } + } + }); + $('body').on('change', '.related-widget-wrapper select', function(e) { + const event = $.Event('django:update-related'); + $(this).trigger(event); + if (!event.isDefaultPrevented()) { + updateRelatedObjectLinks(this); + } + }); + $('.related-widget-wrapper select').trigger('change'); + $('body').on('click', '.related-lookup', function(e) { + e.preventDefault(); + const event = $.Event('django:lookup-related'); + $(this).trigger(event); + if (!event.isDefaultPrevented()) { + showRelatedObjectLookupPopup(this); + } + }); + }); +} diff --git a/staticfiles/admin/js/autocomplete.js b/staticfiles/admin/js/autocomplete.js new file mode 100644 index 0000000..d3daeab --- /dev/null +++ b/staticfiles/admin/js/autocomplete.js @@ -0,0 +1,33 @@ +'use strict'; +{ + const $ = django.jQuery; + + $.fn.djangoAdminSelect2 = function() { + $.each(this, function(i, element) { + $(element).select2({ + ajax: { + data: (params) => { + return { + term: params.term, + page: params.page, + app_label: element.dataset.appLabel, + model_name: element.dataset.modelName, + field_name: element.dataset.fieldName + }; + } + } + }); + }); + return this; + }; + + $(function() { + // Initialize all autocomplete widgets except the one in the template + // form used when a new formset is added. + $('.admin-autocomplete').not('[name*=__prefix__]').djangoAdminSelect2(); + }); + + document.addEventListener('formset:added', (event) => { + $(event.target).find('.admin-autocomplete').djangoAdminSelect2(); + }); +} diff --git a/staticfiles/admin/js/calendar.js b/staticfiles/admin/js/calendar.js new file mode 100644 index 0000000..776310f --- /dev/null +++ b/staticfiles/admin/js/calendar.js @@ -0,0 +1,239 @@ +/*global gettext, pgettext, get_format, quickElement, removeChildren*/ +/* +calendar.js - Calendar functions by Adrian Holovaty +depends on core.js for utility functions like removeChildren or quickElement +*/ +'use strict'; +{ + // CalendarNamespace -- Provides a collection of HTML calendar-related helper functions + const CalendarNamespace = { + monthsOfYear: [ + gettext('January'), + gettext('February'), + gettext('March'), + gettext('April'), + gettext('May'), + gettext('June'), + gettext('July'), + gettext('August'), + gettext('September'), + gettext('October'), + gettext('November'), + gettext('December') + ], + monthsOfYearAbbrev: [ + pgettext('abbrev. month January', 'Jan'), + pgettext('abbrev. month February', 'Feb'), + pgettext('abbrev. month March', 'Mar'), + pgettext('abbrev. month April', 'Apr'), + pgettext('abbrev. month May', 'May'), + pgettext('abbrev. month June', 'Jun'), + pgettext('abbrev. month July', 'Jul'), + pgettext('abbrev. month August', 'Aug'), + pgettext('abbrev. month September', 'Sep'), + pgettext('abbrev. month October', 'Oct'), + pgettext('abbrev. month November', 'Nov'), + pgettext('abbrev. month December', 'Dec') + ], + daysOfWeek: [ + gettext('Sunday'), + gettext('Monday'), + gettext('Tuesday'), + gettext('Wednesday'), + gettext('Thursday'), + gettext('Friday'), + gettext('Saturday') + ], + daysOfWeekAbbrev: [ + pgettext('abbrev. day Sunday', 'Sun'), + pgettext('abbrev. day Monday', 'Mon'), + pgettext('abbrev. day Tuesday', 'Tue'), + pgettext('abbrev. day Wednesday', 'Wed'), + pgettext('abbrev. day Thursday', 'Thur'), + pgettext('abbrev. day Friday', 'Fri'), + pgettext('abbrev. day Saturday', 'Sat') + ], + daysOfWeekInitial: [ + pgettext('one letter Sunday', 'S'), + pgettext('one letter Monday', 'M'), + pgettext('one letter Tuesday', 'T'), + pgettext('one letter Wednesday', 'W'), + pgettext('one letter Thursday', 'T'), + pgettext('one letter Friday', 'F'), + pgettext('one letter Saturday', 'S') + ], + firstDayOfWeek: parseInt(get_format('FIRST_DAY_OF_WEEK')), + isLeapYear: function(year) { + return (((year % 4) === 0) && ((year % 100) !== 0 ) || ((year % 400) === 0)); + }, + getDaysInMonth: function(month, year) { + let days; + if (month === 1 || month === 3 || month === 5 || month === 7 || month === 8 || month === 10 || month === 12) { + days = 31; + } + else if (month === 4 || month === 6 || month === 9 || month === 11) { + days = 30; + } + else if (month === 2 && CalendarNamespace.isLeapYear(year)) { + days = 29; + } + else { + days = 28; + } + return days; + }, + draw: function(month, year, div_id, callback, selected) { // month = 1-12, year = 1-9999 + const today = new Date(); + const todayDay = today.getDate(); + const todayMonth = today.getMonth() + 1; + const todayYear = today.getFullYear(); + let todayClass = ''; + + // Use UTC functions here because the date field does not contain time + // and using the UTC function variants prevent the local time offset + // from altering the date, specifically the day field. For example: + // + // ``` + // var x = new Date('2013-10-02'); + // var day = x.getDate(); + // ``` + // + // The day variable above will be 1 instead of 2 in, say, US Pacific time + // zone. + let isSelectedMonth = false; + if (typeof selected !== 'undefined') { + isSelectedMonth = (selected.getUTCFullYear() === year && (selected.getUTCMonth() + 1) === month); + } + + month = parseInt(month); + year = parseInt(year); + const calDiv = document.getElementById(div_id); + removeChildren(calDiv); + const calTable = document.createElement('table'); + quickElement('caption', calTable, CalendarNamespace.monthsOfYear[month - 1] + ' ' + year); + const tableBody = quickElement('tbody', calTable); + + // Draw days-of-week header + let tableRow = quickElement('tr', tableBody); + for (let i = 0; i < 7; i++) { + quickElement('th', tableRow, CalendarNamespace.daysOfWeekInitial[(i + CalendarNamespace.firstDayOfWeek) % 7]); + } + + const startingPos = new Date(year, month - 1, 1 - CalendarNamespace.firstDayOfWeek).getDay(); + const days = CalendarNamespace.getDaysInMonth(month, year); + + let nonDayCell; + + // Draw blanks before first of month + tableRow = quickElement('tr', tableBody); + for (let i = 0; i < startingPos; i++) { + nonDayCell = quickElement('td', tableRow, ' '); + nonDayCell.className = "nonday"; + } + + function calendarMonth(y, m) { + function onClick(e) { + e.preventDefault(); + callback(y, m, this.textContent); + } + return onClick; + } + + // Draw days of month + let currentDay = 1; + for (let i = startingPos; currentDay <= days; i++) { + if (i % 7 === 0 && currentDay !== 1) { + tableRow = quickElement('tr', tableBody); + } + if ((currentDay === todayDay) && (month === todayMonth) && (year === todayYear)) { + todayClass = 'today'; + } else { + todayClass = ''; + } + + // use UTC function; see above for explanation. + if (isSelectedMonth && currentDay === selected.getUTCDate()) { + if (todayClass !== '') { + todayClass += " "; + } + todayClass += "selected"; + } + + const cell = quickElement('td', tableRow, '', 'class', todayClass); + const link = quickElement('a', cell, currentDay, 'href', '#'); + link.addEventListener('click', calendarMonth(year, month)); + currentDay++; + } + + // Draw blanks after end of month (optional, but makes for valid code) + while (tableRow.childNodes.length < 7) { + nonDayCell = quickElement('td', tableRow, ' '); + nonDayCell.className = "nonday"; + } + + calDiv.appendChild(calTable); + } + }; + + // Calendar -- A calendar instance + function Calendar(div_id, callback, selected) { + // div_id (string) is the ID of the element in which the calendar will + // be displayed + // callback (string) is the name of a JavaScript function that will be + // called with the parameters (year, month, day) when a day in the + // calendar is clicked + this.div_id = div_id; + this.callback = callback; + this.today = new Date(); + this.currentMonth = this.today.getMonth() + 1; + this.currentYear = this.today.getFullYear(); + if (typeof selected !== 'undefined') { + this.selected = selected; + } + } + Calendar.prototype = { + drawCurrent: function() { + CalendarNamespace.draw(this.currentMonth, this.currentYear, this.div_id, this.callback, this.selected); + }, + drawDate: function(month, year, selected) { + this.currentMonth = month; + this.currentYear = year; + + if(selected) { + this.selected = selected; + } + + this.drawCurrent(); + }, + drawPreviousMonth: function() { + if (this.currentMonth === 1) { + this.currentMonth = 12; + this.currentYear--; + } + else { + this.currentMonth--; + } + this.drawCurrent(); + }, + drawNextMonth: function() { + if (this.currentMonth === 12) { + this.currentMonth = 1; + this.currentYear++; + } + else { + this.currentMonth++; + } + this.drawCurrent(); + }, + drawPreviousYear: function() { + this.currentYear--; + this.drawCurrent(); + }, + drawNextYear: function() { + this.currentYear++; + this.drawCurrent(); + } + }; + window.Calendar = Calendar; + window.CalendarNamespace = CalendarNamespace; +} diff --git a/staticfiles/admin/js/cancel.js b/staticfiles/admin/js/cancel.js new file mode 100644 index 0000000..3069c6f --- /dev/null +++ b/staticfiles/admin/js/cancel.js @@ -0,0 +1,29 @@ +'use strict'; +{ + // Call function fn when the DOM is loaded and ready. If it is already + // loaded, call the function now. + // http://youmightnotneedjquery.com/#ready + function ready(fn) { + if (document.readyState !== 'loading') { + fn(); + } else { + document.addEventListener('DOMContentLoaded', fn); + } + } + + ready(function() { + function handleClick(event) { + event.preventDefault(); + const params = new URLSearchParams(window.location.search); + if (params.has('_popup')) { + window.close(); // Close the popup. + } else { + window.history.back(); // Otherwise, go back. + } + } + + document.querySelectorAll('.cancel-link').forEach(function(el) { + el.addEventListener('click', handleClick); + }); + }); +} diff --git a/staticfiles/admin/js/change_form.js b/staticfiles/admin/js/change_form.js new file mode 100644 index 0000000..96a4c62 --- /dev/null +++ b/staticfiles/admin/js/change_form.js @@ -0,0 +1,16 @@ +'use strict'; +{ + const inputTags = ['BUTTON', 'INPUT', 'SELECT', 'TEXTAREA']; + const modelName = document.getElementById('django-admin-form-add-constants').dataset.modelName; + if (modelName) { + const form = document.getElementById(modelName + '_form'); + for (const element of form.elements) { + // HTMLElement.offsetParent returns null when the element is not + // rendered. + if (inputTags.includes(element.tagName) && !element.disabled && element.offsetParent) { + element.focus(); + break; + } + } + } +} diff --git a/staticfiles/admin/js/collapse.js b/staticfiles/admin/js/collapse.js new file mode 100644 index 0000000..c6c7b0f --- /dev/null +++ b/staticfiles/admin/js/collapse.js @@ -0,0 +1,43 @@ +/*global gettext*/ +'use strict'; +{ + window.addEventListener('load', function() { + // Add anchor tag for Show/Hide link + const fieldsets = document.querySelectorAll('fieldset.collapse'); + for (const [i, elem] of fieldsets.entries()) { + // Don't hide if fields in this fieldset have errors + if (elem.querySelectorAll('div.errors, ul.errorlist').length === 0) { + elem.classList.add('collapsed'); + const h2 = elem.querySelector('h2'); + const link = document.createElement('a'); + link.id = 'fieldsetcollapser' + i; + link.className = 'collapse-toggle'; + link.href = '#'; + link.textContent = gettext('Show'); + h2.appendChild(document.createTextNode(' (')); + h2.appendChild(link); + h2.appendChild(document.createTextNode(')')); + } + } + // Add toggle to hide/show anchor tag + const toggleFunc = function(ev) { + if (ev.target.matches('.collapse-toggle')) { + ev.preventDefault(); + ev.stopPropagation(); + const fieldset = ev.target.closest('fieldset'); + if (fieldset.classList.contains('collapsed')) { + // Show + ev.target.textContent = gettext('Hide'); + fieldset.classList.remove('collapsed'); + } else { + // Hide + ev.target.textContent = gettext('Show'); + fieldset.classList.add('collapsed'); + } + } + }; + document.querySelectorAll('fieldset.module').forEach(function(el) { + el.addEventListener('click', toggleFunc); + }); + }); +} diff --git a/staticfiles/admin/js/core.js b/staticfiles/admin/js/core.js new file mode 100644 index 0000000..10504d4 --- /dev/null +++ b/staticfiles/admin/js/core.js @@ -0,0 +1,184 @@ +// Core JavaScript helper functions +'use strict'; + +// quickElement(tagType, parentReference [, textInChildNode, attribute, attributeValue ...]); +function quickElement() { + const obj = document.createElement(arguments[0]); + if (arguments[2]) { + const textNode = document.createTextNode(arguments[2]); + obj.appendChild(textNode); + } + const len = arguments.length; + for (let i = 3; i < len; i += 2) { + obj.setAttribute(arguments[i], arguments[i + 1]); + } + arguments[1].appendChild(obj); + return obj; +} + +// "a" is reference to an object +function removeChildren(a) { + while (a.hasChildNodes()) { + a.removeChild(a.lastChild); + } +} + +// ---------------------------------------------------------------------------- +// Find-position functions by PPK +// See https://www.quirksmode.org/js/findpos.html +// ---------------------------------------------------------------------------- +function findPosX(obj) { + let curleft = 0; + if (obj.offsetParent) { + while (obj.offsetParent) { + curleft += obj.offsetLeft - obj.scrollLeft; + obj = obj.offsetParent; + } + } else if (obj.x) { + curleft += obj.x; + } + return curleft; +} + +function findPosY(obj) { + let curtop = 0; + if (obj.offsetParent) { + while (obj.offsetParent) { + curtop += obj.offsetTop - obj.scrollTop; + obj = obj.offsetParent; + } + } else if (obj.y) { + curtop += obj.y; + } + return curtop; +} + +//----------------------------------------------------------------------------- +// Date object extensions +// ---------------------------------------------------------------------------- +{ + Date.prototype.getTwelveHours = function() { + return this.getHours() % 12 || 12; + }; + + Date.prototype.getTwoDigitMonth = function() { + return (this.getMonth() < 9) ? '0' + (this.getMonth() + 1) : (this.getMonth() + 1); + }; + + Date.prototype.getTwoDigitDate = function() { + return (this.getDate() < 10) ? '0' + this.getDate() : this.getDate(); + }; + + Date.prototype.getTwoDigitTwelveHour = function() { + return (this.getTwelveHours() < 10) ? '0' + this.getTwelveHours() : this.getTwelveHours(); + }; + + Date.prototype.getTwoDigitHour = function() { + return (this.getHours() < 10) ? '0' + this.getHours() : this.getHours(); + }; + + Date.prototype.getTwoDigitMinute = function() { + return (this.getMinutes() < 10) ? '0' + this.getMinutes() : this.getMinutes(); + }; + + Date.prototype.getTwoDigitSecond = function() { + return (this.getSeconds() < 10) ? '0' + this.getSeconds() : this.getSeconds(); + }; + + Date.prototype.getAbbrevDayName = function() { + return typeof window.CalendarNamespace === "undefined" + ? '0' + this.getDay() + : window.CalendarNamespace.daysOfWeekAbbrev[this.getDay()]; + }; + + Date.prototype.getFullDayName = function() { + return typeof window.CalendarNamespace === "undefined" + ? '0' + this.getDay() + : window.CalendarNamespace.daysOfWeek[this.getDay()]; + }; + + Date.prototype.getAbbrevMonthName = function() { + return typeof window.CalendarNamespace === "undefined" + ? this.getTwoDigitMonth() + : window.CalendarNamespace.monthsOfYearAbbrev[this.getMonth()]; + }; + + Date.prototype.getFullMonthName = function() { + return typeof window.CalendarNamespace === "undefined" + ? this.getTwoDigitMonth() + : window.CalendarNamespace.monthsOfYear[this.getMonth()]; + }; + + Date.prototype.strftime = function(format) { + const fields = { + a: this.getAbbrevDayName(), + A: this.getFullDayName(), + b: this.getAbbrevMonthName(), + B: this.getFullMonthName(), + c: this.toString(), + d: this.getTwoDigitDate(), + H: this.getTwoDigitHour(), + I: this.getTwoDigitTwelveHour(), + m: this.getTwoDigitMonth(), + M: this.getTwoDigitMinute(), + p: (this.getHours() >= 12) ? 'PM' : 'AM', + S: this.getTwoDigitSecond(), + w: '0' + this.getDay(), + x: this.toLocaleDateString(), + X: this.toLocaleTimeString(), + y: ('' + this.getFullYear()).substr(2, 4), + Y: '' + this.getFullYear(), + '%': '%' + }; + let result = '', i = 0; + while (i < format.length) { + if (format.charAt(i) === '%') { + result += fields[format.charAt(i + 1)]; + ++i; + } + else { + result += format.charAt(i); + } + ++i; + } + return result; + }; + + // ---------------------------------------------------------------------------- + // String object extensions + // ---------------------------------------------------------------------------- + String.prototype.strptime = function(format) { + const split_format = format.split(/[.\-/]/); + const date = this.split(/[.\-/]/); + let i = 0; + let day, month, year; + while (i < split_format.length) { + switch (split_format[i]) { + case "%d": + day = date[i]; + break; + case "%m": + month = date[i] - 1; + break; + case "%Y": + year = date[i]; + break; + case "%y": + // A %y value in the range of [00, 68] is in the current + // century, while [69, 99] is in the previous century, + // according to the Open Group Specification. + if (parseInt(date[i], 10) >= 69) { + year = date[i]; + } else { + year = (new Date(Date.UTC(date[i], 0))).getUTCFullYear() + 100; + } + break; + } + ++i; + } + // Create Date object from UTC since the parsed value is supposed to be + // in UTC, not local time. Also, the calendar uses UTC functions for + // date extraction. + return new Date(Date.UTC(year, month, day)); + }; +} diff --git a/staticfiles/admin/js/filters.js b/staticfiles/admin/js/filters.js new file mode 100644 index 0000000..f5536eb --- /dev/null +++ b/staticfiles/admin/js/filters.js @@ -0,0 +1,30 @@ +/** + * Persist changelist filters state (collapsed/expanded). + */ +'use strict'; +{ + // Init filters. + let filters = JSON.parse(sessionStorage.getItem('django.admin.filtersState')); + + if (!filters) { + filters = {}; + } + + Object.entries(filters).forEach(([key, value]) => { + const detailElement = document.querySelector(`[data-filter-title='${CSS.escape(key)}']`); + + // Check if the filter is present, it could be from other view. + if (detailElement) { + value ? detailElement.setAttribute('open', '') : detailElement.removeAttribute('open'); + } + }); + + // Save filter state when clicks. + const details = document.querySelectorAll('details'); + details.forEach(detail => { + detail.addEventListener('toggle', event => { + filters[`${event.target.dataset.filterTitle}`] = detail.open; + sessionStorage.setItem('django.admin.filtersState', JSON.stringify(filters)); + }); + }); +} diff --git a/staticfiles/admin/js/inlines.js b/staticfiles/admin/js/inlines.js new file mode 100644 index 0000000..e9a1dfe --- /dev/null +++ b/staticfiles/admin/js/inlines.js @@ -0,0 +1,359 @@ +/*global DateTimeShortcuts, SelectFilter*/ +/** + * Django admin inlines + * + * Based on jQuery Formset 1.1 + * @author Stanislaus Madueke (stan DOT madueke AT gmail DOT com) + * @requires jQuery 1.2.6 or later + * + * Copyright (c) 2009, Stanislaus Madueke + * All rights reserved. + * + * Spiced up with Code from Zain Memon's GSoC project 2009 + * and modified for Django by Jannis Leidel, Travis Swicegood and Julien Phalip. + * + * Licensed under the New BSD License + * See: https://opensource.org/licenses/bsd-license.php + */ +'use strict'; +{ + const $ = django.jQuery; + $.fn.formset = function(opts) { + const options = $.extend({}, $.fn.formset.defaults, opts); + const $this = $(this); + const $parent = $this.parent(); + const updateElementIndex = function(el, prefix, ndx) { + const id_regex = new RegExp("(" + prefix + "-(\\d+|__prefix__))"); + const replacement = prefix + "-" + ndx; + if ($(el).prop("for")) { + $(el).prop("for", $(el).prop("for").replace(id_regex, replacement)); + } + if (el.id) { + el.id = el.id.replace(id_regex, replacement); + } + if (el.name) { + el.name = el.name.replace(id_regex, replacement); + } + }; + const totalForms = $("#id_" + options.prefix + "-TOTAL_FORMS").prop("autocomplete", "off"); + let nextIndex = parseInt(totalForms.val(), 10); + const maxForms = $("#id_" + options.prefix + "-MAX_NUM_FORMS").prop("autocomplete", "off"); + const minForms = $("#id_" + options.prefix + "-MIN_NUM_FORMS").prop("autocomplete", "off"); + let addButton; + + /** + * The "Add another MyModel" button below the inline forms. + */ + const addInlineAddButton = function() { + if (addButton === null) { + if ($this.prop("tagName") === "TR") { + // If forms are laid out as table rows, insert the + // "add" button in a new table row: + const numCols = $this.eq(-1).children().length; + $parent.append('' + options.addText + ""); + addButton = $parent.find("tr:last a"); + } else { + // Otherwise, insert it immediately after the last form: + $this.filter(":last").after('"); + addButton = $this.filter(":last").next().find("a"); + } + } + addButton.on('click', addInlineClickHandler); + }; + + const addInlineClickHandler = function(e) { + e.preventDefault(); + const template = $("#" + options.prefix + "-empty"); + const row = template.clone(true); + row.removeClass(options.emptyCssClass) + .addClass(options.formCssClass) + .attr("id", options.prefix + "-" + nextIndex); + addInlineDeleteButton(row); + row.find("*").each(function() { + updateElementIndex(this, options.prefix, totalForms.val()); + }); + // Insert the new form when it has been fully edited. + row.insertBefore($(template)); + // Update number of total forms. + $(totalForms).val(parseInt(totalForms.val(), 10) + 1); + nextIndex += 1; + // Hide the add button if there's a limit and it's been reached. + if ((maxForms.val() !== '') && (maxForms.val() - totalForms.val()) <= 0) { + addButton.parent().hide(); + } + // Show the remove buttons if there are more than min_num. + toggleDeleteButtonVisibility(row.closest('.inline-group')); + + // Pass the new form to the post-add callback, if provided. + if (options.added) { + options.added(row); + } + row.get(0).dispatchEvent(new CustomEvent("formset:added", { + bubbles: true, + detail: { + formsetName: options.prefix + } + })); + }; + + /** + * The "X" button that is part of every unsaved inline. + * (When saved, it is replaced with a "Delete" checkbox.) + */ + const addInlineDeleteButton = function(row) { + if (row.is("tr")) { + // If the forms are laid out in table rows, insert + // the remove button into the last table cell: + row.children(":last").append('"); + } else if (row.is("ul") || row.is("ol")) { + // If they're laid out as an ordered/unordered list, + // insert an
  • after the last list item: + row.append('
  • ' + options.deleteText + "
  • "); + } else { + // Otherwise, just insert the remove button as the + // last child element of the form's container: + row.children(":first").append('' + options.deleteText + ""); + } + // Add delete handler for each row. + row.find("a." + options.deleteCssClass).on('click', inlineDeleteHandler.bind(this)); + }; + + const inlineDeleteHandler = function(e1) { + e1.preventDefault(); + const deleteButton = $(e1.target); + const row = deleteButton.closest('.' + options.formCssClass); + const inlineGroup = row.closest('.inline-group'); + // Remove the parent form containing this button, + // and also remove the relevant row with non-field errors: + const prevRow = row.prev(); + if (prevRow.length && prevRow.hasClass('row-form-errors')) { + prevRow.remove(); + } + row.remove(); + nextIndex -= 1; + // Pass the deleted form to the post-delete callback, if provided. + if (options.removed) { + options.removed(row); + } + document.dispatchEvent(new CustomEvent("formset:removed", { + detail: { + formsetName: options.prefix + } + })); + // Update the TOTAL_FORMS form count. + const forms = $("." + options.formCssClass); + $("#id_" + options.prefix + "-TOTAL_FORMS").val(forms.length); + // Show add button again once below maximum number. + if ((maxForms.val() === '') || (maxForms.val() - forms.length) > 0) { + addButton.parent().show(); + } + // Hide the remove buttons if at min_num. + toggleDeleteButtonVisibility(inlineGroup); + // Also, update names and ids for all remaining form controls so + // they remain in sequence: + let i, formCount; + const updateElementCallback = function() { + updateElementIndex(this, options.prefix, i); + }; + for (i = 0, formCount = forms.length; i < formCount; i++) { + updateElementIndex($(forms).get(i), options.prefix, i); + $(forms.get(i)).find("*").each(updateElementCallback); + } + }; + + const toggleDeleteButtonVisibility = function(inlineGroup) { + if ((minForms.val() !== '') && (minForms.val() - totalForms.val()) >= 0) { + inlineGroup.find('.inline-deletelink').hide(); + } else { + inlineGroup.find('.inline-deletelink').show(); + } + }; + + $this.each(function(i) { + $(this).not("." + options.emptyCssClass).addClass(options.formCssClass); + }); + + // Create the delete buttons for all unsaved inlines: + $this.filter('.' + options.formCssClass + ':not(.has_original):not(.' + options.emptyCssClass + ')').each(function() { + addInlineDeleteButton($(this)); + }); + toggleDeleteButtonVisibility($this); + + // Create the add button, initially hidden. + addButton = options.addButton; + addInlineAddButton(); + + // Show the add button if allowed to add more items. + // Note that max_num = None translates to a blank string. + const showAddButton = maxForms.val() === '' || (maxForms.val() - totalForms.val()) > 0; + if ($this.length && showAddButton) { + addButton.parent().show(); + } else { + addButton.parent().hide(); + } + + return this; + }; + + /* Setup plugin defaults */ + $.fn.formset.defaults = { + prefix: "form", // The form prefix for your django formset + addText: "add another", // Text for the add link + deleteText: "remove", // Text for the delete link + addCssClass: "add-row", // CSS class applied to the add link + deleteCssClass: "delete-row", // CSS class applied to the delete link + emptyCssClass: "empty-row", // CSS class applied to the empty row + formCssClass: "dynamic-form", // CSS class applied to each form in a formset + added: null, // Function called each time a new form is added + removed: null, // Function called each time a form is deleted + addButton: null // Existing add button to use + }; + + + // Tabular inlines --------------------------------------------------------- + $.fn.tabularFormset = function(selector, options) { + const $rows = $(this); + + const reinitDateTimeShortCuts = function() { + // Reinitialize the calendar and clock widgets by force + if (typeof DateTimeShortcuts !== "undefined") { + $(".datetimeshortcuts").remove(); + DateTimeShortcuts.init(); + } + }; + + const updateSelectFilter = function() { + // If any SelectFilter widgets are a part of the new form, + // instantiate a new SelectFilter instance for it. + if (typeof SelectFilter !== 'undefined') { + $('.selectfilter').each(function(index, value) { + SelectFilter.init(value.id, this.dataset.fieldName, false); + }); + $('.selectfilterstacked').each(function(index, value) { + SelectFilter.init(value.id, this.dataset.fieldName, true); + }); + } + }; + + const initPrepopulatedFields = function(row) { + row.find('.prepopulated_field').each(function() { + const field = $(this), + input = field.find('input, select, textarea'), + dependency_list = input.data('dependency_list') || [], + dependencies = []; + $.each(dependency_list, function(i, field_name) { + dependencies.push('#' + row.find('.field-' + field_name).find('input, select, textarea').attr('id')); + }); + if (dependencies.length) { + input.prepopulate(dependencies, input.attr('maxlength')); + } + }); + }; + + $rows.formset({ + prefix: options.prefix, + addText: options.addText, + formCssClass: "dynamic-" + options.prefix, + deleteCssClass: "inline-deletelink", + deleteText: options.deleteText, + emptyCssClass: "empty-form", + added: function(row) { + initPrepopulatedFields(row); + reinitDateTimeShortCuts(); + updateSelectFilter(); + }, + addButton: options.addButton + }); + + return $rows; + }; + + // Stacked inlines --------------------------------------------------------- + $.fn.stackedFormset = function(selector, options) { + const $rows = $(this); + const updateInlineLabel = function(row) { + $(selector).find(".inline_label").each(function(i) { + const count = i + 1; + $(this).html($(this).html().replace(/(#\d+)/g, "#" + count)); + }); + }; + + const reinitDateTimeShortCuts = function() { + // Reinitialize the calendar and clock widgets by force, yuck. + if (typeof DateTimeShortcuts !== "undefined") { + $(".datetimeshortcuts").remove(); + DateTimeShortcuts.init(); + } + }; + + const updateSelectFilter = function() { + // If any SelectFilter widgets were added, instantiate a new instance. + if (typeof SelectFilter !== "undefined") { + $(".selectfilter").each(function(index, value) { + SelectFilter.init(value.id, this.dataset.fieldName, false); + }); + $(".selectfilterstacked").each(function(index, value) { + SelectFilter.init(value.id, this.dataset.fieldName, true); + }); + } + }; + + const initPrepopulatedFields = function(row) { + row.find('.prepopulated_field').each(function() { + const field = $(this), + input = field.find('input, select, textarea'), + dependency_list = input.data('dependency_list') || [], + dependencies = []; + $.each(dependency_list, function(i, field_name) { + // Dependency in a fieldset. + let field_element = row.find('.form-row .field-' + field_name); + // Dependency without a fieldset. + if (!field_element.length) { + field_element = row.find('.form-row.field-' + field_name); + } + dependencies.push('#' + field_element.find('input, select, textarea').attr('id')); + }); + if (dependencies.length) { + input.prepopulate(dependencies, input.attr('maxlength')); + } + }); + }; + + $rows.formset({ + prefix: options.prefix, + addText: options.addText, + formCssClass: "dynamic-" + options.prefix, + deleteCssClass: "inline-deletelink", + deleteText: options.deleteText, + emptyCssClass: "empty-form", + removed: updateInlineLabel, + added: function(row) { + initPrepopulatedFields(row); + reinitDateTimeShortCuts(); + updateSelectFilter(); + updateInlineLabel(row); + }, + addButton: options.addButton + }); + + return $rows; + }; + + $(document).ready(function() { + $(".js-inline-admin-formset").each(function() { + const data = $(this).data(), + inlineOptions = data.inlineFormset; + let selector; + switch(data.inlineType) { + case "stacked": + selector = inlineOptions.name + "-group .inline-related"; + $(selector).stackedFormset(selector, inlineOptions.options); + break; + case "tabular": + selector = inlineOptions.name + "-group .tabular.inline-related tbody:first > tr.form-row"; + $(selector).tabularFormset(selector, inlineOptions.options); + break; + } + }); + }); +} diff --git a/staticfiles/admin/js/jquery.init.js b/staticfiles/admin/js/jquery.init.js new file mode 100644 index 0000000..f40b27f --- /dev/null +++ b/staticfiles/admin/js/jquery.init.js @@ -0,0 +1,8 @@ +/*global jQuery:false*/ +'use strict'; +/* Puts the included jQuery into our own namespace using noConflict and passing + * it 'true'. This ensures that the included jQuery doesn't pollute the global + * namespace (i.e. this preserves pre-existing values for both window.$ and + * window.jQuery). + */ +window.django = {jQuery: jQuery.noConflict(true)}; diff --git a/staticfiles/admin/js/nav_sidebar.js b/staticfiles/admin/js/nav_sidebar.js new file mode 100644 index 0000000..7e735db --- /dev/null +++ b/staticfiles/admin/js/nav_sidebar.js @@ -0,0 +1,79 @@ +'use strict'; +{ + const toggleNavSidebar = document.getElementById('toggle-nav-sidebar'); + if (toggleNavSidebar !== null) { + const navSidebar = document.getElementById('nav-sidebar'); + const main = document.getElementById('main'); + let navSidebarIsOpen = localStorage.getItem('django.admin.navSidebarIsOpen'); + if (navSidebarIsOpen === null) { + navSidebarIsOpen = 'true'; + } + main.classList.toggle('shifted', navSidebarIsOpen === 'true'); + navSidebar.setAttribute('aria-expanded', navSidebarIsOpen); + + toggleNavSidebar.addEventListener('click', function() { + if (navSidebarIsOpen === 'true') { + navSidebarIsOpen = 'false'; + } else { + navSidebarIsOpen = 'true'; + } + localStorage.setItem('django.admin.navSidebarIsOpen', navSidebarIsOpen); + main.classList.toggle('shifted'); + navSidebar.setAttribute('aria-expanded', navSidebarIsOpen); + }); + } + + function initSidebarQuickFilter() { + const options = []; + const navSidebar = document.getElementById('nav-sidebar'); + if (!navSidebar) { + return; + } + navSidebar.querySelectorAll('th[scope=row] a').forEach((container) => { + options.push({title: container.innerHTML, node: container}); + }); + + function checkValue(event) { + let filterValue = event.target.value; + if (filterValue) { + filterValue = filterValue.toLowerCase(); + } + if (event.key === 'Escape') { + filterValue = ''; + event.target.value = ''; // clear input + } + let matches = false; + for (const o of options) { + let displayValue = ''; + if (filterValue) { + if (o.title.toLowerCase().indexOf(filterValue) === -1) { + displayValue = 'none'; + } else { + matches = true; + } + } + // show/hide parent + o.node.parentNode.parentNode.style.display = displayValue; + } + if (!filterValue || matches) { + event.target.classList.remove('no-results'); + } else { + event.target.classList.add('no-results'); + } + sessionStorage.setItem('django.admin.navSidebarFilterValue', filterValue); + } + + const nav = document.getElementById('nav-filter'); + nav.addEventListener('change', checkValue, false); + nav.addEventListener('input', checkValue, false); + nav.addEventListener('keyup', checkValue, false); + + const storedValue = sessionStorage.getItem('django.admin.navSidebarFilterValue'); + if (storedValue) { + nav.value = storedValue; + checkValue({target: nav, key: ''}); + } + } + window.initSidebarQuickFilter = initSidebarQuickFilter; + initSidebarQuickFilter(); +} diff --git a/staticfiles/admin/js/popup_response.js b/staticfiles/admin/js/popup_response.js new file mode 100644 index 0000000..2b1d3dd --- /dev/null +++ b/staticfiles/admin/js/popup_response.js @@ -0,0 +1,16 @@ +/*global opener */ +'use strict'; +{ + const initData = JSON.parse(document.getElementById('django-admin-popup-response-constants').dataset.popupResponse); + switch(initData.action) { + case 'change': + opener.dismissChangeRelatedObjectPopup(window, initData.value, initData.obj, initData.new_value); + break; + case 'delete': + opener.dismissDeleteRelatedObjectPopup(window, initData.value); + break; + default: + opener.dismissAddRelatedObjectPopup(window, initData.value, initData.obj); + break; + } +} diff --git a/staticfiles/admin/js/prepopulate.js b/staticfiles/admin/js/prepopulate.js new file mode 100644 index 0000000..89e95ab --- /dev/null +++ b/staticfiles/admin/js/prepopulate.js @@ -0,0 +1,43 @@ +/*global URLify*/ +'use strict'; +{ + const $ = django.jQuery; + $.fn.prepopulate = function(dependencies, maxLength, allowUnicode) { + /* + Depends on urlify.js + Populates a selected field with the values of the dependent fields, + URLifies and shortens the string. + dependencies - array of dependent fields ids + maxLength - maximum length of the URLify'd string + allowUnicode - Unicode support of the URLify'd string + */ + return this.each(function() { + const prepopulatedField = $(this); + + const populate = function() { + // Bail if the field's value has been changed by the user + if (prepopulatedField.data('_changed')) { + return; + } + + const values = []; + $.each(dependencies, function(i, field) { + field = $(field); + if (field.val().length > 0) { + values.push(field.val()); + } + }); + prepopulatedField.val(URLify(values.join(' '), maxLength, allowUnicode)); + }; + + prepopulatedField.data('_changed', false); + prepopulatedField.on('change', function() { + prepopulatedField.data('_changed', true); + }); + + if (!prepopulatedField.val()) { + $(dependencies.join(',')).on('keyup change focus', populate); + } + }); + }; +} diff --git a/staticfiles/admin/js/prepopulate_init.js b/staticfiles/admin/js/prepopulate_init.js new file mode 100644 index 0000000..a58841f --- /dev/null +++ b/staticfiles/admin/js/prepopulate_init.js @@ -0,0 +1,15 @@ +'use strict'; +{ + const $ = django.jQuery; + const fields = $('#django-admin-prepopulated-fields-constants').data('prepopulatedFields'); + $.each(fields, function(index, field) { + $( + '.empty-form .form-row .field-' + field.name + + ', .empty-form.form-row .field-' + field.name + + ', .empty-form .form-row.field-' + field.name + ).addClass('prepopulated_field'); + $(field.id).data('dependency_list', field.dependency_list).prepopulate( + field.dependency_ids, field.maxLength, field.allowUnicode + ); + }); +} diff --git a/staticfiles/admin/js/theme.js b/staticfiles/admin/js/theme.js new file mode 100644 index 0000000..794cd15 --- /dev/null +++ b/staticfiles/admin/js/theme.js @@ -0,0 +1,56 @@ +'use strict'; +{ + window.addEventListener('load', function(e) { + + function setTheme(mode) { + if (mode !== "light" && mode !== "dark" && mode !== "auto") { + console.error(`Got invalid theme mode: ${mode}. Resetting to auto.`); + mode = "auto"; + } + document.documentElement.dataset.theme = mode; + localStorage.setItem("theme", mode); + } + + function cycleTheme() { + const currentTheme = localStorage.getItem("theme") || "auto"; + const prefersDark = window.matchMedia("(prefers-color-scheme: dark)").matches; + + if (prefersDark) { + // Auto (dark) -> Light -> Dark + if (currentTheme === "auto") { + setTheme("light"); + } else if (currentTheme === "light") { + setTheme("dark"); + } else { + setTheme("auto"); + } + } else { + // Auto (light) -> Dark -> Light + if (currentTheme === "auto") { + setTheme("dark"); + } else if (currentTheme === "dark") { + setTheme("light"); + } else { + setTheme("auto"); + } + } + } + + function initTheme() { + // set theme defined in localStorage if there is one, or fallback to auto mode + const currentTheme = localStorage.getItem("theme"); + currentTheme ? setTheme(currentTheme) : setTheme("auto"); + } + + function setupTheme() { + // Attach event handlers for toggling themes + const buttons = document.getElementsByClassName("theme-toggle"); + Array.from(buttons).forEach((btn) => { + btn.addEventListener("click", cycleTheme); + }); + initTheme(); + } + + setupTheme(); + }); +} diff --git a/staticfiles/admin/js/urlify.js b/staticfiles/admin/js/urlify.js new file mode 100644 index 0000000..9fc0409 --- /dev/null +++ b/staticfiles/admin/js/urlify.js @@ -0,0 +1,169 @@ +/*global XRegExp*/ +'use strict'; +{ + const LATIN_MAP = { + 'À': 'A', 'Á': 'A', 'Â': 'A', 'Ã': 'A', 'Ä': 'A', 'Å': 'A', 'Æ': 'AE', + 'Ç': 'C', 'È': 'E', 'É': 'E', 'Ê': 'E', 'Ë': 'E', 'Ì': 'I', 'Í': 'I', + 'Î': 'I', 'Ï': 'I', 'Ð': 'D', 'Ñ': 'N', 'Ò': 'O', 'Ó': 'O', 'Ô': 'O', + 'Õ': 'O', 'Ö': 'O', 'Ő': 'O', 'Ø': 'O', 'Ù': 'U', 'Ú': 'U', 'Û': 'U', + 'Ü': 'U', 'Ű': 'U', 'Ý': 'Y', 'Þ': 'TH', 'Ÿ': 'Y', 'ß': 'ss', 'à': 'a', + 'á': 'a', 'â': 'a', 'ã': 'a', 'ä': 'a', 'å': 'a', 'æ': 'ae', 'ç': 'c', + 'è': 'e', 'é': 'e', 'ê': 'e', 'ë': 'e', 'ì': 'i', 'í': 'i', 'î': 'i', + 'ï': 'i', 'ð': 'd', 'ñ': 'n', 'ò': 'o', 'ó': 'o', 'ô': 'o', 'õ': 'o', + 'ö': 'o', 'ő': 'o', 'ø': 'o', 'ù': 'u', 'ú': 'u', 'û': 'u', 'ü': 'u', + 'ű': 'u', 'ý': 'y', 'þ': 'th', 'ÿ': 'y' + }; + const LATIN_SYMBOLS_MAP = { + '©': '(c)' + }; + const GREEK_MAP = { + 'α': 'a', 'β': 'b', 'γ': 'g', 'δ': 'd', 'ε': 'e', 'ζ': 'z', 'η': 'h', + 'θ': '8', 'ι': 'i', 'κ': 'k', 'λ': 'l', 'μ': 'm', 'ν': 'n', 'ξ': '3', + 'ο': 'o', 'π': 'p', 'ρ': 'r', 'σ': 's', 'τ': 't', 'υ': 'y', 'φ': 'f', + 'χ': 'x', 'ψ': 'ps', 'ω': 'w', 'ά': 'a', 'έ': 'e', 'ί': 'i', 'ό': 'o', + 'ύ': 'y', 'ή': 'h', 'ώ': 'w', 'ς': 's', 'ϊ': 'i', 'ΰ': 'y', 'ϋ': 'y', + 'ΐ': 'i', 'Α': 'A', 'Β': 'B', 'Γ': 'G', 'Δ': 'D', 'Ε': 'E', 'Ζ': 'Z', + 'Η': 'H', 'Θ': '8', 'Ι': 'I', 'Κ': 'K', 'Λ': 'L', 'Μ': 'M', 'Ν': 'N', + 'Ξ': '3', 'Ο': 'O', 'Π': 'P', 'Ρ': 'R', 'Σ': 'S', 'Τ': 'T', 'Υ': 'Y', + 'Φ': 'F', 'Χ': 'X', 'Ψ': 'PS', 'Ω': 'W', 'Ά': 'A', 'Έ': 'E', 'Ί': 'I', + 'Ό': 'O', 'Ύ': 'Y', 'Ή': 'H', 'Ώ': 'W', 'Ϊ': 'I', 'Ϋ': 'Y' + }; + const TURKISH_MAP = { + 'ş': 's', 'Ş': 'S', 'ı': 'i', 'İ': 'I', 'ç': 'c', 'Ç': 'C', 'ü': 'u', + 'Ü': 'U', 'ö': 'o', 'Ö': 'O', 'ğ': 'g', 'Ğ': 'G' + }; + const ROMANIAN_MAP = { + 'ă': 'a', 'î': 'i', 'ș': 's', 'ț': 't', 'â': 'a', + 'Ă': 'A', 'Î': 'I', 'Ș': 'S', 'Ț': 'T', 'Â': 'A' + }; + const RUSSIAN_MAP = { + 'а': 'a', 'б': 'b', 'в': 'v', 'г': 'g', 'д': 'd', 'е': 'e', 'ё': 'yo', + 'ж': 'zh', 'з': 'z', 'и': 'i', 'й': 'j', 'к': 'k', 'л': 'l', 'м': 'm', + 'н': 'n', 'о': 'o', 'п': 'p', 'р': 'r', 'с': 's', 'т': 't', 'у': 'u', + 'ф': 'f', 'х': 'h', 'ц': 'c', 'ч': 'ch', 'ш': 'sh', 'щ': 'sh', 'ъ': '', + 'ы': 'y', 'ь': '', 'э': 'e', 'ю': 'yu', 'я': 'ya', + 'А': 'A', 'Б': 'B', 'В': 'V', 'Г': 'G', 'Д': 'D', 'Е': 'E', 'Ё': 'Yo', + 'Ж': 'Zh', 'З': 'Z', 'И': 'I', 'Й': 'J', 'К': 'K', 'Л': 'L', 'М': 'M', + 'Н': 'N', 'О': 'O', 'П': 'P', 'Р': 'R', 'С': 'S', 'Т': 'T', 'У': 'U', + 'Ф': 'F', 'Х': 'H', 'Ц': 'C', 'Ч': 'Ch', 'Ш': 'Sh', 'Щ': 'Sh', 'Ъ': '', + 'Ы': 'Y', 'Ь': '', 'Э': 'E', 'Ю': 'Yu', 'Я': 'Ya' + }; + const UKRAINIAN_MAP = { + 'Є': 'Ye', 'І': 'I', 'Ї': 'Yi', 'Ґ': 'G', 'є': 'ye', 'і': 'i', + 'ї': 'yi', 'ґ': 'g' + }; + const CZECH_MAP = { + 'č': 'c', 'ď': 'd', 'ě': 'e', 'ň': 'n', 'ř': 'r', 'š': 's', 'ť': 't', + 'ů': 'u', 'ž': 'z', 'Č': 'C', 'Ď': 'D', 'Ě': 'E', 'Ň': 'N', 'Ř': 'R', + 'Š': 'S', 'Ť': 'T', 'Ů': 'U', 'Ž': 'Z' + }; + const SLOVAK_MAP = { + 'á': 'a', 'ä': 'a', 'č': 'c', 'ď': 'd', 'é': 'e', 'í': 'i', 'ľ': 'l', + 'ĺ': 'l', 'ň': 'n', 'ó': 'o', 'ô': 'o', 'ŕ': 'r', 'š': 's', 'ť': 't', + 'ú': 'u', 'ý': 'y', 'ž': 'z', + 'Á': 'a', 'Ä': 'A', 'Č': 'C', 'Ď': 'D', 'É': 'E', 'Í': 'I', 'Ľ': 'L', + 'Ĺ': 'L', 'Ň': 'N', 'Ó': 'O', 'Ô': 'O', 'Ŕ': 'R', 'Š': 'S', 'Ť': 'T', + 'Ú': 'U', 'Ý': 'Y', 'Ž': 'Z' + }; + const POLISH_MAP = { + 'ą': 'a', 'ć': 'c', 'ę': 'e', 'ł': 'l', 'ń': 'n', 'ó': 'o', 'ś': 's', + 'ź': 'z', 'ż': 'z', + 'Ą': 'A', 'Ć': 'C', 'Ę': 'E', 'Ł': 'L', 'Ń': 'N', 'Ó': 'O', 'Ś': 'S', + 'Ź': 'Z', 'Ż': 'Z' + }; + const LATVIAN_MAP = { + 'ā': 'a', 'č': 'c', 'ē': 'e', 'ģ': 'g', 'ī': 'i', 'ķ': 'k', 'ļ': 'l', + 'ņ': 'n', 'š': 's', 'ū': 'u', 'ž': 'z', + 'Ā': 'A', 'Č': 'C', 'Ē': 'E', 'Ģ': 'G', 'Ī': 'I', 'Ķ': 'K', 'Ļ': 'L', + 'Ņ': 'N', 'Š': 'S', 'Ū': 'U', 'Ž': 'Z' + }; + const ARABIC_MAP = { + 'أ': 'a', 'ب': 'b', 'ت': 't', 'ث': 'th', 'ج': 'g', 'ح': 'h', 'خ': 'kh', 'د': 'd', + 'ذ': 'th', 'ر': 'r', 'ز': 'z', 'س': 's', 'ش': 'sh', 'ص': 's', 'ض': 'd', 'ط': 't', + 'ظ': 'th', 'ع': 'aa', 'غ': 'gh', 'ف': 'f', 'ق': 'k', 'ك': 'k', 'ل': 'l', 'م': 'm', + 'ن': 'n', 'ه': 'h', 'و': 'o', 'ي': 'y' + }; + const LITHUANIAN_MAP = { + 'ą': 'a', 'č': 'c', 'ę': 'e', 'ė': 'e', 'į': 'i', 'š': 's', 'ų': 'u', + 'ū': 'u', 'ž': 'z', + 'Ą': 'A', 'Č': 'C', 'Ę': 'E', 'Ė': 'E', 'Į': 'I', 'Š': 'S', 'Ų': 'U', + 'Ū': 'U', 'Ž': 'Z' + }; + const SERBIAN_MAP = { + 'ђ': 'dj', 'ј': 'j', 'љ': 'lj', 'њ': 'nj', 'ћ': 'c', 'џ': 'dz', + 'đ': 'dj', 'Ђ': 'Dj', 'Ј': 'j', 'Љ': 'Lj', 'Њ': 'Nj', 'Ћ': 'C', + 'Џ': 'Dz', 'Đ': 'Dj' + }; + const AZERBAIJANI_MAP = { + 'ç': 'c', 'ə': 'e', 'ğ': 'g', 'ı': 'i', 'ö': 'o', 'ş': 's', 'ü': 'u', + 'Ç': 'C', 'Ə': 'E', 'Ğ': 'G', 'İ': 'I', 'Ö': 'O', 'Ş': 'S', 'Ü': 'U' + }; + const GEORGIAN_MAP = { + 'ა': 'a', 'ბ': 'b', 'გ': 'g', 'დ': 'd', 'ე': 'e', 'ვ': 'v', 'ზ': 'z', + 'თ': 't', 'ი': 'i', 'კ': 'k', 'ლ': 'l', 'მ': 'm', 'ნ': 'n', 'ო': 'o', + 'პ': 'p', 'ჟ': 'j', 'რ': 'r', 'ს': 's', 'ტ': 't', 'უ': 'u', 'ფ': 'f', + 'ქ': 'q', 'ღ': 'g', 'ყ': 'y', 'შ': 'sh', 'ჩ': 'ch', 'ც': 'c', 'ძ': 'dz', + 'წ': 'w', 'ჭ': 'ch', 'ხ': 'x', 'ჯ': 'j', 'ჰ': 'h' + }; + + const ALL_DOWNCODE_MAPS = [ + LATIN_MAP, + LATIN_SYMBOLS_MAP, + GREEK_MAP, + TURKISH_MAP, + ROMANIAN_MAP, + RUSSIAN_MAP, + UKRAINIAN_MAP, + CZECH_MAP, + SLOVAK_MAP, + POLISH_MAP, + LATVIAN_MAP, + ARABIC_MAP, + LITHUANIAN_MAP, + SERBIAN_MAP, + AZERBAIJANI_MAP, + GEORGIAN_MAP + ]; + + const Downcoder = { + 'Initialize': function() { + if (Downcoder.map) { // already made + return; + } + Downcoder.map = {}; + for (const lookup of ALL_DOWNCODE_MAPS) { + Object.assign(Downcoder.map, lookup); + } + Downcoder.regex = new RegExp(Object.keys(Downcoder.map).join('|'), 'g'); + } + }; + + function downcode(slug) { + Downcoder.Initialize(); + return slug.replace(Downcoder.regex, function(m) { + return Downcoder.map[m]; + }); + } + + + function URLify(s, num_chars, allowUnicode) { + // changes, e.g., "Petty theft" to "petty-theft" + if (!allowUnicode) { + s = downcode(s); + } + s = s.toLowerCase(); // convert to lowercase + // if downcode doesn't hit, the char will be stripped here + if (allowUnicode) { + // Keep Unicode letters including both lowercase and uppercase + // characters, whitespace, and dash; remove other characters. + s = XRegExp.replace(s, XRegExp('[^-_\\p{L}\\p{N}\\s]', 'g'), ''); + } else { + s = s.replace(/[^-\w\s]/g, ''); // remove unneeded chars + } + s = s.replace(/^\s+|\s+$/g, ''); // trim leading/trailing spaces + s = s.replace(/[-\s]+/g, '-'); // convert spaces to hyphens + s = s.substring(0, num_chars); // trim to first num_chars chars + return s.replace(/-+$/g, ''); // trim any trailing hyphens + } + window.URLify = URLify; +} diff --git a/staticfiles/admin/js/vendor/jquery/LICENSE.txt b/staticfiles/admin/js/vendor/jquery/LICENSE.txt new file mode 100644 index 0000000..f642c3f --- /dev/null +++ b/staticfiles/admin/js/vendor/jquery/LICENSE.txt @@ -0,0 +1,20 @@ +Copyright OpenJS Foundation and other contributors, https://openjsf.org/ + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/staticfiles/admin/js/vendor/jquery/jquery.js b/staticfiles/admin/js/vendor/jquery/jquery.js new file mode 100644 index 0000000..1a86433 --- /dev/null +++ b/staticfiles/admin/js/vendor/jquery/jquery.js @@ -0,0 +1,10716 @@ +/*! + * jQuery JavaScript Library v3.7.1 + * https://jquery.com/ + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2023-08-28T13:37Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket trac-14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var flat = arr.flat ? function( array ) { + return arr.flat.call( array ); +} : function( array ) { + return arr.concat.apply( [], array ); +}; + + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + // Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5 + // Plus for old WebKit, typeof returns "function" for HTML collections + // (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756) + return typeof obj === "function" && typeof obj.nodeType !== "number" && + typeof obj.item !== "function"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + +var document = window.document; + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var version = "3.7.1", + + rhtmlSuffix = /HTML$/i, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + even: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return ( i + 1 ) % 2; + } ) ); + }, + + odd: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return i % 2; + } ) ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function( code, options, doc ) { + DOMEval( code, { nonce: options && options.nonce }, doc ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + + // Retrieve the text value of an array of DOM nodes + text: function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + + // If no nodeType, this is expected to be an array + while ( ( node = elem[ i++ ] ) ) { + + // Do not traverse comment nodes + ret += jQuery.text( node ); + } + } + if ( nodeType === 1 || nodeType === 11 ) { + return elem.textContent; + } + if ( nodeType === 9 ) { + return elem.documentElement.textContent; + } + if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + isXMLDoc: function( elem ) { + var namespace = elem && elem.namespaceURI, + docElem = elem && ( elem.ownerDocument || elem ).documentElement; + + // Assume HTML when documentElement doesn't yet exist, such as inside + // document fragments. + return !rhtmlSuffix.test( namespace || docElem && docElem.nodeName || "HTML" ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return flat( ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), + function( _i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); + } ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +} +var pop = arr.pop; + + +var sort = arr.sort; + + +var splice = arr.splice; + + +var whitespace = "[\\x20\\t\\r\\n\\f]"; + + +var rtrimCSS = new RegExp( + "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", + "g" +); + + + + +// Note: an element does not contain itself +jQuery.contains = function( a, b ) { + var bup = b && b.parentNode; + + return a === bup || !!( bup && bup.nodeType === 1 && ( + + // Support: IE 9 - 11+ + // IE doesn't have `contains` on SVG. + a.contains ? + a.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + ) ); +}; + + + + +// CSS string/identifier serialization +// https://drafts.csswg.org/cssom/#common-serializing-idioms +var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g; + +function fcssescape( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; +} + +jQuery.escapeSelector = function( sel ) { + return ( sel + "" ).replace( rcssescape, fcssescape ); +}; + + + + +var preferredDoc = document, + pushNative = push; + +( function() { + +var i, + Expr, + outermostContext, + sortInput, + hasDuplicate, + push = pushNative, + + // Local document vars + document, + documentElement, + documentIsHTML, + rbuggyQSA, + matches, + + // Instance-specific data + expando = jQuery.expando, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|" + + "loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: https://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rleadingCombinator = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + + whitespace + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + ID: new RegExp( "^#(" + identifier + ")" ), + CLASS: new RegExp( "^\\.(" + identifier + ")" ), + TAG: new RegExp( "^(" + identifier + "|[*])" ), + ATTR: new RegExp( "^" + attributes ), + PSEUDO: new RegExp( "^" + pseudos ), + CHILD: new RegExp( + "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + bool: new RegExp( "^(?:" + booleans + ")$", "i" ), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + needsContext: new RegExp( "^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // https://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\([^\\r\\n\\f])", "g" ), + funescape = function( escape, nonHex ) { + var high = "0x" + escape.slice( 1 ) - 0x10000; + + if ( nonHex ) { + + // Strip the backslash prefix from a non-hex escape sequence + return nonHex; + } + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + return high < 0 ? + String.fromCharCode( high + 0x10000 ) : + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // Used for iframes; see `setDocument`. + // Support: IE 9 - 11+, Edge 12 - 18+ + // Removing the function wrapper causes a "Permission Denied" + // error in IE/Edge. + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && nodeName( elem, "fieldset" ); + }, + { dir: "parentNode", next: "legend" } + ); + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + ( arr = slice.call( preferredDoc.childNodes ) ), + preferredDoc.childNodes + ); + + // Support: Android <=4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { + apply: function( target, els ) { + pushNative.apply( target, slice.call( els ) ); + }, + call: function( target ) { + pushNative.apply( target, slice.call( arguments, 1 ) ); + } + }; +} + +function find( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + setDocument( context ); + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) { + + // ID selector + if ( ( m = match[ 1 ] ) ) { + + // Document context + if ( nodeType === 9 ) { + if ( ( elem = context.getElementById( m ) ) ) { + + // Support: IE 9 only + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + push.call( results, elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE 9 only + // getElementById can match elements by name instead of ID + if ( newContext && ( elem = newContext.getElementById( m ) ) && + find.contains( context, elem ) && + elem.id === m ) { + + push.call( results, elem ); + return results; + } + } + + // Type selector + } else if ( match[ 2 ] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( ( m = match[ 3 ] ) && context.getElementsByClassName ) { + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( !nonnativeSelectorCache[ selector + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && + ( rdescend.test( selector ) || rleadingCombinator.test( selector ) ) ) { + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when + // strict-comparing two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( newContext != context || !support.scope ) { + + // Capture the context ID, setting it first if necessary + if ( ( nid = context.getAttribute( "id" ) ) ) { + nid = jQuery.escapeSelector( nid ); + } else { + context.setAttribute( "id", ( nid = expando ) ); + } + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " + + toSelector( groups[ i ] ); + } + newSelector = groups.join( "," ); + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrimCSS, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + + // Use (key + " ") to avoid collision with native prototype properties + // (see https://github.com/jquery/sizzle/issues/157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return ( cache[ key + " " ] = value ); + } + return cache; +} + +/** + * Mark a function for special use by jQuery selector module + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement( "fieldset" ); + + try { + return !!fn( el ); + } catch ( e ) { + return false; + } finally { + + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + + // release memory in IE + el = null; + } +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + return nodeName( elem, "input" ) && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + return ( nodeName( elem, "input" ) || nodeName( elem, "button" ) ) && + elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11+ + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction( function( argument ) { + argument = +argument; + return markFunction( function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ ( j = matchIndexes[ i ] ) ] ) { + seed[ j ] = !( matches[ j ] = seed[ j ] ); + } + } + } ); + } ); +} + +/** + * Checks a node for validity as a jQuery selector context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [node] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +function setDocument( node ) { + var subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + documentElement = document.documentElement; + documentIsHTML = !jQuery.isXMLDoc( document ); + + // Support: iOS 7 only, IE 9 - 11+ + // Older browsers didn't support unprefixed `matches`. + matches = documentElement.matches || + documentElement.webkitMatchesSelector || + documentElement.msMatchesSelector; + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors + // (see trac-13936). + // Limit the fix to IE & Edge Legacy; despite Edge 15+ implementing `matches`, + // all IE 9+ and Edge Legacy versions implement `msMatchesSelector` as well. + if ( documentElement.msMatchesSelector && + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + preferredDoc != document && + ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) { + + // Support: IE 9 - 11+, Edge 12 - 18+ + subWindow.addEventListener( "unload", unloadHandler ); + } + + // Support: IE <10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert( function( el ) { + documentElement.appendChild( el ).id = jQuery.expando; + return !document.getElementsByName || + !document.getElementsByName( jQuery.expando ).length; + } ); + + // Support: IE 9 only + // Check to see if it's possible to do matchesSelector + // on a disconnected node. + support.disconnectedMatch = assert( function( el ) { + return matches.call( el, "*" ); + } ); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // IE/Edge don't support the :scope pseudo-class. + support.scope = assert( function() { + return document.querySelectorAll( ":scope" ); + } ); + + // Support: Chrome 105 - 111 only, Safari 15.4 - 16.3 only + // Make sure the `:has()` argument is parsed unforgivingly. + // We include `*` in the test to detect buggy implementations that are + // _selectively_ forgiving (specifically when the list includes at least + // one valid selector). + // Note that we treat complete lack of support for `:has()` as if it were + // spec-compliant support, which is fine because use of `:has()` in such + // environments will fail in the qSA path and fall back to jQuery traversal + // anyway. + support.cssHas = assert( function() { + try { + document.querySelector( ":has(*,:jqfake)" ); + return false; + } catch ( e ) { + return true; + } + } ); + + // ID filter and find + if ( support.getById ) { + Expr.filter.ID = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute( "id" ) === attrId; + }; + }; + Expr.find.ID = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter.ID = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode( "id" ); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find.ID = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( ( elem = elems[ i++ ] ) ) { + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find.TAG = function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else { + return context.querySelectorAll( tag ); + } + }; + + // Class + Expr.find.CLASS = function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + rbuggyQSA = []; + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert( function( el ) { + + var input; + + documentElement.appendChild( el ).innerHTML = + "" + + ""; + + // Support: iOS <=7 - 8 only + // Boolean attributes and "value" are not treated correctly in some XML documents + if ( !el.querySelectorAll( "[selected]" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: iOS <=7 - 8 only + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push( "~=" ); + } + + // Support: iOS 8 only + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push( ".#.+[+~]" ); + } + + // Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+ + // In some of the document kinds, these selectors wouldn't work natively. + // This is probably OK but for backwards compatibility we want to maintain + // handling them through jQuery traversal in jQuery 3.x. + if ( !el.querySelectorAll( ":checked" ).length ) { + rbuggyQSA.push( ":checked" ); + } + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + input = document.createElement( "input" ); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE 9 - 11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + // Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+ + // In some of the document kinds, these selectors wouldn't work natively. + // This is probably OK but for backwards compatibility we want to maintain + // handling them through jQuery traversal in jQuery 3.x. + documentElement.appendChild( el ).disabled = true; + if ( el.querySelectorAll( ":disabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement( "input" ); + input.setAttribute( "name", "" ); + el.appendChild( input ); + if ( !el.querySelectorAll( "[name='']" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")" ); + } + } ); + + if ( !support.cssHas ) { + + // Support: Chrome 105 - 110+, Safari 15.4 - 16.3+ + // Our regular `try-catch` mechanism fails to detect natively-unsupported + // pseudo-classes inside `:has()` (such as `:has(:contains("Foo"))`) + // in browsers that parse the `:has()` argument as a forgiving selector list. + // https://drafts.csswg.org/selectors/#relational now requires the argument + // to be parsed unforgivingly, but browsers have not yet fully adjusted. + rbuggyQSA.push( ":has" ); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) ); + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( a === document || a.ownerDocument == preferredDoc && + find.contains( preferredDoc, a ) ) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( b === document || b.ownerDocument == preferredDoc && + find.contains( preferredDoc, b ) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf.call( sortInput, a ) - indexOf.call( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + }; + + return document; +} + +find.matches = function( expr, elements ) { + return find( expr, null, null, elements ); +}; + +find.matchesSelector = function( elem, expr ) { + setDocument( elem ); + + if ( documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch ( e ) { + nonnativeSelectorCache( expr, true ); + } + } + + return find( expr, document, null, [ elem ] ).length > 0; +}; + +find.contains = function( context, elem ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( context.ownerDocument || context ) != document ) { + setDocument( context ); + } + return jQuery.contains( context, elem ); +}; + + +find.attr = function( elem, name ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( elem.ownerDocument || elem ) != document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + + // Don't get fooled by Object.prototype properties (see trac-13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + if ( val !== undefined ) { + return val; + } + + return elem.getAttribute( name ); +}; + +find.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +jQuery.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + // + // Support: Android <=4.0+ + // Testing for detecting duplicates is unpredictable so instead assume we can't + // depend on duplicate detection in all browsers without a stable sort. + hasDuplicate = !support.sortStable; + sortInput = !support.sortStable && slice.call( results, 0 ); + sort.call( results, sortOrder ); + + if ( hasDuplicate ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + splice.call( results, duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +jQuery.fn.uniqueSort = function() { + return this.pushStack( jQuery.uniqueSort( slice.apply( this ) ) ); +}; + +Expr = jQuery.expr = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + ATTR: function( match ) { + match[ 1 ] = match[ 1 ].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[ 3 ] = ( match[ 3 ] || match[ 4 ] || match[ 5 ] || "" ) + .replace( runescape, funescape ); + + if ( match[ 2 ] === "~=" ) { + match[ 3 ] = " " + match[ 3 ] + " "; + } + + return match.slice( 0, 4 ); + }, + + CHILD: function( match ) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[ 1 ] = match[ 1 ].toLowerCase(); + + if ( match[ 1 ].slice( 0, 3 ) === "nth" ) { + + // nth-* requires argument + if ( !match[ 3 ] ) { + find.error( match[ 0 ] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[ 4 ] = +( match[ 4 ] ? + match[ 5 ] + ( match[ 6 ] || 1 ) : + 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) + ); + match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" ); + + // other types prohibit arguments + } else if ( match[ 3 ] ) { + find.error( match[ 0 ] ); + } + + return match; + }, + + PSEUDO: function( match ) { + var excess, + unquoted = !match[ 6 ] && match[ 2 ]; + + if ( matchExpr.CHILD.test( match[ 0 ] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[ 3 ] ) { + match[ 2 ] = match[ 4 ] || match[ 5 ] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + + // Get excess from tokenize (recursively) + ( excess = tokenize( unquoted, true ) ) && + + // advance to the next closing parenthesis + ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) { + + // excess is a negative index + match[ 0 ] = match[ 0 ].slice( 0, excess ); + match[ 2 ] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + TAG: function( nodeNameSelector ) { + var expectedNodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { + return true; + } : + function( elem ) { + return nodeName( elem, expectedNodeName ); + }; + }, + + CLASS: function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + ( pattern = new RegExp( "(^|" + whitespace + ")" + className + + "(" + whitespace + "|$)" ) ) && + classCache( className, function( elem ) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute( "class" ) || + "" + ); + } ); + }, + + ATTR: function( name, operator, check ) { + return function( elem ) { + var result = find.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + if ( operator === "=" ) { + return result === check; + } + if ( operator === "!=" ) { + return result !== check; + } + if ( operator === "^=" ) { + return check && result.indexOf( check ) === 0; + } + if ( operator === "*=" ) { + return check && result.indexOf( check ) > -1; + } + if ( operator === "$=" ) { + return check && result.slice( -check.length ) === check; + } + if ( operator === "~=" ) { + return ( " " + result.replace( rwhitespace, " " ) + " " ) + .indexOf( check ) > -1; + } + if ( operator === "|=" ) { + return result === check || result.slice( 0, check.length + 1 ) === check + "-"; + } + + return false; + }; + }, + + CHILD: function( type, what, _argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, _context, xml ) { + var cache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( ( node = node[ dir ] ) ) { + if ( ofType ? + nodeName( node, name ) : + node.nodeType === 1 ) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + outerCache = parent[ expando ] || ( parent[ expando ] = {} ); + cache = outerCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( ( node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + outerCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if ( useCache ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + cache = outerCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + + // Use the same loop as above to seek `elem` from the start + while ( ( node = ++nodeIndex && node && node[ dir ] || + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + if ( ( ofType ? + nodeName( node, name ) : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || + ( node[ expando ] = {} ); + outerCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + PSEUDO: function( pseudo, argument ) { + + // pseudo-class names are case-insensitive + // https://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + find.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as jQuery does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction( function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[ i ] ); + seed[ idx ] = !( matches[ idx ] = matched[ i ] ); + } + } ) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + not: markFunction( function( selector ) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrimCSS, "$1" ) ); + + return matcher[ expando ] ? + markFunction( function( seed, matches, _context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( ( elem = unmatched[ i ] ) ) { + seed[ i ] = !( matches[ i ] = elem ); + } + } + } ) : + function( elem, _context, xml ) { + input[ 0 ] = elem; + matcher( input, null, xml, results ); + + // Don't keep the element + // (see https://github.com/jquery/sizzle/issues/299) + input[ 0 ] = null; + return !results.pop(); + }; + } ), + + has: markFunction( function( selector ) { + return function( elem ) { + return find( selector, elem ).length > 0; + }; + } ), + + contains: markFunction( function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || jQuery.text( elem ) ).indexOf( text ) > -1; + }; + } ), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // https://www.w3.org/TR/selectors/#lang-pseudo + lang: markFunction( function( lang ) { + + // lang value must be a valid identifier + if ( !ridentifier.test( lang || "" ) ) { + find.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( ( elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 ); + return false; + }; + } ), + + // Miscellaneous + target: function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + root: function( elem ) { + return elem === documentElement; + }, + + focus: function( elem ) { + return elem === safeActiveElement() && + document.hasFocus() && + !!( elem.type || elem.href || ~elem.tabIndex ); + }, + + // Boolean properties + enabled: createDisabledPseudo( false ), + disabled: createDisabledPseudo( true ), + + checked: function( elem ) { + + // In CSS3, :checked should return both checked and selected elements + // https://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + return ( nodeName( elem, "input" ) && !!elem.checked ) || + ( nodeName( elem, "option" ) && !!elem.selected ); + }, + + selected: function( elem ) { + + // Support: IE <=11+ + // Accessing the selectedIndex property + // forces the browser to treat the default option as + // selected when in an optgroup. + if ( elem.parentNode ) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + empty: function( elem ) { + + // https://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + parent: function( elem ) { + return !Expr.pseudos.empty( elem ); + }, + + // Element/input types + header: function( elem ) { + return rheader.test( elem.nodeName ); + }, + + input: function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + button: function( elem ) { + return nodeName( elem, "input" ) && elem.type === "button" || + nodeName( elem, "button" ); + }, + + text: function( elem ) { + var attr; + return nodeName( elem, "input" ) && elem.type === "text" && + + // Support: IE <10 only + // New HTML5 attribute values (e.g., "search") appear + // with elem.type === "text" + ( ( attr = elem.getAttribute( "type" ) ) == null || + attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + first: createPositionalPseudo( function() { + return [ 0 ]; + } ), + + last: createPositionalPseudo( function( _matchIndexes, length ) { + return [ length - 1 ]; + } ), + + eq: createPositionalPseudo( function( _matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + } ), + + even: createPositionalPseudo( function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + odd: createPositionalPseudo( function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + lt: createPositionalPseudo( function( matchIndexes, length, argument ) { + var i; + + if ( argument < 0 ) { + i = argument + length; + } else if ( argument > length ) { + i = length; + } else { + i = argument; + } + + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + gt: createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ) + } +}; + +Expr.pseudos.nth = Expr.pseudos.eq; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || ( match = rcomma.exec( soFar ) ) ) { + if ( match ) { + + // Don't consume trailing commas as valid + soFar = soFar.slice( match[ 0 ].length ) || soFar; + } + groups.push( ( tokens = [] ) ); + } + + matched = false; + + // Combinators + if ( ( match = rleadingCombinator.exec( soFar ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + + // Cast descendant combinators to space + type: match[ 0 ].replace( rtrimCSS, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] || + ( match = preFilters[ type ]( match ) ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + if ( parseOnly ) { + return soFar.length; + } + + return soFar ? + find.error( selector ) : + + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[ i ].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + + if ( skip && nodeName( elem, skip ) ) { + elem = elem[ dir ] || elem; + } else if ( ( oldCache = outerCache[ key ] ) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return ( newCache[ 2 ] = oldCache[ 2 ] ); + } else { + + // Reuse newcache so results back-propagate to previous elements + outerCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[ i ]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[ 0 ]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + find( selector, contexts[ i ], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( ( elem = unmatched[ i ] ) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction( function( seed, results, context, xml ) { + var temp, i, elem, matcherOut, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || + multipleContexts( selector || "*", + context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems; + + if ( matcher ) { + + // If we have a postFinder, or filtered seed, or non-seed postFilter + // or preexisting results, + matcherOut = postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results; + + // Find primary matches + matcher( matcherIn, matcherOut, context, xml ); + } else { + matcherOut = matcherIn; + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( ( elem = temp[ i ] ) ) { + matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem ); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) ) { + + // Restore matcherIn since elem is not yet a final match + temp.push( ( matcherIn[ i ] = elem ) ); + } + } + postFinder( null, ( matcherOut = [] ), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) && + ( temp = postFinder ? indexOf.call( seed, elem ) : preMap[ i ] ) > -1 ) { + + seed[ temp ] = !( results[ temp ] = elem ); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + } ); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[ 0 ].type ], + implicitRelative = leadingRelative || Expr.relative[ " " ], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + var ret = ( !leadingRelative && ( xml || context != outermostContext ) ) || ( + ( checkContext = context ).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + + // Avoid hanging onto element + // (see https://github.com/jquery/sizzle/issues/299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[ j ].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens.slice( 0, i - 1 ) + .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } ) + ).replace( rtrimCSS, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find.TAG( "*", outermost ), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ), + len = elems.length; + + if ( outermost ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: iOS <=7 - 9 only + // Tolerate NodeList properties (IE: "length"; Safari: ) matching + // elements by id. (see trac-14142) + for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( !context && elem.ownerDocument != document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( ( matcher = elementMatchers[ j++ ] ) ) { + if ( matcher( elem, context || document, xml ) ) { + push.call( results, elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + + // They will have gone through all possible matchers + if ( ( elem = !matcher && elem ) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( ( matcher = setMatchers[ j++ ] ) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !( unmatched[ i ] || setMatched[ i ] ) ) { + setMatched[ i ] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + jQuery.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +function compile( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[ i ] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, + matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +} + +/** + * A low-level selection function that works with jQuery's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with jQuery selector compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +function select( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( ( selector = compiled.selector || selector ) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[ 0 ] = match[ 0 ].slice( 0 ); + if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) { + + context = ( Expr.find.ID( + token.matches[ 0 ].replace( runescape, funescape ), + context + ) || [] )[ 0 ]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr.needsContext.test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[ i ]; + + // Abort if we hit a combinator + if ( Expr.relative[ ( type = token.type ) ] ) { + break; + } + if ( ( find = Expr.find[ type ] ) ) { + + // Search, expanding context for leading sibling combinators + if ( ( seed = find( + token.matches[ 0 ].replace( runescape, funescape ), + rsibling.test( tokens[ 0 ].type ) && + testContext( context.parentNode ) || context + ) ) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +} + +// One-time assignments + +// Support: Android <=4.0 - 4.1+ +// Sort stability +support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando; + +// Initialize against the default document +setDocument(); + +// Support: Android <=4.0 - 4.1+ +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert( function( el ) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1; +} ); + +jQuery.find = find; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.unique = jQuery.uniqueSort; + +// These have always been private, but they used to be documented as part of +// Sizzle so let's maintain them for now for backwards compatibility purposes. +find.compile = compile; +find.select = select; +find.setDocument = setDocument; +find.tokenize = tokenize; + +find.escape = jQuery.escapeSelector; +find.getText = jQuery.text; +find.isXML = jQuery.isXMLDoc; +find.selectors = jQuery.expr; +find.support = jQuery.support; +find.uniqueSort = jQuery.uniqueSort; + + /* eslint-enable */ + +} )(); + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (trac-9521) + // Strict HTML recognition (trac-11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to jQuery#find + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, _i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, _i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, _i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto( elem.contentDocument ) ) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( _i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.error ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the error, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getErrorHook ) { + process.error = jQuery.Deferred.getErrorHook(); + + // The deprecated alias of the above. While the name suggests + // returning the stack, not an error instance, jQuery just passes + // it directly to `console.warn` so both will work; an instance + // just better cooperates with source maps. + } else if ( jQuery.Deferred.getStackHook ) { + process.error = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the primary Deferred + primary = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + primary.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( primary.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return primary.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject ); + } + + return primary.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +// If `jQuery.Deferred.getErrorHook` is defined, `asyncError` is an error +// captured before the async barrier to get the original error cause +// which may otherwise be hidden. +jQuery.Deferred.exceptionHook = function( error, asyncError ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, + error.stack, asyncError ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See trac-6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, _key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( _all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (trac-9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see trac-8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (trac-14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (trac-11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (trac-14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; +} )(); + + +// We have to close these tags to support XHTML (trac-13200) +var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
    " ], + col: [ 2, "", "
    " ], + tr: [ 2, "", "
    " ], + td: [ 3, "", "
    " ], + + _default: [ 0, "", "" ] +}; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// Support: IE <=9 only +if ( !support.option ) { + wrapMap.optgroup = wrapMap.option = [ 1, "" ]; +} + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (trac-15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (trac-12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +var rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Only attach events to objects that accept data + if ( !acceptData( elem ) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = Object.create( null ); + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( nativeEvent ), + + handlers = ( + dataPriv.get( this, "events" ) || Object.create( null ) + )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (trac-13208) + // Don't process clicks on disabled elements (trac-6911, trac-8165, trac-11382, trac-11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (trac-13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", true ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, isSetup ) { + + // Missing `isSetup` indicates a trigger call, which must force setup through jQuery.event.add + if ( !isSetup ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + if ( !saved ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + this[ type ](); + result = dataPriv.get( this, type ); + dataPriv.set( this, type, false ); + + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + + return result; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering + // the native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved ) { + + // ...and capture the result + dataPriv.set( this, type, jQuery.event.trigger( + saved[ 0 ], + saved.slice( 1 ), + this + ) ); + + // Abort handling of the native event by all jQuery handlers while allowing + // native handlers on the same element to run. On target, this is achieved + // by stopping immediate propagation just on the jQuery event. However, + // the native event is re-wrapped by a jQuery one on each level of the + // propagation so the only way to stop it for jQuery is to stop it for + // everyone via native `stopPropagation()`. This is not a problem for + // focus/blur which don't bubble, but it does also stop click on checkboxes + // and radios. We accept this limitation. + event.stopPropagation(); + event.isImmediatePropagationStopped = returnTrue; + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (trac-504, trac-13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + which: true +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + + function focusMappedHandler( nativeEvent ) { + if ( document.documentMode ) { + + // Support: IE 11+ + // Attach a single focusin/focusout handler on the document while someone wants + // focus/blur. This is because the former are synchronous in IE while the latter + // are async. In other browsers, all those handlers are invoked synchronously. + + // `handle` from private data would already wrap the event, but we need + // to change the `type` here. + var handle = dataPriv.get( this, "handle" ), + event = jQuery.event.fix( nativeEvent ); + event.type = nativeEvent.type === "focusin" ? "focus" : "blur"; + event.isSimulated = true; + + // First, handle focusin/focusout + handle( nativeEvent ); + + // ...then, handle focus/blur + // + // focus/blur don't bubble while focusin/focusout do; simulate the former by only + // invoking the handler at the lower level. + if ( event.target === event.currentTarget ) { + + // The setup part calls `leverageNative`, which, in turn, calls + // `jQuery.event.add`, so event handle will already have been set + // by this point. + handle( event ); + } + } else { + + // For non-IE browsers, attach a single capturing handler on the document + // while someone wants focusin/focusout. + jQuery.event.simulate( delegateType, nativeEvent.target, + jQuery.event.fix( nativeEvent ) ); + } + } + + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + var attaches; + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, true ); + + if ( document.documentMode ) { + + // Support: IE 9 - 11+ + // We use the same native handler for focusin & focus (and focusout & blur) + // so we need to coordinate setup & teardown parts between those events. + // Use `delegateType` as the key as `type` is already used by `leverageNative`. + attaches = dataPriv.get( this, delegateType ); + if ( !attaches ) { + this.addEventListener( delegateType, focusMappedHandler ); + } + dataPriv.set( this, delegateType, ( attaches || 0 ) + 1 ); + } else { + + // Return false to allow normal processing in the caller + return false; + } + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + teardown: function() { + var attaches; + + if ( document.documentMode ) { + attaches = dataPriv.get( this, delegateType ) - 1; + if ( !attaches ) { + this.removeEventListener( delegateType, focusMappedHandler ); + dataPriv.remove( this, delegateType ); + } else { + dataPriv.set( this, delegateType, attaches ); + } + } else { + + // Return false to indicate standard teardown should be applied + return false; + } + }, + + // Suppress native focus or blur if we're currently inside + // a leveraged native-event stack + _default: function( event ) { + return dataPriv.get( event.target, type ); + }, + + delegateType: delegateType + }; + + // Support: Firefox <=44 + // Firefox doesn't have focus(in | out) events + // Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 + // + // Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 + // focus(in | out) events fire after focus & blur events, + // which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order + // Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 + // + // Support: IE 9 - 11+ + // To preserve relative focusin/focus & focusout/blur event order guaranteed on the 3.x branch, + // attach a single handler for both events in IE. + jQuery.event.special[ delegateType ] = { + setup: function() { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + dataHolder = document.documentMode ? this : doc, + attaches = dataPriv.get( dataHolder, delegateType ); + + // Support: IE 9 - 11+ + // We use the same native handler for focusin & focus (and focusout & blur) + // so we need to coordinate setup & teardown parts between those events. + // Use `delegateType` as the key as `type` is already used by `leverageNative`. + if ( !attaches ) { + if ( document.documentMode ) { + this.addEventListener( delegateType, focusMappedHandler ); + } else { + doc.addEventListener( type, focusMappedHandler, true ); + } + } + dataPriv.set( dataHolder, delegateType, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this.document || this, + dataHolder = document.documentMode ? this : doc, + attaches = dataPriv.get( dataHolder, delegateType ) - 1; + + if ( !attaches ) { + if ( document.documentMode ) { + this.removeEventListener( delegateType, focusMappedHandler ); + } else { + doc.removeEventListener( type, focusMappedHandler, true ); + } + dataPriv.remove( dataHolder, delegateType ); + } else { + dataPriv.set( dataHolder, delegateType, attaches ); + } + } + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.get( src ); + events = pdataOld.events; + + if ( events ) { + dataPriv.remove( dest, "handle events" ); + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = flat( args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (trac-8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Re-enable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + }, doc ); + } + } else { + + // Unwrap a CDATA section containing script contents. This shouldn't be + // needed as in XML documents they're already not visible when + // inspecting element contents and in HTML documents they have no + // meaning but we're preserving that logic for backwards compatibility. + // This will be removed completely in 4.0. See gh-4904. + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html; + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew jQuery#find here for performance reasons: + // https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var rcustomProp = /^--/; + + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (trac-15098, trac-14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var swap = function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (trac-8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + // + // Support: Firefox 70+ + // Only Firefox includes border widths + // in computed dimensions. (gh-4529) + reliableTrDimensions: function() { + var table, tr, trChild, trStyle; + if ( reliableTrDimensionsVal == null ) { + table = document.createElement( "table" ); + tr = document.createElement( "tr" ); + trChild = document.createElement( "div" ); + + table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate"; + tr.style.cssText = "box-sizing:content-box;border:1px solid"; + + // Support: Chrome 86+ + // Height set through cssText does not get applied. + // Computed height then comes back as 0. + tr.style.height = "1px"; + trChild.style.height = "9px"; + + // Support: Android 8 Chrome 86+ + // In our bodyBackground.html iframe, + // display for all div elements is set to "inline", + // which causes a problem only in Android 8 Chrome 86. + // Ensuring the div is `display: block` + // gets around this issue. + trChild.style.display = "block"; + + documentElement + .appendChild( table ) + .appendChild( tr ) + .appendChild( trChild ); + + trStyle = window.getComputedStyle( tr ); + reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) + + parseInt( trStyle.borderTopWidth, 10 ) + + parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight; + + documentElement.removeChild( table ); + } + return reliableTrDimensionsVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + isCustomProp = rcustomProp.test( name ), + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, trac-12537) + // .css('--customProperty) (gh-3144) + if ( computed ) { + + // Support: IE <=9 - 11+ + // IE only supports `"float"` in `getPropertyValue`; in computed styles + // it's only available as `"cssFloat"`. We no longer modify properties + // sent to `.css()` apart from camelCasing, so we need to check both. + // Normally, this would create difference in behavior: if + // `getPropertyValue` returns an empty string, the value returned + // by `.css()` would be `undefined`. This is usually the case for + // disconnected elements. However, in IE even disconnected elements + // with no styles return `"none"` for `getPropertyValue( "float" )` + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( isCustomProp && ret ) { + + // Support: Firefox 105+, Chrome <=105+ + // Spec requires trimming whitespace for custom properties (gh-4926). + // Firefox only trims leading whitespace. Chrome just collapses + // both leading & trailing whitespace to a single space. + // + // Fall back to `undefined` if empty string returned. + // This collapses a missing definition with property defined + // and set to an empty string but there's no standard API + // allowing us to differentiate them without a performance penalty + // and returning `undefined` aligns with older jQuery. + // + // rtrimCSS treats U+000D CARRIAGE RETURN and U+000C FORM FEED + // as whitespace while CSS does not, but this is not a problem + // because CSS preprocessing replaces them with U+000A LINE FEED + // (which *is* CSS whitespace) + // https://www.w3.org/TR/css-syntax-3/#input-preprocessing + ret = ret.replace( rtrimCSS, "$1" ) || undefined; + } + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( _elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0, + marginDelta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + // Count margin delta separately to only add it after scroll gutter adjustment. + // This is needed to make negative margins work with `outerHeight( true )` (gh-3982). + if ( box === "margin" ) { + marginDelta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta + marginDelta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ( ( !support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName( elem, "tr" ) || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + + // Make sure the element is visible & connected + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + animationIterationCount: true, + aspectRatio: true, + borderImageSlice: true, + columnCount: true, + flexGrow: true, + flexShrink: true, + fontWeight: true, + gridArea: true, + gridColumn: true, + gridColumnEnd: true, + gridColumnStart: true, + gridRow: true, + gridRowEnd: true, + gridRowStart: true, + lineHeight: true, + opacity: true, + order: true, + orphans: true, + scale: true, + widows: true, + zIndex: true, + zoom: true, + + // SVG-related + fillOpacity: true, + floodOpacity: true, + stopOpacity: true, + strokeMiterlimit: true, + strokeOpacity: true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (trac-7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug trac-9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (trac-7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( _i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (trac-12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // Use proper attribute retrieval (trac-12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classNames, cur, curValue, className, i, finalValue; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classNames = classesToArray( value ); + + if ( classNames.length ) { + return this.each( function() { + curValue = getClass( this ); + cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + for ( i = 0; i < classNames.length; i++ ) { + className = classNames[ i ]; + if ( cur.indexOf( " " + className + " " ) < 0 ) { + cur += className + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + this.setAttribute( "class", finalValue ); + } + } + } ); + } + + return this; + }, + + removeClass: function( value ) { + var classNames, cur, curValue, className, i, finalValue; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classNames = classesToArray( value ); + + if ( classNames.length ) { + return this.each( function() { + curValue = getClass( this ); + + // This expression is here for better compressibility (see addClass) + cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + for ( i = 0; i < classNames.length; i++ ) { + className = classNames[ i ]; + + // Remove *all* instances + while ( cur.indexOf( " " + className + " " ) > -1 ) { + cur = cur.replace( " " + className + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + this.setAttribute( "class", finalValue ); + } + } + } ); + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var classNames, className, i, self, + type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + classNames = classesToArray( value ); + + return this.each( function() { + if ( isValidValue ) { + + // Toggle individual class names + self = jQuery( this ); + + for ( i = 0; i < classNames.length; i++ ) { + className = classNames[ i ]; + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (trac-14686, trac-14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (trac-2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion +var location = window.location; + +var nonce = { guid: Date.now() }; + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml, parserErrorElem; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) {} + + parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ]; + if ( !xml || parserErrorElem ) { + jQuery.error( "Invalid XML: " + ( + parserErrorElem ? + jQuery.map( parserErrorElem.childNodes, function( el ) { + return el.textContent; + } ).join( "\n" ) : + data + ) ); + } + return xml; +}; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (trac-9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (trac-9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (trac-6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ).filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ).map( function( _i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // trac-7653, trac-8125, trac-8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (trac-10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + +originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes trac-9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (trac-10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket trac-12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (trac-15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // trac-9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Use a noop converter for missing script but not if jsonp + if ( !isSuccess && + jQuery.inArray( "script", s.dataTypes ) > -1 && + jQuery.inArray( "json", s.dataTypes ) < 0 ) { + s.converters[ "text script" ] = function() {}; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( _i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + +jQuery.ajaxPrefilter( function( s ) { + var i; + for ( i in s.headers ) { + if ( i.toLowerCase() === "content-type" ) { + s.contentType = s.headers[ i ] || ""; + } + } +} ); + + +jQuery._evalUrl = function( url, options, doc ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (trac-11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options, doc ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // trac-1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see trac-8605, trac-14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // trac-14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( "